missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Zirconium Standard for ICP 1000 ppm in 2% HNO3/HF, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010362100N
Description
- 1000 ppm in 2% HNO3/HF
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 95.29%,1.96%,0.49%,0.26% | |
| 1 | |
| N2O7Zr | |
| Approximately 0°C | |
| JWBWFTANBHYHBC-UHFFFAOYSA-N | |
| (nitrooxy)(oxo)zirconio nitrate | |
| 100 mL | |
| High Purity |
| 14985-18-3,7697-37-2,7664-39-3,7732-18-5 | |
| 99.17%,2.04%,0.51%,0.28% | |
| Liquid | |
| MFCD00149896 | |
| Standard | |
| [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O | |
| 231.23 | |
| 16211674 |
Chemical Identifiers
| 14985-18-3 | |
| 231.23 | |
| JWBWFTANBHYHBC-UHFFFAOYSA-N | |
| (nitrooxy)(oxo)zirconio nitrate |
| N2O7Zr | |
| MFCD00149896 | |
| 16211674 | |
| [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O |