Organic cations
- (1)
- (50)
- (2)
- (3)
- (2)
- (1)
- (11)
- (5)
- (2)
- (3)
- (2)
- (6)
- (1)
- (3)
- (2)
- (1)
- (3)
- (1)
- (9)
- (2)
- (1)
- (2)
- (2)
- (3)
- (4)
- (82)
- (2)
- (2)
- (1)
- (2)
- (2)
- (24)
- (2)
- (3)
- (1)
- (1)
- (3)
- (2)
- (2)
- (2)
Filtered Search Results
N-tert-Butyl-α-phenylnitrone, ≥99.5% (HPLC), MilliporeSigma™ Supelco™
MDL Number: MFCD00008799 Synonym: N-Benzylidene-tert-butylamine N-oxide; PBN; Phenyl N-t-butylnitrone
| MDL Number | MFCD00008799 |
|---|---|
| Synonym | N-Benzylidene-tert-butylamine N-oxide; PBN; Phenyl N-t-butylnitrone |
LiChropur™ Trimethylsulfonium hydroxide Solution, ∼0.25 M in Methanol, MilliporeSigma™ Supelco™
MDL Number: MFCD00216756 Synonym: TMSH
| MDL Number | MFCD00216756 |
|---|---|
| Synonym | TMSH |
MilliporeSigma™ Cacodylic Acid, Sodium Salt, Trihydrate, Calbiochem™,
CAS: 6131-99-3 Molecular Formula: C2H12AsNaO5 Molecular Weight (g/mol): 214.024 InChI Key: RLGWPHBPRCROJO-UHFFFAOYSA-M Synonym: sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate PubChem CID: 23679059 IUPAC Name: sodium;dimethylarsinate;trihydrate SMILES: C[As](=O)(C)[O-].O.O.O.[Na+]
| PubChem CID | 23679059 |
|---|---|
| CAS | 6131-99-3 |
| Molecular Weight (g/mol) | 214.024 |
| SMILES | C[As](=O)(C)[O-].O.O.O.[Na+] |
| Synonym | sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate |
| IUPAC Name | sodium;dimethylarsinate;trihydrate |
| InChI Key | RLGWPHBPRCROJO-UHFFFAOYSA-M |
| Molecular Formula | C2H12AsNaO5 |
Sodium aurothiomalate(I), 99.9% (metals basis)
CAS: 12244-57-4 Molecular Formula: C4H5AuNa2O5S Molecular Weight (g/mol): 408.09 MDL Number: MFCD00064304,MFCD00064304 InChI Key: YLQOAPBVYJCTPW-UHFFFAOYNA-K Synonym: gold sodium thiomalate PubChem CID: 133108869 IUPAC Name: gold;sodium;2-sulfanylbutanedioic acid SMILES: O.[Na+].[Na+].[Au+].[O-]C(=O)CC([S-])C([O-])=O
| PubChem CID | 133108869 |
|---|---|
| CAS | 12244-57-4 |
| Molecular Weight (g/mol) | 408.09 |
| MDL Number | MFCD00064304,MFCD00064304 |
| SMILES | O.[Na+].[Na+].[Au+].[O-]C(=O)CC([S-])C([O-])=O |
| Synonym | gold sodium thiomalate |
| IUPAC Name | gold;sodium;2-sulfanylbutanedioic acid |
| InChI Key | YLQOAPBVYJCTPW-UHFFFAOYNA-K |
| Molecular Formula | C4H5AuNa2O5S |
Chloropentacarbonylrhenium(I), 98%
CAS: 14099-01-5 Molecular Formula: C5ClO5Re Molecular Weight (g/mol): 361.707 MDL Number: MFCD00013296 InChI Key: JQUUAHKBIXPQAP-UHFFFAOYSA-M Synonym: pentacarbonylchlororhenium,carbon monoxide; chlororhenium,pentakis carbon monoxide ; chlororhenium,5co.clre,rhenium i pentacarbonyl chloride,pentacarbonylchlororhenium i PubChem CID: 6096982 IUPAC Name: carbon monoxide;chlororhenium SMILES: [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].Cl[Re]
| PubChem CID | 6096982 |
|---|---|
| CAS | 14099-01-5 |
| Molecular Weight (g/mol) | 361.707 |
| MDL Number | MFCD00013296 |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].Cl[Re] |
| Synonym | pentacarbonylchlororhenium,carbon monoxide; chlororhenium,pentakis carbon monoxide ; chlororhenium,5co.clre,rhenium i pentacarbonyl chloride,pentacarbonylchlororhenium i |
| IUPAC Name | carbon monoxide;chlororhenium |
| InChI Key | JQUUAHKBIXPQAP-UHFFFAOYSA-M |
| Molecular Formula | C5ClO5Re |
Dimethylanilinium Tetrakis (pentafluorophenyl)borate, 98%
CAS: 118612-00-3 Molecular Formula: C32H12BF20N Molecular Weight (g/mol): 801.23 MDL Number: MFCD01074420 InChI Key: BRHZQNMGSKUUMN-UHFFFAOYSA-O Synonym: dimethylanilinium tetrakis pentafluorophenyl borate,unii-h8r86l92nd,n,n-dimethylanilinium tetrakis pentafluorophenyl borate,n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate,n,n-dimethylanilinium tetra pentafluorophenyl borate,benzene, pentafluoro-, boron complex,n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-,benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-,dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate,borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 PubChem CID: 10996402 IUPAC Name: dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide SMILES: [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1
| PubChem CID | 10996402 |
|---|---|
| CAS | 118612-00-3 |
| Molecular Weight (g/mol) | 801.23 |
| MDL Number | MFCD01074420 |
| SMILES | [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1 |
| Synonym | dimethylanilinium tetrakis pentafluorophenyl borate,unii-h8r86l92nd,n,n-dimethylanilinium tetrakis pentafluorophenyl borate,n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate,n,n-dimethylanilinium tetra pentafluorophenyl borate,benzene, pentafluoro-, boron complex,n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-,benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-,dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate,borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 |
| IUPAC Name | dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChI Key | BRHZQNMGSKUUMN-UHFFFAOYSA-O |
| Molecular Formula | C32H12BF20N |
Rhenium pentacarbonyl chloride, 98%
CAS: 14099-01-5 Molecular Formula: C5ClO5Re Molecular Weight (g/mol): 361.71 MDL Number: MFCD00013296 InChI Key: JQUUAHKBIXPQAP-UHFFFAOYSA-M Synonym: pentacarbonylchlororhenium,carbon monoxide; chlororhenium,pentakis carbon monoxide ; chlororhenium,5co.clre,rhenium i pentacarbonyl chloride,pentacarbonylchlororhenium i PubChem CID: 6096982 IUPAC Name: carbon monoxide;chlororhenium SMILES: [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].Cl[Re]
| PubChem CID | 6096982 |
|---|---|
| CAS | 14099-01-5 |
| Molecular Weight (g/mol) | 361.71 |
| MDL Number | MFCD00013296 |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].Cl[Re] |
| Synonym | pentacarbonylchlororhenium,carbon monoxide; chlororhenium,pentakis carbon monoxide ; chlororhenium,5co.clre,rhenium i pentacarbonyl chloride,pentacarbonylchlororhenium i |
| IUPAC Name | carbon monoxide;chlororhenium |
| InChI Key | JQUUAHKBIXPQAP-UHFFFAOYSA-M |
| Molecular Formula | C5ClO5Re |
