Methoxybenzoic acids and derivatives
- (4)
- (9)
- (5)
- (18)
- (4)
- (14)
- (3)
- (5)
- (6)
- (2)
- (6)
- (5)
- (1)
- (26)
- (22)
- (56)
- (33)
- (12)
- (12)
- (1)
- (2)
- (1)
- (72)
- (1)
- (120)
- (1)
- (1)
- (2)
- (11)
- (8)
- (2)
- (1)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
Filtered Search Results
3-Chloro-4-methoxybenzoic acid, 98+%
CAS: 37908-96-6 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00016512 InChI Key: IBCQUQXCTOPJOD-UHFFFAOYSA-N Synonym: 3-chloro-p-anisic acid,3-chloro-4-methoxybenzolic acid,benzoic acid, 3-chloro-4-methoxy,pubchem19130,acmc-209iw4,ksc494s0j,3-chloro-4-methoxybenzoicacid,rarechem al bo 2400,3-chloro-4-anisic acid,3-chloro-4-methoxy benzoic acid PubChem CID: 169982 IUPAC Name: 3-chloro-4-methoxybenzoic acid SMILES: COC1=C(C=C(C=C1)C(=O)O)Cl
| PubChem CID | 169982 |
|---|---|
| CAS | 37908-96-6 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00016512 |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)Cl |
| Synonym | 3-chloro-p-anisic acid,3-chloro-4-methoxybenzolic acid,benzoic acid, 3-chloro-4-methoxy,pubchem19130,acmc-209iw4,ksc494s0j,3-chloro-4-methoxybenzoicacid,rarechem al bo 2400,3-chloro-4-anisic acid,3-chloro-4-methoxy benzoic acid |
| IUPAC Name | 3-chloro-4-methoxybenzoic acid |
| InChI Key | IBCQUQXCTOPJOD-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
2-Bromo-5-methoxybenzoic acid, 98+%
CAS: 22921-68-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD00020214 InChI Key: ODHJOROUCITYNF-UHFFFAOYSA-N Synonym: 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid PubChem CID: 89906 IUPAC Name: 2-bromo-5-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)Br)C(=O)O
| PubChem CID | 89906 |
|---|---|
| CAS | 22921-68-2 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD00020214 |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
| Synonym | 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid |
| IUPAC Name | 2-bromo-5-methoxybenzoic acid |
| InChI Key | ODHJOROUCITYNF-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
3-Amino-4-methoxybenzoic acid, 98+%
CAS: 2840-26-8 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00002521 InChI Key: FDGAEAYZQQCBRN-UHFFFAOYSA-N Synonym: 3-amino-p-anisic acid,p-anisic acid, 3-amino,3-amino-4-methoxy-benzoic acid,3-amino-4-anisic acid,3-amino-4-methoxybenzoicacid,benzoic acid, 3-amino-4-methoxy,kyselina 3-amino-4-methoxybenzoova,3-amino-4-methoxybenzoic,5-carboxy-2-methoxyaniline,kyselina 3-amino-4-methoxybenzoova czech PubChem CID: 17823 IUPAC Name: 3-amino-4-methoxybenzoic acid SMILES: COC1=C(C=C(C=C1)C(=O)O)N
| PubChem CID | 17823 |
|---|---|
| CAS | 2840-26-8 |
| Molecular Weight (g/mol) | 167.164 |
| MDL Number | MFCD00002521 |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)N |
| Synonym | 3-amino-p-anisic acid,p-anisic acid, 3-amino,3-amino-4-methoxy-benzoic acid,3-amino-4-anisic acid,3-amino-4-methoxybenzoicacid,benzoic acid, 3-amino-4-methoxy,kyselina 3-amino-4-methoxybenzoova,3-amino-4-methoxybenzoic,5-carboxy-2-methoxyaniline,kyselina 3-amino-4-methoxybenzoova czech |
| IUPAC Name | 3-amino-4-methoxybenzoic acid |
| InChI Key | FDGAEAYZQQCBRN-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
