Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
- (3)
- (21)
- (61)
- (1)
- (1)
- (1)
- (3)
- (19)
- (2)
- (6)
- (1)
- (3)
- (1)
- (7)
- (18)
- (10)
- (4)
- (57)
- (1)
- (16)
- (10)
- (2)
- (10)
- (9)
- (26)
- (3)
- (2)
- (1)
- (6)
- (8)
- (7)
- (5)
- (1)
- (1)
- (2)
- (1)
- (1)
Résultats de la recherche filtrée
Xylenes (Histological), Fisher Chemical™
CAS: 1330-20-7 Formule moléculaire: C8H10 Numéro MDL: MFCD00077264 Synonyme: Xylol,Dimethylbenzene
| Synonyme | Xylol,Dimethylbenzene |
|---|---|
| Numéro MDL | MFCD00077264 |
| CAS | 1330-20-7 |
| Formule moléculaire | C8H10 |
| Numéro MDL | MFCD00077264 |
|---|---|
| CAS | 1330-20-7 |
o-Xylene (Certified), Fisher Chemical
CAS: 95-47-6 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008519 Clé InChI: CTQNGGLPUBDAKN-UHFFFAOYSA-N Synonyme: o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes CID PubChem: 7237 ChEBI: CHEBI:28063 Nom IUPAC: 1,2-xylene SMILES: CC1=CC=CC=C1C
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes |
| Numéro MDL | MFCD00008519 |
| CAS | 95-47-6 |
| CID PubChem | 7237 |
| ChEBI | CHEBI:28063 |
| Nom IUPAC | 1,2-xylene |
| Clé InChI | CTQNGGLPUBDAKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C |
| Formule moléculaire | C8H10 |
4-Nitro-o-xylene, 99%
CAS: 99-51-4 Formule moléculaire: C8H9NO2 Poids moléculaire (g/mol): 151.17 Numéro MDL: MFCD00007268 Clé InChI: HFZKOYWDLDYELC-UHFFFAOYSA-N Synonyme: 4-nitro-o-xylene,p-nitro-o-xylene,o-xylene, 4-nitro,benzene, 1,2-dimethyl-4-nitro,para-nitro-ortho-xylene,3,4-dimethyl-1-nitrobenzene,4-nitro-1,2-dimethylbenzene,1,2-dimethyl-4-nitrobenzol,3,4-dimethylnitrobenzene,ccris 3118 CID PubChem: 7440 Nom IUPAC: 1,2-dimethyl-4-nitrobenzene SMILES: CC1=CC=C(C=C1C)[N+]([O-])=O
| Poids moléculaire (g/mol) | 151.17 |
|---|---|
| Synonyme | 4-nitro-o-xylene,p-nitro-o-xylene,o-xylene, 4-nitro,benzene, 1,2-dimethyl-4-nitro,para-nitro-ortho-xylene,3,4-dimethyl-1-nitrobenzene,4-nitro-1,2-dimethylbenzene,1,2-dimethyl-4-nitrobenzol,3,4-dimethylnitrobenzene,ccris 3118 |
| Numéro MDL | MFCD00007268 |
| CAS | 99-51-4 |
| CID PubChem | 7440 |
| Nom IUPAC | 1,2-dimethyl-4-nitrobenzene |
| Clé InChI | HFZKOYWDLDYELC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1C)[N+]([O-])=O |
| Formule moléculaire | C8H9NO2 |
p-Xylene, 99%, for HPLC
CAS: 106-42-3 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008556 Clé InChI: URLKBWYHVLBVBO-UHFFFAOYSA-N Synonyme: p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene CID PubChem: 7809 ChEBI: CHEBI:27417 Nom IUPAC: 1,4-xylene SMILES: CC1=CC=C(C)C=C1
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene |
| Numéro MDL | MFCD00008556 |
| CAS | 106-42-3 |
| CID PubChem | 7809 |
| ChEBI | CHEBI:27417 |
| Nom IUPAC | 1,4-xylene |
