Methoxybenzoic acids and derivatives
- (4)
- (9)
- (5)
- (18)
- (2)
- (14)
- (1)
- (5)
- (6)
- (2)
- (6)
- (5)
- (1)
- (26)
- (22)
- (56)
- (31)
- (12)
- (11)
- (1)
- (2)
- (1)
- (70)
- (1)
- (118)
- (1)
- (1)
- (2)
- (11)
- (6)
- (1)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
Filtered Search Results
2-Fluoro-5-methoxybenzoic acid, 97+%
CAS: 367-83-9 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD00272566 InChI Key: REDSLTKMNCCQBC-UHFFFAOYSA-N PubChem CID: 2774543 IUPAC Name: 2-fluoro-5-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)F)C(=O)O
| PubChem CID | 2774543 |
|---|---|
| CAS | 367-83-9 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD00272566 |
| SMILES | COC1=CC(=C(C=C1)F)C(=O)O |
| IUPAC Name | 2-fluoro-5-methoxybenzoic acid |
| InChI Key | REDSLTKMNCCQBC-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
2-Bromo-5-methoxybenzoic acid, 98+%
CAS: 22921-68-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD00020214 InChI Key: ODHJOROUCITYNF-UHFFFAOYSA-N Synonym: 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid PubChem CID: 89906 IUPAC Name: 2-bromo-5-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)Br)C(=O)O
| PubChem CID | 89906 |
|---|---|
| CAS | 22921-68-2 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD00020214 |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
| Synonym | 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid |
| IUPAC Name | 2-bromo-5-methoxybenzoic acid |
| InChI Key | ODHJOROUCITYNF-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
4-Fluoro-3-methoxybenzoic acid, 95%, Thermo Scientific Chemicals
CAS: 82846-18-2 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD00272134 InChI Key: LWGCZCMLPRMKIZ-UHFFFAOYSA-N Synonym: 3-methoxy-4-fluorobenzoic acid,4-fluoro-m-anisic acid,benzoic acid, 4-fluoro-3-methoxy,4-fluoro-3-methoxybenzoicacid,4-fluoro-3-methoxy-benzoic acid,4-fluoranyl-3-methoxy-benzoic acid,pubchem1394,acmc-209pqm,ksc495c0r,rarechem al bo 0973 PubChem CID: 598436 IUPAC Name: 4-fluoro-3-methoxybenzoic acid SMILES: COC1=C(C=CC(=C1)C(=O)O)F
| PubChem CID | 598436 |
|---|---|
| CAS | 82846-18-2 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD00272134 |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)F |
| Synonym | 3-methoxy-4-fluorobenzoic acid,4-fluoro-m-anisic acid,benzoic acid, 4-fluoro-3-methoxy,4-fluoro-3-methoxybenzoicacid,4-fluoro-3-methoxy-benzoic acid,4-fluoranyl-3-methoxy-benzoic acid,pubchem1394,acmc-209pqm,ksc495c0r,rarechem al bo 0973 |
| IUPAC Name | 4-fluoro-3-methoxybenzoic acid |
| InChI Key | LWGCZCMLPRMKIZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl vanillate, 99%
CAS: 3943-74-6 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.175 MDL Number: MFCD00008438 InChI Key: BVWTXUYLKBHMOX-UHFFFAOYSA-N Synonym: methyl vanillate,methyl 3-methoxy-4-hydroxybenzoate,vanillic acid, methyl ester,4-hydroxy-3-methoxybenzoic acid methyl ester,methylvanillate,benzoic acid, 4-hydroxy-3-methoxy-, methyl ester,vanillic acid methyl ester,unii-2hxg8qso3d,2hxg8qso3d,vxx PubChem CID: 19844 ChEBI: CHEBI:46477 IUPAC Name: methyl 4-hydroxy-3-methoxybenzoate SMILES: COC1=C(C=CC(=C1)C(=O)OC)O
| PubChem CID | 19844 |
|---|---|
| CAS | 3943-74-6 |
| Molecular Weight (g/mol) | 182.175 |
| ChEBI | CHEBI:46477 |
| MDL Number | MFCD00008438 |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)O |
| Synonym | methyl vanillate,methyl 3-methoxy-4-hydroxybenzoate,vanillic acid, methyl ester,4-hydroxy-3-methoxybenzoic acid methyl ester,methylvanillate,benzoic acid, 4-hydroxy-3-methoxy-, methyl ester,vanillic acid methyl ester,unii-2hxg8qso3d,2hxg8qso3d,vxx |
| IUPAC Name | methyl 4-hydroxy-3-methoxybenzoate |
| InChI Key | BVWTXUYLKBHMOX-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
Methyl 3-cyano-4-methoxybenzoate, 97%
CAS: 25978-74-9 Molecular Formula: C10H9NO3 Molecular Weight (g/mol): 191.186 MDL Number: MFCD00052930 InChI Key: RYJSFYBJYKFNCF-UHFFFAOYSA-N Synonym: benzoic acid, 3-cyano-4-methoxy-, methyl ester,acmc-1cj4t,methyl 3-cyano-4-methoxy-benzoate,methyl 3-cyano-4-methoxybenzoate.,methyl 3-cyano-4-methyloxy benzoate,3-cyano-4-methoxy-benzoic acid methyl ester,benzoicacid,3-cyano-4-methoxy-,methyl ester PubChem CID: 2801011 IUPAC Name: methyl 3-cyano-4-methoxybenzoate SMILES: COC1=C(C=C(C=C1)C(=O)OC)C#N
| PubChem CID | 2801011 |
|---|---|
| CAS | 25978-74-9 |
| Molecular Weight (g/mol) | 191.186 |
| MDL Number | MFCD00052930 |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC)C#N |
| Synonym | benzoic acid, 3-cyano-4-methoxy-, methyl ester,acmc-1cj4t,methyl 3-cyano-4-methoxy-benzoate,methyl 3-cyano-4-methoxybenzoate.,methyl 3-cyano-4-methyloxy benzoate,3-cyano-4-methoxy-benzoic acid methyl ester,benzoicacid,3-cyano-4-methoxy-,methyl ester |
| IUPAC Name | methyl 3-cyano-4-methoxybenzoate |
| InChI Key | RYJSFYBJYKFNCF-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO3 |
4-Methoxysalicylic acid, 99%
CAS: 2237-36-7 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002450 InChI Key: MRIXVKKOHPQOFK-UHFFFAOYSA-N Synonym: 4-methoxysalicylic acid,2-hydroxy-p-anisic acid,2-hydroxy-4-methoxy-benzoic acid,benzoic acid, 2-hydroxy-4-methoxy,2-hydroxy-4-methoxybenzoes,4-methoxysalicylicacid,pubchem18895,4-methoxy salicylic acid,4-methoxy-salicylic acid,acmc-1cs6b PubChem CID: 75231 IUPAC Name: 2-hydroxy-4-methoxybenzoic acid SMILES: COC1=CC=C(C(O)=O)C(O)=C1
| PubChem CID | 75231 |
|---|---|
| CAS | 2237-36-7 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002450 |
| SMILES | COC1=CC=C(C(O)=O)C(O)=C1 |
| Synonym | 4-methoxysalicylic acid,2-hydroxy-p-anisic acid,2-hydroxy-4-methoxy-benzoic acid,benzoic acid, 2-hydroxy-4-methoxy,2-hydroxy-4-methoxybenzoes,4-methoxysalicylicacid,pubchem18895,4-methoxy salicylic acid,4-methoxy-salicylic acid,acmc-1cs6b |
| IUPAC Name | 2-hydroxy-4-methoxybenzoic acid |
| InChI Key | MRIXVKKOHPQOFK-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
3-Amino-4-methoxybenzoic acid, 98+%
CAS: 2840-26-8 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00002521 InChI Key: FDGAEAYZQQCBRN-UHFFFAOYSA-N Synonym: 3-amino-p-anisic acid,p-anisic acid, 3-amino,3-amino-4-methoxy-benzoic acid,3-amino-4-anisic acid,3-amino-4-methoxybenzoicacid,benzoic acid, 3-amino-4-methoxy,kyselina 3-amino-4-methoxybenzoova,3-amino-4-methoxybenzoic,5-carboxy-2-methoxyaniline,kyselina 3-amino-4-methoxybenzoova czech PubChem CID: 17823 IUPAC Name: 3-amino-4-methoxybenzoic acid SMILES: COC1=C(C=C(C=C1)C(=O)O)N
