Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethylenediaminetetraacetic Acid, Di Na Salt Dihydr. (Crystalline Powd./Electrophor.), Fisher BioReagents™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Dithiothreitol (White Crystals or Powder/Electrophoresis), Fisher BioReagents™
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
L-Ascorbic Acid (White Crystalline Powder), Fisher BioReagents
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Sodium Citrate Dihydrate (Small, Colorless Granules), Fisher BioReagents™
CAS: 6132-04-3 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 6132-04-3 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Formaldehyde (37% by Weight/Molecular Biology), Fisher BioReagents
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Decane, Fisher Chemical
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.286 MDL Number: MFCD00008954 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.286 |
| ChEBI | CHEBI:41808 |
| MDL Number | MFCD00008954 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
Mineral Oil, Light (NF/FCC), Fisher Chemical™
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
1-Hexanesulfonic Acid Sodium Salt (HPLC), Fisher Chemical™
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 IUPAC Name: sodium hexane-1-sulfonate SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| IUPAC Name | sodium hexane-1-sulfonate |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |
1-Heptanesulfonic Acid Sodium Salt (HPLC), Fisher Chemical™
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M PubChem CID: 23672332
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| MDL Number | MFCD00007543 |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Triethylamine (Reagent), Fisher Chemical™
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00009051 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.193 |
| ChEBI | CHEBI:35026 |
| MDL Number | MFCD00009051 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
Imidazole (Certified), Fisher Chemical
CAS: 288-32-4 Molecular Formula: C3H4N2 Molecular Weight (g/mol): 68.08 MDL Number: MFCD00005183 InChI Key: RAXXELZNTBOGNW-UHFFFAOYSA-N Synonym: imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole PubChem CID: 795 ChEBI: CHEBI:16069 IUPAC Name: 1H-imidazole SMILES: N1C=CN=C1
| PubChem CID | 795 |
|---|---|
| CAS | 288-32-4 |
| Molecular Weight (g/mol) | 68.08 |
| ChEBI | CHEBI:16069 |
| MDL Number | MFCD00005183 |
| SMILES | N1C=CN=C1 |
| Synonym | imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole |
| IUPAC Name | 1H-imidazole |
| InChI Key | RAXXELZNTBOGNW-UHFFFAOYSA-N |
| Molecular Formula | C3H4N2 |
Triethylamine (HPLC), Fisher Chemical™
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N IUPAC Name: triethylamine SMILES: CCN(CC)CC
| CAS | 121-44-8 |
|---|---|
| Molecular Weight (g/mol) | 101.19 |
| SMILES | CCN(CC)CC |
| IUPAC Name | triethylamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
1-Pentanesulfonic Acid Sodium Salt, Anhydrous (HPLC), Fisher Chemical
CAS: 22767-49-3 Molecular Formula: C5H11NaO3S Molecular Weight (g/mol): 174.19 MDL Number: MFCD00007541,MFCD00149548 InChI Key: ROBLTDOHDSGGDT-UHFFFAOYSA-M Synonym: sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt PubChem CID: 23664617 IUPAC Name: sodium pentane-1-sulfonate SMILES: [Na+].CCCCCS([O-])(=O)=O
| PubChem CID | 23664617 |
|---|---|
| CAS | 22767-49-3 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD00007541,MFCD00149548 |
| SMILES | [Na+].CCCCCS([O-])(=O)=O |
| Synonym | sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt |
| IUPAC Name | sodium pentane-1-sulfonate |
| InChI Key | ROBLTDOHDSGGDT-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S |