missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Thioflavin T, Calbiochem™,
A cell-permeable benzothiazole dye that exhibits enhanced fluorescence upon binding to amyloid fibrils
Supplier: MilliporeSigma™ 596200500MG
Specifications
| Thioflavin T | |
| Yellow | |
| MFCD00011944 | |
| thioflavin t, thioflavine t, basic yellow 1, 2-4-dimethylamino phenyl-3,6-dimethylbenzo d thiazol-3-ium chloride, setoflavine t, acronol yellow t, tannoflavine t, setoflavin t, rhoduline yellow, thioflavin tg | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride | |
| 16953 | |
| 318.9 |
| 2390-54-7 | |
| C17H19ClN2S | |
| 500 mg | |
| Water: Soluble | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 | |
| 318.86 | |
| CHEBI:76023 | |
| Solid |
Chemical Identifiers
| 2390-54-7 | |
| 318.86 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 16953 | |
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| C17H19ClN2S | |
| MFCD00011944 | |
| thioflavin t, thioflavine t, basic yellow 1, 2-4-dimethylamino phenyl-3,6-dimethylbenzo d thiazol-3-ium chloride, setoflavine t, acronol yellow t, tannoflavine t, setoflavin t, rhoduline yellow, thioflavin tg | |
| CHEBI:76023 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
Safety and Handling
Recommended Storage : 15° to 25°C (59° to 77°F)