missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Strontium ICP Standard, 10,000 ppm Sr in 5% HNO3, Ricca Chemical
Supplier: Ricca Chemical Company PSR10KN500
Specifications
| Strontium ICP Standard | |
| Natural Poly Bottle | |
| 89.0,6.7,2.15 | |
| Colorless | |
| N2O6Sr | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate | |
| 24848 | |
| Liquid |
| 10042-76-9,7697-37-2,7732-18-5 | |
| 500 mL | |
| 93.0,6.97,2.24 | |
| 10,000ppm Sr | |
| MFCD00011248 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 211.63 | |
| 1 mL = 10 mg Sr |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate |
| N2O6Sr | |
| MFCD00011248 | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |