missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Giemsa Stain, Reagent Grade, LabChem™
Supplier: LabChem LC148357
Spécifications
| Powder | |
| 300°C | |
| 100 | |
| Soluble in water | |
| Golden/Green | |
| C14H14ClN3S | |
| MFCD00012112,MFCD00081642 | |
| NALREUIWICQLPS-UHFFFAOYSA-N | |
| 7-amino-N,N-dimethyl-3H-phenothiazin-3-iminium chloride | |
| 13735 | |
| Reagent |
| Giemsa Stain | |
| 51811-82-6 | |
| Amber Glass | |
| Hydrogen chloride; Carbon monoxide; Carbon dioxide; Nitrogen oxides; Sulfur compounds | |
| 10 g | |
| C14H14ClN3S | |
| azure a, dimethylthionine, giemsa stain, azur a, n,n-dimethylthionine, 3-amino-7-dimethylamino phenothiazin-5-ium chloride, methylene azure a, giemsa solution, 3-amino-7-dimethylaminophenazathionium chloride, unii-m731v243ef | |
| [Cl-].C[N+](C)=C1C=CC2=NC3=CC=C(N)C=C3SC2=C1 | |
| 291.80 | |
| 291.8 |
Identifiants chimiques
| 51811-82-6 | |
| 291.80 | |
| NALREUIWICQLPS-UHFFFAOYSA-N | |
| 13735 | |
| [Cl-].C[N+](C)=C1C=CC2=NC3=CC=C(N)C=C3SC2=C1 |
| C14H14ClN3S | |
| MFCD00012112,MFCD00081642 | |
| azure a, dimethylthionine, giemsa stain, azur a, n,n-dimethylthionine, 3-amino-7-dimethylamino phenothiazin-5-ium chloride, methylene azure a, giemsa solution, 3-amino-7-dimethylaminophenazathionium chloride, unii-m731v243ef | |
| 7-amino-N,N-dimethyl-3H-phenothiazin-3-iminium chloride |
Sécurité et manipulation
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Warning
EINECSNumber : 257-438-2
Recommended Storage : Room Temperature