Benzoic acid esters
- (14)
- (28)
- (1)
- (22)
- (7)
- (4)
- (4)
- (6)
- (1)
- (9)
- (1)
- (10)
- (1)
- (26)
- (3)
- (6)
- (2)
- (4)
- (26)
- (30)
- (16)
- (3)
- (4)
- (13)
- (5)
- (97)
- (24)
- (3)
- (5)
- (1)
- (33)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (5)
- (3)
- (1)
Filtered Search Results
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
n-Octyl 4-hydroxybenzoate, 98%
CAS: 1219-38-1 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00016482 InChI Key: RIKCMEDSBFQFAL-UHFFFAOYSA-N Synonym: octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german PubChem CID: 14642 IUPAC Name: octyl 4-hydroxybenzoate SMILES: CCCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14642 |
|---|---|
| CAS | 1219-38-1 |
| Molecular Weight (g/mol) | 250.34 |
| MDL Number | MFCD00016482 |
| SMILES | CCCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german |
| IUPAC Name | octyl 4-hydroxybenzoate |
| InChI Key | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |
Benzyl salicylate, 99%
CAS: 118-58-1 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.247 MDL Number: MFCD00020034 InChI Key: ZCTQGTTXIYCGGC-UHFFFAOYSA-N Synonym: benzyl salicylate,benzyl o-hydroxybenzoate,salicylic acid, benzyl ester,benzoic acid, 2-hydroxy-, phenylmethyl ester,phenylmethyl 2-hydroxybenzoate,salicylic acid benzyl ester,salicyclic acid, benzyl ester,salicylsaeurebenzylester,unii-wao5mnk9tu,salicyclic acid benzyl ester PubChem CID: 8363 IUPAC Name: benzyl 2-hydroxybenzoate SMILES: C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O
| PubChem CID | 8363 |
|---|---|
| CAS | 118-58-1 |
| Molecular Weight (g/mol) | 228.247 |
| MDL Number | MFCD00020034 |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O |
| Synonym | benzyl salicylate,benzyl o-hydroxybenzoate,salicylic acid, benzyl ester,benzoic acid, 2-hydroxy-, phenylmethyl ester,phenylmethyl 2-hydroxybenzoate,salicylic acid benzyl ester,salicyclic acid, benzyl ester,salicylsaeurebenzylester,unii-wao5mnk9tu,salicyclic acid benzyl ester |
| IUPAC Name | benzyl 2-hydroxybenzoate |
| InChI Key | ZCTQGTTXIYCGGC-UHFFFAOYSA-N |
| Molecular Formula | C14H12O3 |
Methyl 3,5-dibromo-2-hydroxybenzoate, 98%
CAS: 21702-79-4 Molecular Formula: C8H6Br2O3 Molecular Weight (g/mol): 309.94 MDL Number: MFCD00017534 InChI Key: KISQISIKTRRMOX-UHFFFAOYSA-N PubChem CID: 624217 IUPAC Name: methyl 3,5-dibromo-2-hydroxybenzoate SMILES: COC(=O)C1=CC(Br)=CC(Br)=C1O
| PubChem CID | 624217 |
|---|---|
| CAS | 21702-79-4 |
| Molecular Weight (g/mol) | 309.94 |
| MDL Number | MFCD00017534 |
| SMILES | COC(=O)C1=CC(Br)=CC(Br)=C1O |
| IUPAC Name | methyl 3,5-dibromo-2-hydroxybenzoate |
| InChI Key | KISQISIKTRRMOX-UHFFFAOYSA-N |
| Molecular Formula | C8H6Br2O3 |
Isopropyl 4-hydroxybenzoate, 98%
CAS: 4191-73-5 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00016468 InChI Key: CMHMMKSPYOOVGI-UHFFFAOYSA-N Synonym: isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester PubChem CID: 20161 IUPAC Name: propan-2-yl 4-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 20161 |
|---|---|
| CAS | 4191-73-5 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00016468 |
| SMILES | CC(C)OC(=O)C1=CC=C(O)C=C1 |
| Synonym | isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester |
| IUPAC Name | propan-2-yl 4-hydroxybenzoate |
| InChI Key | CMHMMKSPYOOVGI-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Isopropyl salicylate, 99%
CAS: 607-85-2 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00035703 InChI Key: YEULQIJMIOWCHB-UHFFFAOYSA-N Synonym: isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate PubChem CID: 11838 ChEBI: CHEBI:38703 IUPAC Name: propan-2-yl 2-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=CC=C1O
| PubChem CID | 11838 |
|---|---|
| CAS | 607-85-2 |
| Molecular Weight (g/mol) | 180.203 |
| ChEBI | CHEBI:38703 |
| MDL Number | MFCD00035703 |
| SMILES | CC(C)OC(=O)C1=CC=CC=C1O |
| Synonym | isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate |
| IUPAC Name | propan-2-yl 2-hydroxybenzoate |
| InChI Key | YEULQIJMIOWCHB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 4-fluoro-3-hydroxybenzoate, 98+%
CAS: 214822-96-5 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD06797457 InChI Key: CUGWNEOTLGLGDG-UHFFFAOYSA-N Synonym: 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester PubChem CID: 12016892 IUPAC Name: methyl 4-fluoro-3-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C=C1)F)O
| PubChem CID | 12016892 |
|---|---|
| CAS | 214822-96-5 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD06797457 |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)O |
| Synonym | 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester |
| IUPAC Name | methyl 4-fluoro-3-hydroxybenzoate |
| InChI Key | CUGWNEOTLGLGDG-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl 3,5-di-tert-butyl-4-hydroxybenzoate, 98%
CAS: 2511-22-0 Molecular Formula: C16H24O3 Molecular Weight (g/mol): 264.37 MDL Number: MFCD00017253 InChI Key: UPVYFJALDJUSOV-UHFFFAOYSA-N Synonym: methyl 3,5-di-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-bis 1,1-dimethylethyl-4-hydroxy-, methyl ester,3,5-di-tert-butyl-4-hydroxybenzoic acid methyl ester,3,5-bis 1,1-dimethylethyl-4-hydroxy-benzoic acid ethyl ester,acmc-20akhp,methyl 3,5-bis-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-di-tert-butyl-4-hydroxy-, methyl ester,methyl 3,5-di-tert.butyl-4-hydroxylbenzoate,methyl 3,5-bis tert-butyl-4-hydroxybenzoate PubChem CID: 75639 IUPAC Name: methyl 3,5-ditert-butyl-4-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
| PubChem CID | 75639 |
|---|---|
| CAS | 2511-22-0 |
| Molecular Weight (g/mol) | 264.37 |
| MDL Number | MFCD00017253 |
| SMILES | COC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C |
| Synonym | methyl 3,5-di-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-bis 1,1-dimethylethyl-4-hydroxy-, methyl ester,3,5-di-tert-butyl-4-hydroxybenzoic acid methyl ester,3,5-bis 1,1-dimethylethyl-4-hydroxy-benzoic acid ethyl ester,acmc-20akhp,methyl 3,5-bis-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-di-tert-butyl-4-hydroxy-, methyl ester,methyl 3,5-di-tert.butyl-4-hydroxylbenzoate,methyl 3,5-bis tert-butyl-4-hydroxybenzoate |
| IUPAC Name | methyl 3,5-ditert-butyl-4-hydroxybenzoate |
| InChI Key | UPVYFJALDJUSOV-UHFFFAOYSA-N |
| Molecular Formula | C16H24O3 |
Methyl 4-aminosalicylate, 97%, Thermo Scientific Chemicals
CAS: 4136-97-4 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00088091 InChI Key: QQOXBFUTRLDXDP-UHFFFAOYSA-N Synonym: methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester PubChem CID: 77787 ChEBI: CHEBI:35089 IUPAC Name: methyl 4-amino-2-hydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)N)O
| PubChem CID | 77787 |
|---|---|
| CAS | 4136-97-4 |
| Molecular Weight (g/mol) | 167.164 |
| ChEBI | CHEBI:35089 |
| MDL Number | MFCD00088091 |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)O |
| Synonym | methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 4-amino-2-hydroxybenzoate |
| InChI Key | QQOXBFUTRLDXDP-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
Ethyl salicylate, 99%
CAS: 118-61-6 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002215 InChI Key: GYCKQBWUSACYIF-UHFFFAOYSA-N Synonym: ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester PubChem CID: 8365 IUPAC Name: ethyl 2-hydroxybenzoate SMILES: CCOC(=O)C1=CC=CC=C1O
| PubChem CID | 8365 |
|---|---|
| CAS | 118-61-6 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002215 |
| SMILES | CCOC(=O)C1=CC=CC=C1O |
| Synonym | ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester |
| IUPAC Name | ethyl 2-hydroxybenzoate |
| InChI Key | GYCKQBWUSACYIF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 2-hydroxy-3-methylbenzoate, 97%
CAS: 23287-26-5 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00020051 InChI Key: SUHLUMKZPUMAFP-UHFFFAOYSA-N Synonym: methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester PubChem CID: 31835 IUPAC Name: methyl 2-hydroxy-3-methylbenzoate SMILES: COC(=O)C1=CC=CC(C)=C1O
| PubChem CID | 31835 |
|---|---|
| CAS | 23287-26-5 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00020051 |
| SMILES | COC(=O)C1=CC=CC(C)=C1O |
| Synonym | methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester |
| IUPAC Name | methyl 2-hydroxy-3-methylbenzoate |
| InChI Key | SUHLUMKZPUMAFP-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Isobutyl 4-hydroxybenzoate, 98%
CAS: 2-3-4247 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00020167 InChI Key: XPJVKCRENWUEJH-UHFFFAOYSA-N Synonym: isobutyl 4-hydroxybenzoate,isobutylparaben,isobutyl p-hydroxybenzoate,isobutyl paraben,isobutyl-4-hydroxybenzoate,isobutyl parahydroxybenzoate,4-hydroxybenzoic acid isobutyl ester,benzoic acid, 4-hydroxy-, 2-methylpropyl ester,p-oxybenzoesaureisobutylester,unii-0qqj25x58g PubChem CID: 20240 IUPAC Name: 2-methylpropyl 4-hydroxybenzoate SMILES: CC(C)COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 20240 |
|---|---|
| CAS | 2-3-4247 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00020167 |
| SMILES | CC(C)COC(=O)C1=CC=C(C=C1)O |
| Synonym | isobutyl 4-hydroxybenzoate,isobutylparaben,isobutyl p-hydroxybenzoate,isobutyl paraben,isobutyl-4-hydroxybenzoate,isobutyl parahydroxybenzoate,4-hydroxybenzoic acid isobutyl ester,benzoic acid, 4-hydroxy-, 2-methylpropyl ester,p-oxybenzoesaureisobutylester,unii-0qqj25x58g |
| IUPAC Name | 2-methylpropyl 4-hydroxybenzoate |
| InChI Key | XPJVKCRENWUEJH-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
n-Heptyl 4-hydroxybenzoate, 98%
CAS: 1085-12-7 Molecular Formula: C14H20O3 Molecular Weight (g/mol): 236.31 MDL Number: MFCD00016481 InChI Key: ZTJORNVITHUQJA-UHFFFAOYSA-N Synonym: heptylparaben,heptyl paraben,heptyl p-hydroxybenzoate,n-heptyl 4-hydroxybenzoate,nipaheptyl,staypro ws 7,n-heptyl p-hydroxybenzoate,benzoic acid, 4-hydroxy-, heptyl ester,p-hydroxybenzoic acid heptyl ester,p-oxybenzoesaureheptylester PubChem CID: 14138 ChEBI: CHEBI:34788 IUPAC Name: heptyl 4-hydroxybenzoate SMILES: CCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14138 |
|---|---|
| CAS | 1085-12-7 |
| Molecular Weight (g/mol) | 236.31 |
| ChEBI | CHEBI:34788 |
| MDL Number | MFCD00016481 |
| SMILES | CCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | heptylparaben,heptyl paraben,heptyl p-hydroxybenzoate,n-heptyl 4-hydroxybenzoate,nipaheptyl,staypro ws 7,n-heptyl p-hydroxybenzoate,benzoic acid, 4-hydroxy-, heptyl ester,p-hydroxybenzoic acid heptyl ester,p-oxybenzoesaureheptylester |
| IUPAC Name | heptyl 4-hydroxybenzoate |
| InChI Key | ZTJORNVITHUQJA-UHFFFAOYSA-N |
| Molecular Formula | C14H20O3 |
Ethyl 3,4-dihydroxybenzoate, 97%
CAS: 3943-89-3 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002199 InChI Key: KBPUBCVJHFXPOC-UHFFFAOYSA-N Synonym: ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester PubChem CID: 77547 IUPAC Name: ethyl 3,4-dihydroxybenzoate SMILES: CCOC(=O)C1=CC=C(O)C(O)=C1
| PubChem CID | 77547 |
|---|---|
| CAS | 3943-89-3 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002199 |
| SMILES | CCOC(=O)C1=CC=C(O)C(O)=C1 |
| Synonym | ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester |
| IUPAC Name | ethyl 3,4-dihydroxybenzoate |
| InChI Key | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
Methyl salicylate, 98%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |