missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,5-Bis(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America B18861G
Specifications
| 3,5-Bis(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride) | |
| 220°C | |
| C8H5BF6O2 | |
| 1 g | |
| BPTABBGLHGBJQR-UHFFFAOYSA-N | |
| [3,5-bis(trifluoromethyl)phenyl]boronic acid | |
| 156265 | |
| Crystalline Powder |
| 73852-19-4 | |
| White-Yellow | |
| MFCD00051850 | |
| 3,5-bis trifluoromethyl phenylboronic acid, 3,5-bis trifluoromethyl benzeneboronic acid, 3,5-bis trifluoromethyl phenyl boronic acid, 3,5-bis-trifluoromethylphenylboronic acid, 3,5-bis trifluoromethylphenyl boronic acid, 3,5-bis trifluoromethyl phenylboroic acid, btfpba, 3,5-bis trifluoromethyl phenyl boranediol | |
| OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F | |
| 257.93 | |
| 257.93 |
Chemical Identifiers
| 73852-19-4 | |
| 257.93 | |
| BPTABBGLHGBJQR-UHFFFAOYSA-N | |
| 156265 | |
| OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| C8H5BF6O2 | |
| MFCD00051850 | |
| 3,5-bis trifluoromethyl phenylboronic acid, 3,5-bis trifluoromethyl benzeneboronic acid, 3,5-bis trifluoromethyl phenyl boronic acid, 3,5-bis-trifluoromethylphenylboronic acid, 3,5-bis trifluoromethylphenyl boronic acid, 3,5-bis trifluoromethyl phenylboroic acid, btfpba, 3,5-bis trifluoromethyl phenyl boranediol | |
| [3,5-bis(trifluoromethyl)phenyl]boronic acid |
Safety and Handling
TSCA : No