missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals N-Acetyl-L-leucine, 99%
CAS: 1188-21-2 | C8H15NO3 | 173.21 g/mol
$74.81 - $74.81
Identifiants chimiques
| CAS | 1188-21-2 |
|---|---|
| Molecular Formula | C8H15NO3 |
| Molecular Weight (g/mol) | 173.21 |
| MDL Number | MFCD00065131 |
| InChI Key | WXNXCEHXYPACJF-JLDDOWRYNA-N |
| Synonym | n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin |
| PubChem CID | 70912 |
| ChEBI | CHEBI:17786 |
| IUPAC Name | (2S)-2-acetamido-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(C)=O)C(O)=O |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|
AC347010050
|
Thermo Scientific Chemicals
347010050 |
5 g | Glass bottle |
chaque for $74.81
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
|||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 1188-21-2 | |
| 173.21 | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| 70912 | |
| (2S)-2-acetamido-4-methylpentanoic acid |
| C8H15NO3 | |
| MFCD00065131 | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| CHEBI:17786 | |
| CC(C)C[C@H](NC(C)=O)C(O)=O |
Spécifications
| 1188-21-2 | |
| 100.0 | |
| White | |
| 99% | |
| C8H15NO3 | |
| MFCD00065131 | |
| − 24.50 | |
| (5% in ethanol) Clear colorless | |
| CC(C)C[C@H](NC(C)=O)C(O)=O | |
| 173.21 | |
| CHEBI:17786 | |
| 99% | |
| N-Acetyl-L-leucine, 99% |
| 98.5 | |
| 190.0°C | |
| Authentic | |
| Glass bottle | |
| (CH3)2CHCH2CH(NHCOCH3)COOH | |
| 5 g | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| (2S)-2-acetamido-4-methylpentanoic acid | |
| 70912 | |
| 173.21 | |
| Crystalline Powder |
Sécurité et manipulation
missing translation for 'einecsNumber' : 214-706-3
missing translation for 'tsca' : TSCA
RUO – Research Use Only