Xylenes
Xylenes are any one of three isomers of dimethylbenzene, or a combination thereof. All are colorless, flammable liquids composed of a central benzene ring with two methyl groups attached at substituents. They can be applied as precursor chemicals and solvents.
Xylenes are flammable petrochemical products that can be produced via catalytic reforming and coal carbonization during coke production and found in crude oil, gasoline, and aircraft fuel. Xylenes were first isolated from wood tar and named by the French chemist Auguste Cahours.
What Is Xylene?
Xylene, more appropriately called xylenes, refers to any single or combination of the three isomers of dimethylbenzene. The isomeric forms are designated as ortho- (o-), meta- (m-), and para- (p-), a reference to the carbon in the benzene ring to which the two methyl groups are attached.
- o-isomer: 1,2-dimethylbenzene
- m-isomer: 1,3-dimethylbenzene
- p-isomer: 1,4-dimethylbenzene
Xylenes are colorless and can be detected by odor at concentrations as low as 0.08 to 3.7 ppm in air and tasted in water at 0.53 to 1.8 ppm.
Refer to the Certificate of Analysis or the Safety Data Sheet for specific information about xylene density and safety hazards.
What Is Xylene Used For?
Industrial Uses
p-Xylene is a precursor to terephthalic acid and dimethyl terephthalate, used to make polyethylene terephthalate plastic bottles and polyester clothing.
Xylene can be used as a solvent and is a common component of ink, rubber, adhesives, and paint and varnish thinners. Xylenes may be used to clean steel, silicon wafers, and integrated circuits. Medical applications include use as a solvent of dental materials and ear wax.
Laboratory Uses
Xylene can be used with dry ice in baths, to remove oil from microscope objectives, and as a cleaning agent or mounting material in histology procedures.
- (3)
- (21)
- (61)
- (1)
- (1)
- (1)
- (3)
- (19)
- (2)
- (6)
- (1)
- (3)
- (1)
- (7)
- (18)
- (10)
- (4)
- (57)
- (1)
- (16)
- (10)
- (2)
- (10)
- (9)
- (26)
- (3)
- (2)
- (1)
- (6)
- (8)
- (7)
- (5)
- (1)
- (1)
- (2)
- (1)
- (1)
Résultats de la recherche filtrée
Xylenes (Histological), Fisher Chemical™
CAS: 1330-20-7 Formule moléculaire: C8H10 Numéro MDL: MFCD00077264 Synonyme: Xylol,Dimethylbenzene
| Synonyme | Xylol,Dimethylbenzene |
|---|---|
| Numéro MDL | MFCD00077264 |
| CAS | 1330-20-7 |
| Formule moléculaire | C8H10 |
| Numéro MDL | MFCD00077264 |
|---|---|
| CAS | 1330-20-7 |
o-Xylene (Certified), Fisher Chemical
CAS: 95-47-6 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008519 Clé InChI: CTQNGGLPUBDAKN-UHFFFAOYSA-N Synonyme: o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes CID PubChem: 7237 ChEBI: CHEBI:28063 Nom IUPAC: 1,2-xylene SMILES: CC1=CC=CC=C1C
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes |
| Numéro MDL | MFCD00008519 |
| CAS | 95-47-6 |
| CID PubChem | 7237 |
| ChEBI | CHEBI:28063 |
| Nom IUPAC | 1,2-xylene |
| Clé InChI | CTQNGGLPUBDAKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C |
| Formule moléculaire | C8H10 |
3,4-Dimethylthiobenzamide, 97%, Thermo Scientific Chemicals