| PubChem CID | 17823 |
|---|---|
| CAS | 2840-26-8 |
| Molecular Weight (g/mol) | 167.164 |
| MDL Number | MFCD00002521 |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)N |
| Synonym | 3-amino-p-anisic acid,p-anisic acid, 3-amino,3-amino-4-methoxy-benzoic acid,3-amino-4-anisic acid,3-amino-4-methoxybenzoicacid,benzoic acid, 3-amino-4-methoxy,kyselina 3-amino-4-methoxybenzoova,3-amino-4-methoxybenzoic,5-carboxy-2-methoxyaniline,kyselina 3-amino-4-methoxybenzoova czech |
| IUPAC Name | 3-amino-4-methoxybenzoic acid |
| InChI Key | FDGAEAYZQQCBRN-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
Methyl 3,5-dimethoxybenzoate, 98%
CAS: 2150-37-0 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.20 MDL Number: MFCD00008432 InChI Key: YXUIOVUOFQKWDM-UHFFFAOYSA-N Synonym: 3,5-dimethoxybenzoic acid methyl ester,benzoic acid, 3,5-dimethoxy-, methyl ester,3,5-dimethoxybenzoic acid methyl,methyl 3,5-bis methyloxy benzoate,acmc-1ccvs,rarechem al bf 0065,methyl 3,5-dimethoxybnezoate,ksc489q8p,ethyl 3,5-dimethoxybenzoate,methyl 3,5-dimethoxybenzoate PubChem CID: 75074 IUPAC Name: methyl 3,5-dimethoxybenzoate SMILES: COC(=O)C1=CC(OC)=CC(OC)=C1
| PubChem CID | 75074 |
|---|---|
| CAS | 2150-37-0 |
| Molecular Weight (g/mol) | 196.20 |
| MDL Number | MFCD00008432 |
| SMILES | COC(=O)C1=CC(OC)=CC(OC)=C1 |
| Synonym | 3,5-dimethoxybenzoic acid methyl ester,benzoic acid, 3,5-dimethoxy-, methyl ester,3,5-dimethoxybenzoic acid methyl,methyl 3,5-bis methyloxy benzoate,acmc-1ccvs,rarechem al bf 0065,methyl 3,5-dimethoxybnezoate,ksc489q8p,ethyl 3,5-dimethoxybenzoate,methyl 3,5-dimethoxybenzoate |
| IUPAC Name | methyl 3,5-dimethoxybenzoate |
| InChI Key | YXUIOVUOFQKWDM-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
3,5-Dimethyl-p-anisic acid, 98%, Thermo Scientific™
CAS: 21553-46-8 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.2 MDL Number: MFCD00020309 InChI Key: WXVQURJGDUNJCS-UHFFFAOYSA-N Synonym: 3,5-dimethyl-4-methoxybenzoic acid,3,5-dimethyl-p-anisic acid,4-methoxy-3,5-dimethyl-benzoic acid,3,5-dimethyl anisic acid,benzoic acid, 4-methoxy-3,5-dimethyl,4-methoxy-3,5-dimethylbenzoicacid,acmc-209flo,ksc496g8f,3,5-dimethyl-4-methoxy-benzoic acid,4-methoxy-3,5-dimethyl benzoic acid PubChem CID: 88944 IUPAC Name: 4-methoxy-3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1OC)C)C(=O)O
| PubChem CID | 88944 |
|---|---|
| CAS | 21553-46-8 |
| Molecular Weight (g/mol) | 180.2 |
| MDL Number | MFCD00020309 |
| SMILES | CC1=CC(=CC(=C1OC)C)C(=O)O |
| Synonym | 3,5-dimethyl-4-methoxybenzoic acid,3,5-dimethyl-p-anisic acid,4-methoxy-3,5-dimethyl-benzoic acid,3,5-dimethyl anisic acid,benzoic acid, 4-methoxy-3,5-dimethyl,4-methoxy-3,5-dimethylbenzoicacid,acmc-209flo,ksc496g8f,3,5-dimethyl-4-methoxy-benzoic acid,4-methoxy-3,5-dimethyl benzoic acid |
| IUPAC Name | 4-methoxy-3,5-dimethylbenzoic acid |
| InChI Key | WXVQURJGDUNJCS-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
2-Chloro-4-methoxybenzoic acid, 98%
