Benzoic acid esters
- (14)
- (28)
- (1)
- (22)
- (7)
- (4)
- (4)
- (6)
- (1)
- (8)
- (1)
- (10)
- (1)
- (26)
- (3)
- (6)
- (2)
- (4)
- (26)
- (30)
- (16)
- (3)
- (4)
- (13)
- (5)
- (97)
- (24)
- (3)
- (5)
- (1)
- (33)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (5)
- (3)
- (1)
Filtered Search Results
Methyl 5-iodosalicylate, 99%
CAS: 4068-75-1 Molecular Formula: C8H7IO3 Molecular Weight (g/mol): 278.045 MDL Number: MFCD00016462 InChI Key: NRSWJTRJHPRZMH-UHFFFAOYSA-N PubChem CID: 248910 IUPAC Name: methyl 2-hydroxy-5-iodobenzoate SMILES: COC(=O)C1=C(C=CC(=C1)I)O
| PubChem CID | 248910 |
|---|---|
| CAS | 4068-75-1 |
| Molecular Weight (g/mol) | 278.045 |
| MDL Number | MFCD00016462 |
| SMILES | COC(=O)C1=C(C=CC(=C1)I)O |
| IUPAC Name | methyl 2-hydroxy-5-iodobenzoate |
| InChI Key | NRSWJTRJHPRZMH-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO3 |
n-Pentyl 4-hydroxybenzoate, 98%
CAS: 6521-29-5 Molecular Formula: C12H16O3 Molecular Weight (g/mol): 208.26 MDL Number: MFCD00016479 InChI Key: ZNSSPLQZSUWFJT-UHFFFAOYSA-N PubChem CID: 23019 IUPAC Name: pentyl 4-hydroxybenzoate SMILES: CCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 23019 |
|---|---|
| CAS | 6521-29-5 |
| Molecular Weight (g/mol) | 208.26 |
| MDL Number | MFCD00016479 |
| SMILES | CCCCCOC(=O)C1=CC=C(O)C=C1 |
| IUPAC Name | pentyl 4-hydroxybenzoate |
| InChI Key | ZNSSPLQZSUWFJT-UHFFFAOYSA-N |
| Molecular Formula | C12H16O3 |
Methyl salicylate, 98%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 4-iodosalicylate, 98%
CAS: 18179-39-0 Molecular Formula: C8H7IO3 Molecular Weight (g/mol): 278.045 MDL Number: MFCD06797864 InChI Key: WUFUURSWOJROKY-UHFFFAOYSA-N Synonym: methyl 4-iodosalicylate,2-hydroxy-4-iodobenzoic acid methyl ester,benzoic acid,2-hydroxy-4-iodo-, methyl ester,methyl-4-iodosalicylate,methyl 4-iodosalicyclate,acmc-1c81e,methyl2-hydroxy-4-iodobenzoate,methyl 4-iodo-2-hydroxybenzoate,methyl-2-hydroxy-4-iodo-benzoate PubChem CID: 11380407 IUPAC Name: methyl 2-hydroxy-4-iodobenzoate SMILES: COC(=O)C1=C(C=C(C=C1)I)O
| PubChem CID | 11380407 |
|---|---|
| CAS | 18179-39-0 |
| Molecular Weight (g/mol) | 278.045 |
| MDL Number | MFCD06797864 |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)O |
| Synonym | methyl 4-iodosalicylate,2-hydroxy-4-iodobenzoic acid methyl ester,benzoic acid,2-hydroxy-4-iodo-, methyl ester,methyl-4-iodosalicylate,methyl 4-iodosalicyclate,acmc-1c81e,methyl2-hydroxy-4-iodobenzoate,methyl 4-iodo-2-hydroxybenzoate,methyl-2-hydroxy-4-iodo-benzoate |
| IUPAC Name | methyl 2-hydroxy-4-iodobenzoate |
| InChI Key | WUFUURSWOJROKY-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO3 |
Isopropyl 4-hydroxybenzoate, 98%
CAS: 4191-73-5 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00016468 InChI Key: CMHMMKSPYOOVGI-UHFFFAOYSA-N Synonym: isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester PubChem CID: 20161 IUPAC Name: propan-2-yl 4-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 20161 |
|---|---|
| CAS | 4191-73-5 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00016468 |
| SMILES | CC(C)OC(=O)C1=CC=C(O)C=C1 |
| Synonym | isopropyl 4-hydroxybenzoate,isopropylparaben,isopropyl p-hydroxybenzoate,isopropyl paraben,p-hydroxybenzoic acid isopropyl ester,isopropylhydroxybenzoate,unii-a6eox47qk0,p-oxybenzoesaureisopropylester,4-hydroxybenzoic acid isopropyl ester,benzoic acid, 4-hydroxy-, 1-methylethyl ester |
| IUPAC Name | propan-2-yl 4-hydroxybenzoate |
| InChI Key | CMHMMKSPYOOVGI-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 3,5-dihydroxybenzoate, 98%
CAS: 2150-44-9 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002289 InChI Key: RNVFYQUEEMZKLR-UHFFFAOYSA-N Synonym: 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate PubChem CID: 75076 IUPAC Name: methyl 3,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 75076 |
|---|---|
| CAS | 2150-44-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002289 |
| SMILES | COC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate |
| IUPAC Name | methyl 3,5-dihydroxybenzoate |
| InChI Key | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 3-amino-4-hydroxybenzoate, 95%