CAS: 58952-03-7 Formule moléculaire: C9H11NS Poids moléculaire (g/mol): 165.25 Numéro MDL: MFCD06738326 Clé InChI: MGSZKKVFYBQMPF-UHFFFAOYSA-N Synonyme: 3,4-dimethyl-thiobenzamide,3,4-dimethylthiobenzamide,3,4-dimethylbenzothioamide,3,4-dimethylbenzene-1-carbothioamide,3,4-dimethyl-thiobenzamid CID PubChem: 20470851 Nom IUPAC: 3,4-dimethylbenzenecarbothioamide SMILES: CC1=C(C)C=C(C=C1)C(N)=S
| Poids moléculaire (g/mol) | 165.25 |
|---|---|
| Synonyme | 3,4-dimethyl-thiobenzamide,3,4-dimethylthiobenzamide,3,4-dimethylbenzothioamide,3,4-dimethylbenzene-1-carbothioamide,3,4-dimethyl-thiobenzamid |
| Numéro MDL | MFCD06738326 |
| CAS | 58952-03-7 |
| CID PubChem | 20470851 |
| Nom IUPAC | 3,4-dimethylbenzenecarbothioamide |
| Clé InChI | MGSZKKVFYBQMPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C=C(C=C1)C(N)=S |
| Formule moléculaire | C9H11NS |
2,6-Dimethylaniline, 99%
CAS: 87-62-7 Formule moléculaire: C8H11N Poids moléculaire (g/mol): 121.18 Numéro MDL: MFCD00007747 Clé InChI: UFFBMTHBGFGIHF-UHFFFAOYSA-N Synonyme: 2,6-xylidine,2-amino-m-xylene,o-xylidine,2,6-dimethylbenzenamine,2-amino-1,3-dimethylbenzene,2,6-dimethylphenylamine,benzenamine, 2,6-dimethyl,2,6-xylylamine,2-amino-1,3-xylene,1-amino-2,6-dimethylbenzene CID PubChem: 6896 ChEBI: CHEBI:28738 Nom IUPAC: 2,6-dimethylaniline SMILES: CC1=CC=CC(C)=C1N
| Poids moléculaire (g/mol) | 121.18 |
|---|---|
| Synonyme | 2,6-xylidine,2-amino-m-xylene,o-xylidine,2,6-dimethylbenzenamine,2-amino-1,3-dimethylbenzene,2,6-dimethylphenylamine,benzenamine, 2,6-dimethyl,2,6-xylylamine,2-amino-1,3-xylene,1-amino-2,6-dimethylbenzene |
| Numéro MDL | MFCD00007747 |
| CAS | 87-62-7 |
| CID PubChem | 6896 |
| ChEBI | CHEBI:28738 |
| Nom IUPAC | 2,6-dimethylaniline |
| Clé InChI | UFFBMTHBGFGIHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(C)=C1N |
| Formule moléculaire | C8H11N |
3,5-Dimethylbenzoic acid, 99%
CAS: 499-06-9 Formule moléculaire: C9H10O2 Poids moléculaire (g/mol): 150.18 Numéro MDL: MFCD00002525 Clé InChI: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonyme: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid CID PubChem: 10356 ChEBI: CHEBI:64821 Nom IUPAC: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| Poids moléculaire (g/mol) | 150.18 |
|---|---|
| Synonyme | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| Numéro MDL | MFCD00002525 |
| CAS | 499-06-9 |
| CID PubChem | 10356 |
| ChEBI | CHEBI:64821 |
| Nom IUPAC | 3,5-dimethylbenzoic acid |
| Clé InChI | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Formule moléculaire | C9H10O2 |
o-Xylene, HPLC Grade, 96% min
CAS: 95-47-6 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008519 Clé InChI: CTQNGGLPUBDAKN-UHFFFAOYSA-N Synonyme: o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes CID PubChem: 7237 ChEBI: CHEBI:28063 Nom IUPAC: 1,2-xylene SMILES: CC1=CC=CC=C1C
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | o-xylene,1,2-dimethylbenzene,ortho-xylene,o-xylol,o-methyltoluene,o-dimethylbenzene,2-xylene,3,4-xylene,benzene, 1,2-dimethyl,o-xylenes |
| Numéro MDL | MFCD00008519 |
| CAS | 95-47-6 |
| CID PubChem | 7237 |
| ChEBI | CHEBI:28063 |
| Nom IUPAC | 1,2-xylene |
| Clé InChI | CTQNGGLPUBDAKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C |
| Formule moléculaire | C8H10 |
4-Fluoro-o-xylene, 98%
CAS: 452-64-2 Formule moléculaire: C8H9F Poids moléculaire (g/mol): 124.158 Numéro MDL: MFCD00039217 Clé InChI: WYHBENDEZDFJNU-UHFFFAOYSA-N Synonyme: 4-fluoro-o-xylene,1,2-dimethyl-4-fluorobenzene,3,4-dimethylfluorobenzene,4-fluoro-1,2-xylene,1-fluoro-3,4-dimethylbenzene,benzene, 4-fluoro-1,2-dimethyl,o-xylene, 4-fluoro,pubchem14118,acmc-1afww,3,4-dimethyl fluorobenzene CID PubChem: 253306 Nom IUPAC: 4-fluoro-1,2-dimethylbenzene SMILES: CC1=C(C=C(C=C1)F)C
| Poids moléculaire (g/mol) | 124.158 |
|---|---|
| Synonyme | 4-fluoro-o-xylene,1,2-dimethyl-4-fluorobenzene,3,4-dimethylfluorobenzene,4-fluoro-1,2-xylene,1-fluoro-3,4-dimethylbenzene,benzene, 4-fluoro-1,2-dimethyl,o-xylene, 4-fluoro,pubchem14118,acmc-1afww,3,4-dimethyl fluorobenzene |
| Numéro MDL | MFCD00039217 |
| CAS | 452-64-2 |
| CID PubChem | 253306 |
| Nom IUPAC | 4-fluoro-1,2-dimethylbenzene |
| Clé InChI | WYHBENDEZDFJNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C |
| Formule moléculaire | C8H9F |
4-Chloro-2,5-dimethylbenzenesulfonyl chloride, 98%
CAS: 88-49-3 Formule moléculaire: C8H8Cl2O2S Poids moléculaire (g/mol): 239.11 Numéro MDL: MFCD00044017 Clé InChI: JBYZPUBAISWVDI-UHFFFAOYSA-N Synonyme: 5-chloro-p-xylene-2-sulphonyl chloride,4-chloro-2,5-dimethylbenzene-1-sulfonyl chloride,4-chloro-2, 5-dimethylphenylsulfonyl chloride,2,5-dimethyl-4-chlorobenzenesulfonyl chloride,chloro 4-chloro-2,5-dimethylphenyl sulfone,pubchem5091,4-chloro-2,5-dimethylbenzenesulfonylchloride,4-chloro 2,5-dimethylphenylsulfonylchloride,4-chloro-2,5-dimethylphenylsulfonyl chloride,4-chloro-2,5-dimethyl-benzenesulfonyl chloride CID PubChem: 66618 Nom IUPAC: 4-chloro-2,5-dimethylbenzenesulfonyl chloride SMILES: CC1=CC(=C(C)C=C1Cl)S(Cl)(=O)=O
| Poids moléculaire (g/mol) | 239.11 |
|---|---|
| Synonyme | 5-chloro-p-xylene-2-sulphonyl chloride,4-chloro-2,5-dimethylbenzene-1-sulfonyl chloride,4-chloro-2, 5-dimethylphenylsulfonyl chloride,2,5-dimethyl-4-chlorobenzenesulfonyl chloride,chloro 4-chloro-2,5-dimethylphenyl sulfone,pubchem5091,4-chloro-2,5-dimethylbenzenesulfonylchloride,4-chloro 2,5-dimethylphenylsulfonylchloride,4-chloro-2,5-dimethylphenylsulfonyl chloride,4-chloro-2,5-dimethyl-benzenesulfonyl chloride |
| Numéro MDL | MFCD00044017 |
| CAS | 88-49-3 |
| CID PubChem | 66618 |
| Nom IUPAC | 4-chloro-2,5-dimethylbenzenesulfonyl chloride |
| Clé InChI | JBYZPUBAISWVDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C)C=C1Cl)S(Cl)(=O)=O |
| Formule moléculaire | C8H8Cl2O2S |
m-Xylene, 99+%, extra pure
CAS: 108-38-3 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008536 Clé InChI: IVSZLXZYQVIEFR-UHFFFAOYSA-N Synonyme: m-xylene,1,3-dimethylbenzene,m-xylol,m-dimethylbenzene,meta-xylene,m-methyltoluene,3-xylene,benzene, 1,3-dimethyl,1,3-dimethylbenzol,santosol 150 CID PubChem: 7929 ChEBI: CHEBI:28488 Nom IUPAC: 1,3-xylene SMILES: CC1=CC(C)=CC=C1
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | m-xylene,1,3-dimethylbenzene,m-xylol,m-dimethylbenzene,meta-xylene,m-methyltoluene,3-xylene,benzene, 1,3-dimethyl,1,3-dimethylbenzol,santosol 150 |
| Numéro MDL | MFCD00008536 |
| CAS | 108-38-3 |
| CID PubChem | 7929 |
| ChEBI | CHEBI:28488 |
| Nom IUPAC | 1,3-xylene |
| Clé InChI | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)=CC=C1 |
| Formule moléculaire | C8H10 |
p-Xylene, 99%, pure
CAS: 106-42-3 Formule moléculaire: C8H10 Poids moléculaire (g/mol): 106.17 Numéro MDL: MFCD00008556 Clé InChI: URLKBWYHVLBVBO-UHFFFAOYSA-N Synonyme: p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene CID PubChem: 7809 ChEBI: CHEBI:27417 Nom IUPAC: 1,4-xylene SMILES: CC1=CC=C(C)C=C1
| Poids moléculaire (g/mol) | 106.17 |
|---|---|
| Synonyme | p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene |
| Numéro MDL | MFCD00008556 |
| CAS | 106-42-3 |
| CID PubChem | 7809 |
| ChEBI | CHEBI:27417 |
| Nom IUPAC | 1,4-xylene |
| Clé InChI | URLKBWYHVLBVBO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C)C=C1 |
| Formule moléculaire | C8H10 |
3,3',5,5'-Tetramethylbiphenyl, 97+%
CAS: 25570-02-9 Formule moléculaire: C16H18 Poids moléculaire (g/mol): 210.32 Numéro MDL: MFCD00051910 Clé InChI: CMZYGFLOKOQMKF-UHFFFAOYSA-N CID PubChem: 520212 Nom IUPAC: 1-(3,5-dimethylphenyl)-3,5-dimethylbenzene SMILES: CC1=CC(=CC(C)=C1)C1=CC(C)=CC(C)=C1
| Poids moléculaire (g/mol) | 210.32 |
|---|---|
| Numéro MDL | MFCD00051910 |
| CAS | 25570-02-9 |
| CID PubChem | 520212 |
| Nom IUPAC | 1-(3,5-dimethylphenyl)-3,5-dimethylbenzene |
| Clé InChI | CMZYGFLOKOQMKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(C)=C1)C1=CC(C)=CC(C)=C1 |
| Formule moléculaire | C16H18 |
2-Iodo-p-xylene, 98+%
CAS: 1122-42-5 Formule moléculaire: C8H9I Poids moléculaire (g/mol): 232.064 Numéro MDL: MFCD00013708 Clé InChI: WYZVNUSNUCABRF-UHFFFAOYSA-N Synonyme: 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 CID PubChem: 70731 Nom IUPAC: 2-iodo-1,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)C)I
| Poids moléculaire (g/mol) | 232.064 |
|---|---|
| Synonyme | 2-iodo-p-xylene,1,4-dimethyl-2-iodobenzene,p-xylene, 2-iodo,1-iodo-2,5-dimethylbenzene,benzene, 2-iodo-1,4-dimethyl,2-iodo-4-xylene,2,5-dimethyliodobenzene,2-iodo-1,4-dimethyl-benzene,2,5-dimethyl-1-iodobenzene,pubchem3875 |
| Numéro MDL | MFCD00013708 |
| CAS | 1122-42-5 |
| CID PubChem | 70731 |
| Nom IUPAC | 2-iodo-1,4-dimethylbenzene |
| Clé InChI | WYZVNUSNUCABRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)I |
| Formule moléculaire | C8H9I |
2,3-Dimethylanisole, 97%
CAS: 2944-49-2 Formule moléculaire: C9H12O Poids moléculaire (g/mol): 136.194 Numéro MDL: MFCD00008376 Clé InChI: BLMBNEVGYRXFNA-UHFFFAOYSA-N Synonyme: 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole CID PubChem: 76269 Nom IUPAC: 1-methoxy-2,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)OC)C
| Poids moléculaire (g/mol) | 136.194 |
|---|---|
| Synonyme | 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole |
| Numéro MDL | MFCD00008376 |
| CAS | 2944-49-2 |
| CID PubChem | 76269 |
| Nom IUPAC | 1-methoxy-2,3-dimethylbenzene |
| Clé InChI | BLMBNEVGYRXFNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC)C |
| Formule moléculaire | C9H12O |
Xylenes, 96%, pure, mixed isomers with ethylbenzene
CAS: 1330-20-7 Formule moléculaire: C8H10 Numéro MDL: MFCD00077264 Synonyme: Dimethylbenzene
| Synonyme | Dimethylbenzene |
|---|---|
| Numéro MDL | MFCD00077264 |
| CAS | 1330-20-7 |
| Formule moléculaire | C8H10 |