2,4-Difluoro-3-nitrobenzonitrile, 97%, Thermo Scientific Chemicals
CAS: 1186194-75-1 Molecular Formula: C7H2F2N2O2 Molecular Weight (g/mol): 184.1 InChI Key: HESWWHRCQMLPFT-UHFFFAOYSA-N Synonym: 3-nitro-2,4-difluoro-benzonitrile PubChem CID: 45790497 IUPAC Name: 2,4-difluoro-3-nitrobenzonitrile SMILES: C1=CC(=C(C(=C1C#N)F)[N+](=O)[O-])F
| PubChem CID | 45790497 |
|---|---|
| CAS | 1186194-75-1 |
| Molecular Weight (g/mol) | 184.1 |
| SMILES | C1=CC(=C(C(=C1C#N)F)[N+](=O)[O-])F |
| Synonym | 3-nitro-2,4-difluoro-benzonitrile |
| IUPAC Name | 2,4-difluoro-3-nitrobenzonitrile |
| InChI Key | HESWWHRCQMLPFT-UHFFFAOYSA-N |
| Molecular Formula | C7H2F2N2O2 |
Tri-n-butyltin methoxide, 97%
CAS: 1067-52-3 Molecular Formula: C13H30OSn Molecular Weight (g/mol): 321.07 MDL Number: MFCD00009419 InChI Key: KJGLZJQPMKQFIK-UHFFFAOYSA-N Synonym: tributyltin methoxide,stannane, tributylmethoxy,unii-9cff2afn2v,tri-n-butyltin methanolate,9cff2afn2v,methoxytributyltin,tin, tributylmethoxy,tributyltin methanolate,stannane,tributylmethoxy,stannane, methoxytributyl PubChem CID: 16683411 IUPAC Name: tributyl(methoxy)stannane SMILES: CCCC[Sn](CCCC)(CCCC)OC
| PubChem CID | 16683411 |
|---|---|
| CAS | 1067-52-3 |
| Molecular Weight (g/mol) | 321.07 |
| MDL Number | MFCD00009419 |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC |
| Synonym | tributyltin methoxide,stannane, tributylmethoxy,unii-9cff2afn2v,tri-n-butyltin methanolate,9cff2afn2v,methoxytributyltin,tin, tributylmethoxy,tributyltin methanolate,stannane,tributylmethoxy,stannane, methoxytributyl |
| IUPAC Name | tributyl(methoxy)stannane |
| InChI Key | KJGLZJQPMKQFIK-UHFFFAOYSA-N |
| Molecular Formula | C13H30OSn |
(Ethyl benzoate)tricarbonylchromium, 98%, Thermo Scientific™
CAS: 32874-26-3 Molecular Formula: C12H10CrO5 Molecular Weight (g/mol): 286.203 MDL Number: MFCD02683559 InChI Key: SWSAJUVURPSGIG-UHFFFAOYSA-N Synonym: ethyl benzoate tricarbonylchromium,ethyl benzoate tricarbonylchromium 0,tris carbon monoxide ethyl benzoate chromium PubChem CID: 13222494 IUPAC Name: carbon monoxide;chromium;ethyl benzoate SMILES: CCOC(=O)C1=CC=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
| PubChem CID | 13222494 |
|---|---|
| CAS | 32874-26-3 |
| Molecular Weight (g/mol) | 286.203 |
| MDL Number | MFCD02683559 |
| SMILES | CCOC(=O)C1=CC=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| Synonym | ethyl benzoate tricarbonylchromium,ethyl benzoate tricarbonylchromium 0,tris carbon monoxide ethyl benzoate chromium |
| IUPAC Name | carbon monoxide;chromium;ethyl benzoate |
| InChI Key | SWSAJUVURPSGIG-UHFFFAOYSA-N |
| Molecular Formula | C12H10CrO5 |
Diphenylphosphine oxide, 97%
CAS: 4559-70-0 Molecular Formula: C12H11OP Molecular Weight (g/mol): 202.19 MDL Number: MFCD00002079 InChI Key: ASUOLLHGALPRFK-UHFFFAOYSA-N Synonym: diphenylphosphine oxide,phosphine oxide, diphenyl,diphenyl phosphine oxide,hpoph2,asuollhgalprfk-uhfffaoysa-n,dppo,diphenylphosphane oxide,phenylphosphonoylbenzene,diphenylphosphino-1-one,pubchem23810 PubChem CID: 6327869 IUPAC Name: oxo(diphenyl)phosphanium SMILES: O=P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6327869 |
|---|---|
| CAS | 4559-70-0 |
| Molecular Weight (g/mol) | 202.19 |
| MDL Number | MFCD00002079 |
| SMILES | O=P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylphosphine oxide,phosphine oxide, diphenyl,diphenyl phosphine oxide,hpoph2,asuollhgalprfk-uhfffaoysa-n,dppo,diphenylphosphane oxide,phenylphosphonoylbenzene,diphenylphosphino-1-one,pubchem23810 |
| IUPAC Name | oxo(diphenyl)phosphanium |
| InChI Key | ASUOLLHGALPRFK-UHFFFAOYSA-N |
| Molecular Formula | C12H11OP |
Decacarbonyldirhenium, 96%, Thermo Scientific Chemicals
CAS: 14285-68-8 Molecular Formula: C10O10Re2 Molecular Weight (g/mol): 652.51 MDL Number: MFCD00011198 InChI Key: ZIZHEHXAMPQGEK-UHFFFAOYSA-N Synonym: carbon monoxide; rhenium 2+,decacarbonyldirhenium 250mg PubChem CID: 498777 SMILES: [O]#C[Re](C#[O])(C#[O])(C#[O])(C#[O])[Re](C#[O])(C#[O])(C#[O])(C#[O])C#[O]
| PubChem CID | 498777 |
|---|---|
| CAS | 14285-68-8 |
| Molecular Weight (g/mol) | 652.51 |
| MDL Number | MFCD00011198 |
| SMILES | [O]#C[Re](C#[O])(C#[O])(C#[O])(C#[O])[Re](C#[O])(C#[O])(C#[O])(C#[O])C#[O] |
| Synonym | carbon monoxide; rhenium 2+,decacarbonyldirhenium 250mg |
| InChI Key | ZIZHEHXAMPQGEK-UHFFFAOYSA-N |
| Molecular Formula | C10O10Re2 |
Diethyl phosphite, 98%, Thermo Scientific Chemicals
CAS: 762-04-9 MDL Number: MFCD00044573 InChI Key: LXCYSACZTOKNNS-UHFFFAOYSA-N Synonym: diethyl phosphite,diethyl phosphonate,phosphonic acid, diethyl ester,phosphonic acid diethyl ester,diethoxyphosphine oxide,hydrogen diethyl phosphite,diethyl acid phosphite,o,o-diethyl phosphonate,phosphorous acid, diethyl ester,ethyl phosphonate eto 2hpo PubChem CID: 6327654 SMILES: CCO[P+](=O)OCC
| PubChem CID | 6327654 |
|---|---|
| CAS | 762-04-9 |
| MDL Number | MFCD00044573 |
| SMILES | CCO[P+](=O)OCC |
| Synonym | diethyl phosphite,diethyl phosphonate,phosphonic acid, diethyl ester,phosphonic acid diethyl ester,diethoxyphosphine oxide,hydrogen diethyl phosphite,diethyl acid phosphite,o,o-diethyl phosphonate,phosphorous acid, diethyl ester,ethyl phosphonate eto 2hpo |
| InChI Key | LXCYSACZTOKNNS-UHFFFAOYSA-N |
Cacodylic acid sodium salt trihydrate 98+%
CAS: 6131-99-3 Molecular Formula: C2H12AsNaO5 Molecular Weight (g/mol): 214.024 MDL Number: MFCD00149079 InChI Key: RLGWPHBPRCROJO-UHFFFAOYSA-M Synonym: sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate PubChem CID: 23679059 IUPAC Name: sodium;dimethylarsinate;trihydrate SMILES: C[As](=O)(C)[O-].O.O.O.[Na+]
| PubChem CID | 23679059 |
|---|---|
| CAS | 6131-99-3 |
| Molecular Weight (g/mol) | 214.024 |
| MDL Number | MFCD00149079 |
| SMILES | C[As](=O)(C)[O-].O.O.O.[Na+] |
| Synonym | sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate |
| IUPAC Name | sodium;dimethylarsinate;trihydrate |
| InChI Key | RLGWPHBPRCROJO-UHFFFAOYSA-M |
| Molecular Formula | C2H12AsNaO5 |