| Clé InChI | URLKBWYHVLBVBO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C)C=C1 |
| Formule moléculaire | C8H10 |
2,6-Dimethylaniline, 99%
CAS: 87-62-7 Formule moléculaire: C8H11N Poids moléculaire (g/mol): 121.18 Numéro MDL: MFCD00007747 Clé InChI: UFFBMTHBGFGIHF-UHFFFAOYSA-N Synonyme: 2,6-xylidine,2-amino-m-xylene,o-xylidine,2,6-dimethylbenzenamine,2-amino-1,3-dimethylbenzene,2,6-dimethylphenylamine,benzenamine, 2,6-dimethyl,2,6-xylylamine,2-amino-1,3-xylene,1-amino-2,6-dimethylbenzene CID PubChem: 6896 ChEBI: CHEBI:28738 Nom IUPAC: 2,6-dimethylaniline SMILES: CC1=CC=CC(C)=C1N
| Poids moléculaire (g/mol) | 121.18 |
|---|---|
| Synonyme | 2,6-xylidine,2-amino-m-xylene,o-xylidine,2,6-dimethylbenzenamine,2-amino-1,3-dimethylbenzene,2,6-dimethylphenylamine,benzenamine, 2,6-dimethyl,2,6-xylylamine,2-amino-1,3-xylene,1-amino-2,6-dimethylbenzene |
| Numéro MDL | MFCD00007747 |
| CAS | 87-62-7 |
| CID PubChem | 6896 |
| ChEBI | CHEBI:28738 |
| Nom IUPAC | 2,6-dimethylaniline |
| Clé InChI | UFFBMTHBGFGIHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(C)=C1N |
| Formule moléculaire | C8H11N |
2,4-Dimethylaniline, 99%
CAS: 95-68-1 Formule moléculaire: C8H11N Poids moléculaire (g/mol): 121.18 Numéro MDL: MFCD00007738 Clé InChI: CZZZABOKJQXEBO-UHFFFAOYSA-N Synonyme: 2,4-xylidine,2,4-dimethyl aniline,m-xylidine,m-4-xylidine,2,4-dimethylphenylamine,benzenamine, 2,4-dimethyl,2-methyl-p-toluidine,4-methyl-o-toluidine,1-amino-2,4-dimethylbenzene,4-amino-1,3-xylene CID PubChem: 7250 ChEBI: CHEBI:27840 Nom IUPAC: 2,4-dimethylaniline SMILES: CC1=CC(=C(C=C1)N)C
| Poids moléculaire (g/mol) | 121.18 |
|---|---|
| Synonyme | 2,4-xylidine,2,4-dimethyl aniline,m-xylidine,m-4-xylidine,2,4-dimethylphenylamine,benzenamine, 2,4-dimethyl,2-methyl-p-toluidine,4-methyl-o-toluidine,1-amino-2,4-dimethylbenzene,4-amino-1,3-xylene |
| Numéro MDL | MFCD00007738 |
| CAS | 95-68-1 |
| CID PubChem | 7250 |
| ChEBI | CHEBI:27840 |
| Nom IUPAC | 2,4-dimethylaniline |
| Clé InChI | CZZZABOKJQXEBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C |
| Formule moléculaire | C8H11N |
Xylenes, 98+%, for analysis, mixture of isomers
CAS: 1330-20-7 Formule moléculaire: C8H10 Synonyme: Dimethylbenzene
| Synonyme | Dimethylbenzene |
|---|---|
| CAS | 1330-20-7 |
| Formule moléculaire | C8H10 |
4-Iodo-o-xylene, 98+%
CAS: 31599-61-8 Formule moléculaire: C8H9I Poids moléculaire (g/mol): 232.064 Numéro MDL: MFCD00040989 Clé InChI: CSFRCLYFVINMBZ-UHFFFAOYSA-N Synonyme: 4-iodo-o-xylene,1,2-dimethyl-4-iodobenzene,benzene, 4-iodo-1,2-dimethyl,3,4-dimethyliodobenzene,1-iodo-3,4-dimethylbenzene,4-iodo-ortho-xylene,3,4-dimethyl-1-iodobenzene,4-iodo-orthoxylene,4-iodo-0-xylene,pubchem3105 CID PubChem: 141646 Nom IUPAC: 4-iodo-1,2-dimethylbenzene SMILES: CC1=C(C=C(C=C1)I)C
| Poids moléculaire (g/mol) | 232.064 |
|---|---|
| Synonyme | 4-iodo-o-xylene,1,2-dimethyl-4-iodobenzene,benzene, 4-iodo-1,2-dimethyl,3,4-dimethyliodobenzene,1-iodo-3,4-dimethylbenzene,4-iodo-ortho-xylene,3,4-dimethyl-1-iodobenzene,4-iodo-orthoxylene,4-iodo-0-xylene,pubchem3105 |
| Numéro MDL | MFCD00040989 |
| CAS | 31599-61-8 |
| CID PubChem | 141646 |
| Nom IUPAC | 4-iodo-1,2-dimethylbenzene |
| Clé InChI | CSFRCLYFVINMBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C |
| Formule moléculaire | C8H9I |
2,3-Dimethylphenyl isocyanate, 99%
CAS: 1591-99-7 Formule moléculaire: C9H9NO Poids moléculaire (g/mol): 147.177 Numéro MDL: MFCD00013851 Clé InChI: KNHJIEOCVVIBIV-UHFFFAOYSA-N Synonyme: 2,3-dimethylphenyl isocyanate,2,3-dimethylphenylisocyanate,benzene, isocyanatodimethyl,2,3-dimethylbenzenisocyanate,dimethylphenyl isocyanate,acmc-1bttc,1-isocyanato-2,3-dimethyl-benzene,#,benzene,1-isocyanato-2,3-dimethyl CID PubChem: 137096 ChEBI: CHEBI:63899 Nom IUPAC: 1-isocyanato-2,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)N=C=O)C
| Poids moléculaire (g/mol) | 147.177 |
|---|---|
| Synonyme | 2,3-dimethylphenyl isocyanate,2,3-dimethylphenylisocyanate,benzene, isocyanatodimethyl,2,3-dimethylbenzenisocyanate,dimethylphenyl isocyanate,acmc-1bttc,1-isocyanato-2,3-dimethyl-benzene,#,benzene,1-isocyanato-2,3-dimethyl |
| Numéro MDL | MFCD00013851 |
| CAS | 1591-99-7 |
| CID PubChem | 137096 |
| ChEBI | CHEBI:63899 |
| Nom IUPAC | 1-isocyanato-2,3-dimethylbenzene |
| Clé InChI | KNHJIEOCVVIBIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N=C=O)C |
| Formule moléculaire | C9H9NO |
2-Iodo-p-xylene, 98+%
CAS: 1122-42-5 Formule moléculaire: C8H9I Poids moléculaire (g/mol): 232.064 Numéro MDL: MFCD00013708 Clé InChI: WYZVNUSNUCABRF-UHFFFAOYSA-N Synonyme: 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 CID PubChem: 70731 Nom IUPAC: 2-iodo-1,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)C)I
| Poids moléculaire (g/mol) | 232.064 |
|---|---|
| Synonyme | 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 |
| Numéro MDL | MFCD00013708 |
| CAS | 1122-42-5 |
| CID PubChem | 70731 |
| Nom IUPAC | 2-iodo-1,4-dimethylbenzene |
| Clé InChI | WYZVNUSNUCABRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)I |
| Formule moléculaire | C8H9I |
3,3',4,4'-Tetramethylbiphenyl, 98%
CAS: 4920-95-0 Formule moléculaire: C16H18 Poids moléculaire (g/mol): 210.32 Numéro MDL: MFCD00130219 Clé InChI: YXBIAYXZUDJVEB-UHFFFAOYSA-N Synonyme: 3,3',4,4'-tetramethylbiphenyl,3,3',4,4'-tetramethyl-1,1'-biphenyl,3,4,3',4'-tetramethylbiphenyl,1,1'-biphenyl, 3,3',4,4'-tetramethyl,biphenyl, 3,3',4,4'-tetramethyl,3,3',4,4'-tetramethyldiphenyl,4-3,4-dimethylphenyl-1,2-dimethylbenzene,acmc-20anh7,amtda180,4-05-00-01956 beilstein handbook reference CID PubChem: 21029 Nom IUPAC: 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene SMILES: CC1=CC=C(C=C1C)C1=CC=C(C)C(C)=C1
| Poids moléculaire (g/mol) | 210.32 |
|---|---|
| Synonyme | 3,3',4,4'-tetramethylbiphenyl,3,3',4,4'-tetramethyl-1,1'-biphenyl,3,4,3',4'-tetramethylbiphenyl,1,1'-biphenyl, 3,3',4,4'-tetramethyl,biphenyl, 3,3',4,4'-tetramethyl,3,3',4,4'-tetramethyldiphenyl,4-3,4-dimethylphenyl-1,2-dimethylbenzene,acmc-20anh7,amtda180,4-05-00-01956 beilstein handbook reference |
| Numéro MDL | MFCD00130219 |
| CAS | 4920-95-0 |
| CID PubChem | 21029 |
| Nom IUPAC | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene |
| Clé InChI | YXBIAYXZUDJVEB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1C)C1=CC=C(C)C(C)=C1 |
| Formule moléculaire | C16H18 |
2-Iodo-4,6-dimethylaniline, 98%, Thermo Scientific Chemicals
CAS: 4102-54-9 Formule moléculaire: C8H10IN Poids moléculaire (g/mol): 247.079 Numéro MDL: MFCD07779005 Clé InChI: ODPOIEACUVQCBZ-UHFFFAOYSA-N Synonyme: 2,4-dimethyl-6-iodoaniline,2-iodo-4,6-di-methylaniline,benzenamine,2-iodo-4,6-dimethyl CID PubChem: 14040290 Nom IUPAC: 2-iodo-4,6-dimethylaniline SMILES: CC1=CC(=C(C(=C1)I)N)C
| Poids moléculaire (g/mol) | 247.079 |
|---|---|
| Synonyme | 2,4-dimethyl-6-iodoaniline,2-iodo-4,6-di-methylaniline,benzenamine,2-iodo-4,6-dimethyl |
| Numéro MDL | MFCD07779005 |
| CAS | 4102-54-9 |
| CID PubChem | 14040290 |
| Nom IUPAC | 2-iodo-4,6-dimethylaniline |
| Clé InChI | ODPOIEACUVQCBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)I)N)C |
| Formule moléculaire | C8H10IN |
3,5-Dimethylaniline, 97+%
CAS: 108-69-0 Formule moléculaire: C8H11N Poids moléculaire (g/mol): 121.183 Numéro MDL: MFCD00007813 Clé InChI: MKARNSWMMBGSHX-UHFFFAOYSA-N Synonyme: 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene CID PubChem: 7949 Nom IUPAC: 3,5-dimethylaniline SMILES: CC1=CC(=CC(=C1)N)C
| Poids moléculaire (g/mol) | 121.183 |
|---|---|
| Synonyme | 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene |
| Numéro MDL | MFCD00007813 |
| CAS | 108-69-0 |
| CID PubChem | 7949 |
| Nom IUPAC | 3,5-dimethylaniline |
| Clé InChI | MKARNSWMMBGSHX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N)C |
| Formule moléculaire | C8H11N |
o-Xylene, HPLC Grade, 96% min
CAS: 95-47-6 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008519 Clé InChI: CTQNGGLPUBDAKN-UHFFFAOYSA-N Synonyme: o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes CID PubChem: 7237 ChEBI: CHEBI:28063 Nom IUPAC: 1,2-xylene SMILES: CC1=CC=CC=C1C
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes |
| Numéro MDL | MFCD00008519 |
| CAS | 95-47-6 |
| CID PubChem | 7237 |
| ChEBI | CHEBI:28063 |
| Nom IUPAC | 1,2-xylene |
| Clé InChI | CTQNGGLPUBDAKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C |
| Formule moléculaire | C8H10 |