4-Bromo-3,5-dimethoxybenzoic acid, 98%
CAS: 56518-42-4 Molecular Formula: C9H8BrO4 Molecular Weight (g/mol): 260.06 MDL Number: MFCD01632140 InChI Key: JNFZULSIYYVRJO-UHFFFAOYSA-M Synonym: benzoic acid, 4-bromo-3,5-dimethoxy,zlchem 1334,acmc-1az7r,jnfzulsiyyvrjo-uhfffaoysa,3,5-dimethoxy-4-bromobenzoic acid,4-bromo-3,5-dimethoxybenzoic acid PubChem CID: 2774026 IUPAC Name: 4-bromo-3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1Br)C([O-])=O
| PubChem CID | 2774026 |
|---|---|
| CAS | 56518-42-4 |
| Molecular Weight (g/mol) | 260.06 |
| MDL Number | MFCD01632140 |
| SMILES | COC1=CC(=CC(OC)=C1Br)C([O-])=O |
| Synonym | benzoic acid, 4-bromo-3,5-dimethoxy,zlchem 1334,acmc-1az7r,jnfzulsiyyvrjo-uhfffaoysa,3,5-dimethoxy-4-bromobenzoic acid,4-bromo-3,5-dimethoxybenzoic acid |
| IUPAC Name | 4-bromo-3,5-dimethoxybenzoic acid |
| InChI Key | JNFZULSIYYVRJO-UHFFFAOYSA-M |
| Molecular Formula | C9H8BrO4 |
2,4,5-Trimethoxybenzoic acid, 99%
CAS: 490-64-2 Molecular Formula: C10H11O5 Molecular Weight (g/mol): 211.19 MDL Number: MFCD00002435 InChI Key: KVZUCOGWKYOPID-UHFFFAOYSA-M Synonym: asaronic acid,benzoic acid, 2,4,5-trimethoxy,asarylic acid,calamonic acid,acmc-209ket,2,4,5-trimethoxybenzoicacid,ksc489o7d,2,4,5-trimethoxy-benzoic acid,2,4,5-trimethoxybenzoic acid,alpha-hydroxyphenylacetic acid; amygdalic acid; alpha-hydroxyphenylacetic acid; alpha-hydroxy-benzeneacetic acid PubChem CID: 10276 SMILES: COC1=CC(OC)=C(C=C1OC)C([O-])=O
| PubChem CID | 10276 |
|---|---|
| CAS | 490-64-2 |
| Molecular Weight (g/mol) | 211.19 |
| MDL Number | MFCD00002435 |
| SMILES | COC1=CC(OC)=C(C=C1OC)C([O-])=O |
| Synonym | asaronic acid,benzoic acid, 2,4,5-trimethoxy,asarylic acid,calamonic acid,acmc-209ket,2,4,5-trimethoxybenzoicacid,ksc489o7d,2,4,5-trimethoxy-benzoic acid,2,4,5-trimethoxybenzoic acid,alpha-hydroxyphenylacetic acid; amygdalic acid; alpha-hydroxyphenylacetic acid; alpha-hydroxy-benzeneacetic acid |
| InChI Key | KVZUCOGWKYOPID-UHFFFAOYSA-M |
| Molecular Formula | C10H11O5 |
2,3,4-Trimethoxybenzoic acid, 98+%
CAS: 573-11-5 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.201 MDL Number: MFCD00002433 InChI Key: HZNQSWJZTWOTKM-UHFFFAOYSA-N Synonym: benzoic acid, 2,3,4-trimethoxy,2,3,4-trimethoxybenzoicacid,2,3,4-trimethoxy-benzoic acid,trimethoxybenzoic acid,benzoic acid, trimethoxy,acmc-209lx4,ksc265s3r,2,3,4-trimethoxy benzoic acid,2,3,4-trimethoxybenzoic acid PubChem CID: 11308 IUPAC Name: 2,3,4-trimethoxybenzoic acid SMILES: COC1=C(C(=C(C=C1)C(=O)O)OC)OC
| PubChem CID | 11308 |
|---|---|
| CAS | 573-11-5 |
| Molecular Weight (g/mol) | 212.201 |
| MDL Number | MFCD00002433 |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)OC)OC |
| Synonym | benzoic acid, 2,3,4-trimethoxy,2,3,4-trimethoxybenzoicacid,2,3,4-trimethoxy-benzoic acid,trimethoxybenzoic acid,benzoic acid, trimethoxy,acmc-209lx4,ksc265s3r,2,3,4-trimethoxy benzoic acid,2,3,4-trimethoxybenzoic acid |
| IUPAC Name | 2,3,4-trimethoxybenzoic acid |
| InChI Key | HZNQSWJZTWOTKM-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
3,5-Dimethoxybenzoic acid, 99%
CAS: 1132-21-4 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002502 InChI Key: IWPZKOJSYQZABD-UHFFFAOYSA-N Synonym: benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy PubChem CID: 14332 IUPAC Name: 3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1)C(O)=O
| PubChem CID | 14332 |
|---|---|
| CAS | 1132-21-4 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002502 |
| SMILES | COC1=CC(=CC(OC)=C1)C(O)=O |
| Synonym | benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy |
| IUPAC Name | 3,5-dimethoxybenzoic acid |
| InChI Key | IWPZKOJSYQZABD-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
3,5-Dimethoxy-4-methylbenzoic acid, 97%
CAS: 61040-81-1 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.202 MDL Number: MFCD00017506 InChI Key: QIBMVRYNEXOCCF-UHFFFAOYSA-N Synonym: 3,5-dimethoxy-4-methyl-benzoic acid,benzoic acid,3,5-dimethoxy-4-methyl,3,5-dimethoxy-4-methylbenzoicacid,acmc-1b58y,3,5-dimethoxy4-methylbenzoic acid,4-methyl-3,5-dimethoxybenzoic acid,3,5-dimethoxy-p-toluic acid,labotest-bb lt00455447,3,5-dimethoxy-4-methyl benzoic acid,3,5-di-methoxy-4-methyl-benzoic acid PubChem CID: 3764486 IUPAC Name: 3,5-dimethoxy-4-methylbenzoic acid SMILES: CC1=C(C=C(C=C1OC)C(=O)O)OC
| PubChem CID | 3764486 |
|---|---|
| CAS | 61040-81-1 |
| Molecular Weight (g/mol) | 196.202 |
| MDL Number | MFCD00017506 |
| SMILES | CC1=C(C=C(C=C1OC)C(=O)O)OC |
| Synonym | 3,5-dimethoxy-4-methyl-benzoic acid,benzoic acid,3,5-dimethoxy-4-methyl,3,5-dimethoxy-4-methylbenzoicacid,acmc-1b58y,3,5-dimethoxy4-methylbenzoic acid,4-methyl-3,5-dimethoxybenzoic acid,3,5-dimethoxy-p-toluic acid,labotest-bb lt00455447,3,5-dimethoxy-4-methyl benzoic acid,3,5-di-methoxy-4-methyl-benzoic acid |
| IUPAC Name | 3,5-dimethoxy-4-methylbenzoic acid |
| InChI Key | QIBMVRYNEXOCCF-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
4-Methoxy-2-methylbenzoic acid, 97%
CAS: 6245-57-4 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00020291 InChI Key: MSVRGYOYISBGTH-UHFFFAOYSA-N Synonym: 2-methyl-4-methoxybenzoic acid,4-methoxy-2-methyl-benzoic acid,2-methyl-p-anisic acid,benzoic acid, 4-methoxy-2-methyl,4-methoxy-o-toluic acid,acmc-209x9h,ksc495k2d,2-methyl-4-methoxybenzoicacid,2-methyl-4-methoxy-benzoic acid,4-methoxy-2-methyl benzoic acid PubChem CID: 597216 IUPAC Name: 4-methoxy-2-methylbenzoic acid SMILES: COC1=CC(C)=C(C=C1)C(O)=O
| PubChem CID | 597216 |
|---|---|
| CAS | 6245-57-4 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00020291 |
| SMILES | COC1=CC(C)=C(C=C1)C(O)=O |
| Synonym | 2-methyl-4-methoxybenzoic acid,4-methoxy-2-methyl-benzoic acid,2-methyl-p-anisic acid,benzoic acid, 4-methoxy-2-methyl,4-methoxy-o-toluic acid,acmc-209x9h,ksc495k2d,2-methyl-4-methoxybenzoicacid,2-methyl-4-methoxy-benzoic acid,4-methoxy-2-methyl benzoic acid |
| IUPAC Name | 4-methoxy-2-methylbenzoic acid |
| InChI Key | MSVRGYOYISBGTH-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
3-Methoxybenzoic acid, 99%
CAS: 586-38-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002499 InChI Key: XHQZJYCNDZAGLW-UHFFFAOYSA-N Synonym: m-anisic acid,m-methoxybenzoic acid,benzoic acid, 3-methoxy,3-anisic acid,meta-anisic acid,3-methoxy-benzoic acid,unii-e2i36fh6qz,m-methylsalicylic acid,e2i36fh6qz,chembl22425 PubChem CID: 11461 IUPAC Name: 3-methoxybenzoic acid SMILES: COC1=CC=CC(=C1)C(=O)O
| PubChem CID | 11461 |
|---|---|
| CAS | 586-38-9 |
| Molecular Weight (g/mol) | 152.149 |
| MDL Number | MFCD00002499 |
| SMILES | COC1=CC=CC(=C1)C(=O)O |
| Synonym | m-anisic acid,m-methoxybenzoic acid,benzoic acid, 3-methoxy,3-anisic acid,meta-anisic acid,3-methoxy-benzoic acid,unii-e2i36fh6qz,m-methylsalicylic acid,e2i36fh6qz,chembl22425 |
| IUPAC Name | 3-methoxybenzoic acid |
| InChI Key | XHQZJYCNDZAGLW-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
3-Methoxy-4-methylbenzoic acid, 99%
CAS: 7151-68-0 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002566 InChI Key: CEAVPXDEPGAVDA-UHFFFAOYSA-N Synonym: 4-methyl-m-anisic acid,3-methoxy-p-toluic acid,benzoic acid, 3-methoxy-4-methyl,3-methoxy-4-methyl-benzoic acid,3-methoxy-4-methyl benzoic acid,3-methoxy-p-toluic acid; 4-methyl-m-anisic acid,3-methoxy-4-methylbenzoicacid,pubchem2672,5-carboxy-2-methylanisole,acmc-209oj0 PubChem CID: 81579 IUPAC Name: 3-methoxy-4-methylbenzoic acid SMILES: COC1=CC(=CC=C1C)C(O)=O
| PubChem CID | 81579 |
|---|---|
| CAS | 7151-68-0 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00002566 |
| SMILES | COC1=CC(=CC=C1C)C(O)=O |
| Synonym | 4-methyl-m-anisic acid,3-methoxy-p-toluic acid,benzoic acid, 3-methoxy-4-methyl,3-methoxy-4-methyl-benzoic acid,3-methoxy-4-methyl benzoic acid,3-methoxy-p-toluic acid; 4-methyl-m-anisic acid,3-methoxy-4-methylbenzoicacid,pubchem2672,5-carboxy-2-methylanisole,acmc-209oj0 |
| IUPAC Name | 3-methoxy-4-methylbenzoic acid |
| InChI Key | CEAVPXDEPGAVDA-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
4-Methoxybenzoic anhydride, 98%
CAS: 794-94-5 Molecular Formula: C16H14O5 Molecular Weight (g/mol): 286.283 MDL Number: MFCD00017175 InChI Key: YGMHIBLUWGDWKP-UHFFFAOYSA-N Synonym: 4-methoxybenzoic anhydride,p-anisic anhydride,p-anisic acid anhydride,benzoic acid, 4-methoxy-, anhydride,p-methoxybenzoic anhydride,4-anisic anhydride,4-methoxybenzoic acid anhydride,4-methoxybenzoyl 4-methoxybenzoate,4-methoxyphenyl anhydride,anisic anhydride PubChem CID: 69928 IUPAC Name: (4-methoxybenzoyl) 4-methoxybenzoate SMILES: COC1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)OC
| PubChem CID | 69928 |
|---|---|
| CAS | 794-94-5 |
| Molecular Weight (g/mol) | 286.283 |
| MDL Number | MFCD00017175 |
| SMILES | COC1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)OC |
| Synonym | 4-methoxybenzoic anhydride,p-anisic anhydride,p-anisic acid anhydride,benzoic acid, 4-methoxy-, anhydride,p-methoxybenzoic anhydride,4-anisic anhydride,4-methoxybenzoic acid anhydride,4-methoxybenzoyl 4-methoxybenzoate,4-methoxyphenyl anhydride,anisic anhydride |
| IUPAC Name | (4-methoxybenzoyl) 4-methoxybenzoate |
| InChI Key | YGMHIBLUWGDWKP-UHFFFAOYSA-N |
| Molecular Formula | C16H14O5 |
Methyl 3-methoxy-4-methylbenzoate, 98%
CAS: 3556-83-0 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00082710 InChI Key: LLEXCSBUSVRBCA-UHFFFAOYSA-N Synonym: 3-methoxy-4-methylbenzoic acid methyl ester,methyl 3-methoxy-p-toluate,4-methyl-m-anisic acid methyl ester,benzoic acid, 3-methoxy-4-methyl-, methyl ester,pubchem13650,methyl 4-methyl-m-anisate,acmc-1cs22,methyl3-methoxy-4-methylbenzoate,methyl 3-methoxy-4-methyl-benzoate,3-methoxy-p-toluic acid methyl ester PubChem CID: 591123 IUPAC Name: methyl 3-methoxy-4-methylbenzoate SMILES: CC1=C(C=C(C=C1)C(=O)OC)OC
| PubChem CID | 591123 |
|---|---|
| CAS | 3556-83-0 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00082710 |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)OC |
| Synonym | 3-methoxy-4-methylbenzoic acid methyl ester,methyl 3-methoxy-p-toluate,4-methyl-m-anisic acid methyl ester,benzoic acid, 3-methoxy-4-methyl-, methyl ester,pubchem13650,methyl 4-methyl-m-anisate,acmc-1cs22,methyl3-methoxy-4-methylbenzoate,methyl 3-methoxy-4-methyl-benzoate,3-methoxy-p-toluic acid methyl ester |
| IUPAC Name | methyl 3-methoxy-4-methylbenzoate |
| InChI Key | LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 3-iodo-4-methoxybenzoate, 98%
CAS: 35387-93-0 Molecular Formula: C9H9IO3 Molecular Weight (g/mol): 292.07 MDL Number: MFCD00052925 InChI Key: GHNGBFHLUOJHKP-UHFFFAOYSA-N Synonym: 3-iodo-4-methoxy-benzoic acid methyl ester,3-iodo-4-methoxybenzoic acid methyl ester,benzoic acid, 3-iodo-4-methoxy-, methyl ester,methyl3-iodo-4-methoxybenzoate,methyl 3-iodo-p-anisate,acmc-1agb4,ksc495q3h,methyl-3-iodo-4-methoxybenzoate,methyl 3-iodo-4-methoxy-benzoate,3-iodo-p-anisic acid methyl ester PubChem CID: 316980 IUPAC Name: methyl 3-iodo-4-methoxybenzoate SMILES: COC(=O)C1=CC=C(OC)C(I)=C1
| PubChem CID | 316980 |
|---|---|
| CAS | 35387-93-0 |
| Molecular Weight (g/mol) | 292.07 |
| MDL Number | MFCD00052925 |
| SMILES | COC(=O)C1=CC=C(OC)C(I)=C1 |
| Synonym | 3-iodo-4-methoxy-benzoic acid methyl ester,3-iodo-4-methoxybenzoic acid methyl ester,benzoic acid, 3-iodo-4-methoxy-, methyl ester,methyl3-iodo-4-methoxybenzoate,methyl 3-iodo-p-anisate,acmc-1agb4,ksc495q3h,methyl-3-iodo-4-methoxybenzoate,methyl 3-iodo-4-methoxy-benzoate,3-iodo-p-anisic acid methyl ester |
| IUPAC Name | methyl 3-iodo-4-methoxybenzoate |
| InChI Key | GHNGBFHLUOJHKP-UHFFFAOYSA-N |
| Molecular Formula | C9H9IO3 |
Methyl 3-bromo-4-methoxybenzoate, 98%
CAS: 35450-37-4 Molecular Formula: C9H9BrO3 Molecular Weight (g/mol): 245.07 MDL Number: MFCD00210463 InChI Key: ZREVPFANJBZHEU-UHFFFAOYSA-N Synonym: 3-bromo-4-methoxybenzoic acid methyl ester,methyl3-bromo-4-methoxybenzoate,benzoic acid, 3-bromo-4-methoxy-, methyl ester,acmc-209igx,methyl 3-bromo-p-anisate,rarechem al bf 0247,methyl-3-bromo-4-methoxybenzoate,3-bromo-p-anisic acid methyl ester,#,methyl 3-bromo-4-methyloxy benzoate PubChem CID: 611662 IUPAC Name: methyl 3-bromo-4-methoxybenzoate SMILES: COC(=O)C1=CC(Br)=C(OC)C=C1
| PubChem CID | 611662 |
|---|---|
| CAS | 35450-37-4 |
| Molecular Weight (g/mol) | 245.07 |
| MDL Number | MFCD00210463 |
| SMILES | COC(=O)C1=CC(Br)=C(OC)C=C1 |
| Synonym | 3-bromo-4-methoxybenzoic acid methyl ester,methyl3-bromo-4-methoxybenzoate,benzoic acid, 3-bromo-4-methoxy-, methyl ester,acmc-209igx,methyl 3-bromo-p-anisate,rarechem al bf 0247,methyl-3-bromo-4-methoxybenzoate,3-bromo-p-anisic acid methyl ester,#,methyl 3-bromo-4-methyloxy benzoate |
| IUPAC Name | methyl 3-bromo-4-methoxybenzoate |
| InChI Key | ZREVPFANJBZHEU-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO3 |