CAS: 536-25-4 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00017095 InChI Key: VNQABZCSYCTZMS-UHFFFAOYSA-N Synonym: orthocaine,orthoform,aminobenz,orthoderm,3-amino-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-amino-4-hydroxy-, methyl ester,methyl m-amino-p-hydroxybenzoate,methyl 4-hydroxy-3-aminobenzoate,methyl 3-amino-4-hydroxybenzenecarboxylate,unii-jk16yi13qk PubChem CID: 10815 ChEBI: CHEBI:34904 IUPAC Name: methyl 3-amino-4-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C=C1)O)N
| PubChem CID | 10815 |
|---|---|
| CAS | 536-25-4 |
| Molecular Weight (g/mol) | 167.164 |
| ChEBI | CHEBI:34904 |
| MDL Number | MFCD00017095 |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)N |
| Synonym | orthocaine,orthoform,aminobenz,orthoderm,3-amino-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-amino-4-hydroxy-, methyl ester,methyl m-amino-p-hydroxybenzoate,methyl 4-hydroxy-3-aminobenzoate,methyl 3-amino-4-hydroxybenzenecarboxylate,unii-jk16yi13qk |
| IUPAC Name | methyl 3-amino-4-hydroxybenzoate |
| InChI Key | VNQABZCSYCTZMS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
Methyl 4-fluoro-3-hydroxybenzoate, 98+%
CAS: 214822-96-5 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.139 MDL Number: MFCD06797457 InChI Key: CUGWNEOTLGLGDG-UHFFFAOYSA-N Synonym: 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester PubChem CID: 12016892 IUPAC Name: methyl 4-fluoro-3-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C=C1)F)O
| PubChem CID | 12016892 |
|---|---|
| CAS | 214822-96-5 |
| Molecular Weight (g/mol) | 170.139 |
| MDL Number | MFCD06797457 |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)O |
| Synonym | 4-fluoro-3-hydroxybenzoic acid methyl ester,benzoic acid, 4-fluoro-3-hydroxy-, methyl ester,pubchem3567,acmc-209fky,methyl4-fluoro-3-hydroxybenzoate,methyl 4-fluoranyl-3-oxidanyl-benzoate,3-hydroxy-4-fluorobenzoic acid methyl ester,4-fluoro-3-hydroxy-benzoic acid methyl ester,benzoic acid,4-fluoro-3-hydroxy-, methyl ester |
| IUPAC Name | methyl 4-fluoro-3-hydroxybenzoate |
| InChI Key | CUGWNEOTLGLGDG-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 3,5-di-tert-butyl-4-hydroxybenzoate, 98%
CAS: 2511-22-0 Molecular Formula: C16H24O3 Molecular Weight (g/mol): 264.37 MDL Number: MFCD00017253 InChI Key: UPVYFJALDJUSOV-UHFFFAOYSA-N Synonym: methyl 3,5-di-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-bis 1,1-dimethylethyl-4-hydroxy-, methyl ester,3,5-di-tert-butyl-4-hydroxybenzoic acid methyl ester,3,5-bis 1,1-dimethylethyl-4-hydroxy-benzoic acid ethyl ester,acmc-20akhp,methyl 3,5-bis-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-di-tert-butyl-4-hydroxy-, methyl ester,methyl 3,5-di-tert.butyl-4-hydroxylbenzoate,methyl 3,5-bis tert-butyl-4-hydroxybenzoate PubChem CID: 75639 IUPAC Name: methyl 3,5-ditert-butyl-4-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
| PubChem CID | 75639 |
|---|---|
| CAS | 2511-22-0 |
| Molecular Weight (g/mol) | 264.37 |
| MDL Number | MFCD00017253 |
| SMILES | COC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C |
| Synonym | methyl 3,5-di-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-bis 1,1-dimethylethyl-4-hydroxy-, methyl ester,3,5-di-tert-butyl-4-hydroxybenzoic acid methyl ester,3,5-bis 1,1-dimethylethyl-4-hydroxy-benzoic acid ethyl ester,acmc-20akhp,methyl 3,5-bis-tert-butyl-4-hydroxybenzoate,benzoic acid, 3,5-di-tert-butyl-4-hydroxy-, methyl ester,methyl 3,5-di-tert.butyl-4-hydroxylbenzoate,methyl 3,5-bis tert-butyl-4-hydroxybenzoate |
| IUPAC Name | methyl 3,5-ditert-butyl-4-hydroxybenzoate |
| InChI Key | UPVYFJALDJUSOV-UHFFFAOYSA-N |
| Molecular Formula | C16H24O3 |
Propyl 4-hydroxybenzoate, 99+%
CAS: 94-13-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.2 MDL Number: MFCD00002354 InChI Key: QELSKZZBTMNZEB-UHFFFAOYSA-N Synonym: propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept PubChem CID: 7175 ChEBI: CHEBI:32063 IUPAC Name: propyl 4-hydroxybenzoate SMILES: CCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7175 |
|---|---|
| CAS | 94-13-3 |
| Molecular Weight (g/mol) | 180.2 |
| ChEBI | CHEBI:32063 |
| MDL Number | MFCD00002354 |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept |
| IUPAC Name | propyl 4-hydroxybenzoate |
| InChI Key | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 4-aminosalicylate, 97%, Thermo Scientific Chemicals
CAS: 4136-97-4 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00088091 InChI Key: QQOXBFUTRLDXDP-UHFFFAOYSA-N Synonym: methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester PubChem CID: 77787 ChEBI: CHEBI:35089 IUPAC Name: methyl 4-amino-2-hydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1)N)O
| PubChem CID | 77787 |
|---|---|
| CAS | 4136-97-4 |
| Molecular Weight (g/mol) | 167.164 |
| ChEBI | CHEBI:35089 |
| MDL Number | MFCD00088091 |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)O |
| Synonym | methyl 4-aminosalicylate,methyl p-aminosalicylate,pas methyl ester,p-aminosalicylic acid methyl ester,methyl 4-amino-2-hydroxybenzenecarboxylate,benzoic acid, 4-amino-2-hydroxy-, methyl ester,methyl 4-amino-2-hydroxy-benzoate,salicylic acid, amino-, methyl ester,4-aminosalicylic acid methyl ester,4-amino-2-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 4-amino-2-hydroxybenzoate |
| InChI Key | QQOXBFUTRLDXDP-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
n-Octyl 4-hydroxybenzoate, 98%
CAS: 1219-38-1 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00016482 InChI Key: RIKCMEDSBFQFAL-UHFFFAOYSA-N Synonym: octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german PubChem CID: 14642 IUPAC Name: octyl 4-hydroxybenzoate SMILES: CCCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14642 |
|---|---|
| CAS | 1219-38-1 |
| Molecular Weight (g/mol) | 250.34 |
| MDL Number | MFCD00016482 |
| SMILES | CCCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german |
| IUPAC Name | octyl 4-hydroxybenzoate |
| InChI Key | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |
Methyl 4-hydroxy-3-iodobenzoate, 98%
CAS: 15126-06-4 Molecular Formula: C8H7IO3 Molecular Weight (g/mol): 278.045 MDL Number: MFCD05664378 InChI Key: PXNOLLHARLSLHY-UHFFFAOYSA-N Synonym: methyl4-hydroxy-3-iodobenzoate,methyl 3-iodo-4-hydroxybenzoate,methyl 4-hydroxy-3-iodo-benzoate,4-hydroxy-3-iodobenzoic acid methyl ester,4-hydroxy-3-iodo-benzoic acid methyl ester,benzoic acid, 4-hydroxy-3-iodo-, methyl ester,4-hydroxy-3-iodo-benzoicacidmethylester,acmc-209zk0,ksc495e2f,methyl 4-hydroxy-3-iodbenzoate PubChem CID: 11346465 IUPAC Name: methyl 4-hydroxy-3-iodobenzoate SMILES: COC(=O)C1=CC(=C(C=C1)O)I
| PubChem CID | 11346465 |
|---|---|
| CAS | 15126-06-4 |
| Molecular Weight (g/mol) | 278.045 |
| MDL Number | MFCD05664378 |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)I |
| Synonym | methyl4-hydroxy-3-iodobenzoate,methyl 3-iodo-4-hydroxybenzoate,methyl 4-hydroxy-3-iodo-benzoate,4-hydroxy-3-iodobenzoic acid methyl ester,4-hydroxy-3-iodo-benzoic acid methyl ester,benzoic acid, 4-hydroxy-3-iodo-, methyl ester,4-hydroxy-3-iodo-benzoicacidmethylester,acmc-209zk0,ksc495e2f,methyl 4-hydroxy-3-iodbenzoate |
| IUPAC Name | methyl 4-hydroxy-3-iodobenzoate |
| InChI Key | PXNOLLHARLSLHY-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO3 |
Methyl 3-bromo-5-hydroxybenzoate, 97%, Thermo Scientific Chemicals
CAS: 192810-12-1 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD10566800 InChI Key: KRTBWIIGEJIUSA-UHFFFAOYSA-N Synonym: 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester PubChem CID: 53216607 IUPAC Name: methyl 3-bromo-5-hydroxybenzoate SMILES: COC(=O)C1=CC(=CC(=C1)Br)O
| PubChem CID | 53216607 |
|---|---|
| CAS | 192810-12-1 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD10566800 |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)O |
| Synonym | 3-bromo-5-hydroxybenzoic acid methyl ester,acmc-209f1w,methyl3-bromo-5-hydroxybenzoate,methyl 3-bromo-5-hydroxylbenzoate,3-bromo-5-hydroxy-benzoic acid methyl ester,benzoic acid,3-bromo-5-hydroxy-,methyl ester,benzoic acid, 3-bromo-5-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-bromo-5-hydroxybenzoate |
| InChI Key | KRTBWIIGEJIUSA-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |