missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals D(+)-Tryptophan, 99%
CAS: 153-94-6 | C11H12N2O2 | 204.23 g/mol
$900.46 - $900.46
Identifiants chimiques
| CAS | 153-94-6 |
|---|---|
| Molecular Formula | C11H12N2O2 |
| Molecular Weight (g/mol) | 204.23 |
| MDL Number | MFCD00005647 |
| InChI Key | QIVBCDIJIAJPQS-SECBINFHSA-N |
| Synonym | d-tryptophan, h-d-trp-oh, r-tryptophan, d +-tryptophan, d-trytophane, d-tryptophane, tryptophan, d, 2r-2-amino-3-1h-indol-3-yl propanoic acid, +-tryptophan, h-d-typ-oh |
| PubChem CID | 9060 |
| ChEBI | CHEBI:16296 |
| IUPAC Name | (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| SMILES | N[C@H](CC1=CNC2=CC=CC=C12)C(O)=O |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|
AC168631000
|
Thermo Scientific Chemicals
168631000 |
100 g |
chaque for $900.46
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 153-94-6 | |
| 204.23 | |
| QIVBCDIJIAJPQS-SECBINFHSA-N | |
| 9060 | |
| (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| C11H12N2O2 | |
| MFCD00005647 | |
| d-tryptophan, h-d-trp-oh, r-tryptophan, d +-tryptophan, d-trytophane, d-tryptophane, tryptophan, d, 2r-2-amino-3-1h-indol-3-yl propanoic acid, +-tryptophan, h-d-typ-oh | |
| CHEBI:16296 | |
| N[C@H](CC1=CNC2=CC=CC=C12)C(O)=O |
Spécifications
| 282.0°C to 285.0°C | |
| White to Yellow | |
| 0.5% max. | |
| C11H12N2O2 | |
| MFCD00005647 | |
| d-tryptophan, h-d-trp-oh, r-tryptophan, d +-tryptophan, d-trytophane, d-tryptophane, tryptophan, d, 2r-2-amino-3-1h-indol-3-yl propanoic acid, +-tryptophan, h-d-typ-oh | |
| QIVBCDIJIAJPQS-SECBINFHSA-N | |
| (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid | |
| 100 g | |
| 9060 | |
| 204.23 | |
| Powder |
| 153-94-6 | |
| Authentic | |
| 99% | |
| Glass Bottle | |
| + 31.50 | |
| Solubility in water: 11g/L (20°C). Other solubilities: soluble in alkali hydroxides, soluble in hot alcohol, insoluble in chloroform | |
| N[C@H](CC1=CNC2=CC=CC=C12)C(O)=O | |
| + 31.50 (24.00°C c=1,H2O) | |
| 204.23 | |
| CHEBI:16296 | |
| 99% | |
| D(+)-Tryptophan |
RUO – Research Use Only