CAS: 21971-21-1 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00085943 InChI Key: IBANGHTVBPZCHF-UHFFFAOYSA-N Synonym: 2-chloro-4-methoxy-benzoic acid,2-chloro-4-methyloxy benzoic acid,benzoic acid, 2-chloro-4-methoxy,2-chloro-4-methoxybenzoicacid,2-chloranissaure,pubchem14030,2-chloro-p-anisic acid,ksc494q0b,4-methoxy-2-chloro-benzoic acid PubChem CID: 12648026 IUPAC Name: 2-chloro-4-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)C(=O)O)Cl
| PubChem CID | 12648026 |
|---|---|
| CAS | 21971-21-1 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00085943 |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)Cl |
| Synonym | 2-chloro-4-methoxy-benzoic acid,2-chloro-4-methyloxy benzoic acid,benzoic acid, 2-chloro-4-methoxy,2-chloro-4-methoxybenzoicacid,2-chloranissaure,pubchem14030,2-chloro-p-anisic acid,ksc494q0b,4-methoxy-2-chloro-benzoic acid |
| IUPAC Name | 2-chloro-4-methoxybenzoic acid |
| InChI Key | IBANGHTVBPZCHF-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
3-Chloro-4-methoxybenzoic acid, 98+%
CAS: 37908-96-6 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00016512 InChI Key: IBCQUQXCTOPJOD-UHFFFAOYSA-N Synonym: 3-chloro-p-anisic acid,3-chloro-4-methoxybenzolic acid,benzoic acid, 3-chloro-4-methoxy,pubchem19130,acmc-209iw4,ksc494s0j,3-chloro-4-methoxybenzoicacid,rarechem al bo 2400,3-chloro-4-anisic acid,3-chloro-4-methoxy benzoic acid PubChem CID: 169982 IUPAC Name: 3-chloro-4-methoxybenzoic acid SMILES: COC1=C(C=C(C=C1)C(=O)O)Cl
| PubChem CID | 169982 |
|---|---|
| CAS | 37908-96-6 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00016512 |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)Cl |
| Synonym | 3-chloro-p-anisic acid,3-chloro-4-methoxybenzolic acid,benzoic acid, 3-chloro-4-methoxy,pubchem19130,acmc-209iw4,ksc494s0j,3-chloro-4-methoxybenzoicacid,rarechem al bo 2400,3-chloro-4-anisic acid,3-chloro-4-methoxy benzoic acid |
| IUPAC Name | 3-chloro-4-methoxybenzoic acid |
| InChI Key | IBCQUQXCTOPJOD-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
Methyl 3-bromo-4-methoxybenzoate, 98%
CAS: 35450-37-4 Molecular Formula: C9H9BrO3 Molecular Weight (g/mol): 245.07 MDL Number: MFCD00210463 InChI Key: ZREVPFANJBZHEU-UHFFFAOYSA-N Synonym: 3-bromo-4-methoxybenzoic acid methyl ester,methyl3-bromo-4-methoxybenzoate,benzoic acid, 3-bromo-4-methoxy-, methyl ester,acmc-209igx,methyl 3-bromo-p-anisate,rarechem al bf 0247,methyl-3-bromo-4-methoxybenzoate,3-bromo-p-anisic acid methyl ester,#,methyl 3-bromo-4-methyloxy benzoate PubChem CID: 611662 IUPAC Name: methyl 3-bromo-4-methoxybenzoate SMILES: COC(=O)C1=CC(Br)=C(OC)C=C1
| PubChem CID | 611662 |
|---|---|
| CAS | 35450-37-4 |
| Molecular Weight (g/mol) | 245.07 |
| MDL Number | MFCD00210463 |
| SMILES | COC(=O)C1=CC(Br)=C(OC)C=C1 |
| Synonym | 3-bromo-4-methoxybenzoic acid methyl ester,methyl3-bromo-4-methoxybenzoate,benzoic acid, 3-bromo-4-methoxy-, methyl ester,acmc-209igx,methyl 3-bromo-p-anisate,rarechem al bf 0247,methyl-3-bromo-4-methoxybenzoate,3-bromo-p-anisic acid methyl ester,#,methyl 3-bromo-4-methyloxy benzoate |
| IUPAC Name | methyl 3-bromo-4-methoxybenzoate |
| InChI Key | ZREVPFANJBZHEU-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO3 |
4-Methoxy-2-methylbenzoic acid, 97%
CAS: 6245-57-4 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00020291 InChI Key: MSVRGYOYISBGTH-UHFFFAOYSA-N Synonym: 2-methyl-4-methoxybenzoic acid,4-methoxy-2-methyl-benzoic acid,2-methyl-p-anisic acid,benzoic acid, 4-methoxy-2-methyl,4-methoxy-o-toluic acid,acmc-209x9h,ksc495k2d,2-methyl-4-methoxybenzoicacid,2-methyl-4-methoxy-benzoic acid,4-methoxy-2-methyl benzoic acid PubChem CID: 597216 IUPAC Name: 4-methoxy-2-methylbenzoic acid SMILES: COC1=CC(C)=C(C=C1)C(O)=O
| PubChem CID | 597216 |
|---|---|
| CAS | 6245-57-4 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00020291 |
| SMILES | COC1=CC(C)=C(C=C1)C(O)=O |
| Synonym | 2-methyl-4-methoxybenzoic acid,4-methoxy-2-methyl-benzoic acid,2-methyl-p-anisic acid,benzoic acid, 4-methoxy-2-methyl,4-methoxy-o-toluic acid,acmc-209x9h,ksc495k2d,2-methyl-4-methoxybenzoicacid,2-methyl-4-methoxy-benzoic acid,4-methoxy-2-methyl benzoic acid |
| IUPAC Name | 4-methoxy-2-methylbenzoic acid |
| InChI Key | MSVRGYOYISBGTH-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
2-Amino-4,5-dimethoxybenzoic acid, 98%, Thermo Scientific Chemicals
CAS: 5653-40-7 Molecular Formula: C9H11NO4 Molecular Weight (g/mol): 197.19 MDL Number: MFCD00011671 InChI Key: HJVAVGOPTDJYOJ-UHFFFAOYSA-N Synonym: 4,5-dimethoxyanthranilic acid,6-aminoveratric acid,benzoic acid, 2-amino-4,5-dimethoxy,2-amino-4,5-dimethoxy benzoic acid,2-amino-4,5-dimethoxy-benzoic acid,6-aminoveratricacid,zlchem 238,pubchem3110,acmc-1b03r,ksc269i1n PubChem CID: 79736 IUPAC Name: 2-amino-4,5-dimethoxybenzoic acid SMILES: COC1=CC(N)=C(C=C1OC)C(O)=O
| PubChem CID | 79736 |
|---|---|
| CAS | 5653-40-7 |
| Molecular Weight (g/mol) | 197.19 |
| MDL Number | MFCD00011671 |
| SMILES | COC1=CC(N)=C(C=C1OC)C(O)=O |
| Synonym | 4,5-dimethoxyanthranilic acid,6-aminoveratric acid,benzoic acid, 2-amino-4,5-dimethoxy,2-amino-4,5-dimethoxy benzoic acid,2-amino-4,5-dimethoxy-benzoic acid,6-aminoveratricacid,zlchem 238,pubchem3110,acmc-1b03r,ksc269i1n |
| IUPAC Name | 2-amino-4,5-dimethoxybenzoic acid |
| InChI Key | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO4 |
2-Amino-3-methoxybenzoic acid, 98%
CAS: 3177-80-8 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.17 InChI Key: SXOPCLUOUFQBJV-UHFFFAOYSA-N Synonym: 3-methoxyanthranilic acid,benzoic acid, 2-amino-3-methoxy,3-methoxyanthranilate,m-anisic acid, 2-amino,3-methoxy-2-aminobenzoic acid,2-amino-3-methoxy-benzoic acid,2-amino-3-methoxy benzoic acid,2-amino-3-methyloxy benzoic acid,2-amino-3-methoxybenzoicacid PubChem CID: 255720 ChEBI: CHEBI:27440 IUPAC Name: 2-amino-3-methoxybenzoic acid SMILES: COC1=CC=CC(=C1N)C(=O)O
| PubChem CID | 255720 |
|---|---|
| CAS | 3177-80-8 |
| Molecular Weight (g/mol) | 167.17 |
| ChEBI | CHEBI:27440 |
| SMILES | COC1=CC=CC(=C1N)C(=O)O |
| Synonym | 3-methoxyanthranilic acid,benzoic acid, 2-amino-3-methoxy,3-methoxyanthranilate,m-anisic acid, 2-amino,3-methoxy-2-aminobenzoic acid,2-amino-3-methoxy-benzoic acid,2-amino-3-methoxy benzoic acid,2-amino-3-methyloxy benzoic acid,2-amino-3-methoxybenzoicacid |
| IUPAC Name | 2-amino-3-methoxybenzoic acid |
| InChI Key | SXOPCLUOUFQBJV-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |