Organometallic Compounds
Filtered Search Results
1,1,1,3,3,3-Hexamethyldisilazane, 98%
CAS: 999-97-3 Molecular Formula: C6H19NSi2 Molecular Weight (g/mol): 161.4 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| PubChem CID | 13838 |
|---|---|
| CAS | 999-97-3 |
| Molecular Weight (g/mol) | 161.4 |
| ChEBI | CHEBI:85068 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molecular Formula | C6H19NSi2 |
2-Nitrophenylselenocyanate, 97%
CAS: 51694-22-5 Molecular Formula: C7H4N2O2Se Molecular Weight (g/mol): 227.092 MDL Number: MFCD00043146 InChI Key: LHBLJWULWKQRON-UHFFFAOYSA-N Synonym: selenocyanic acid, 2-nitrophenyl ester,2-nitrophenyl selenocyanate,2-nitrophenylselenocyanate,o-nitrophenyl selenocyanate,1-nitro-2-selenocyanatobenzene,2-nitrophenyl selanyl formonitrile,2-nitrophenyl selenocyanic acid,ortho-nitrophenyl selenocyanate,acmc-20anow,o-nitrophenylselenocyanate PubChem CID: 103931 IUPAC Name: (2-nitrophenyl) selenocyanate SMILES: C1=CC=C(C(=C1)[N+](=O)[O-])[Se]C#N
| PubChem CID | 103931 |
|---|---|
| CAS | 51694-22-5 |
| Molecular Weight (g/mol) | 227.092 |
| MDL Number | MFCD00043146 |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])[Se]C#N |
| Synonym | selenocyanic acid, 2-nitrophenyl ester,2-nitrophenyl selenocyanate,2-nitrophenylselenocyanate,o-nitrophenyl selenocyanate,1-nitro-2-selenocyanatobenzene,2-nitrophenyl selanyl formonitrile,2-nitrophenyl selenocyanic acid,ortho-nitrophenyl selenocyanate,acmc-20anow,o-nitrophenylselenocyanate |
| IUPAC Name | (2-nitrophenyl) selenocyanate |
| InChI Key | LHBLJWULWKQRON-UHFFFAOYSA-N |
| Molecular Formula | C7H4N2O2Se |
Phenyl selenocyanate, 98%
CAS: 2179-79-5 Molecular Formula: C7H5NSe Molecular Weight (g/mol): 182.095 MDL Number: MFCD00216944 InChI Key: NODWRXQVQYOJGN-UHFFFAOYSA-N Synonym: phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile PubChem CID: 555340 IUPAC Name: phenyl selenocyanate SMILES: C1=CC=C(C=C1)[Se]C#N
| PubChem CID | 555340 |
|---|---|
| CAS | 2179-79-5 |
| Molecular Weight (g/mol) | 182.095 |
| MDL Number | MFCD00216944 |
| SMILES | C1=CC=C(C=C1)[Se]C#N |
| Synonym | phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile |
| IUPAC Name | phenyl selenocyanate |
| InChI Key | NODWRXQVQYOJGN-UHFFFAOYSA-N |
| Molecular Formula | C7H5NSe |
N,N-Diethyl-1,1,1-trimethylsilylamine, 98+%
CAS: 996-50-9 Molecular Formula: C7H19NSi Molecular Weight (g/mol): 145.32 MDL Number: MFCD00009040 InChI Key: JOOMLFKONHCLCJ-UHFFFAOYSA-N Synonym: n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine PubChem CID: 70454 ChEBI: CHEBI:85070 IUPAC Name: N-ethyl-N-trimethylsilylethanamine SMILES: CCN(CC)[Si](C)(C)C
| PubChem CID | 70454 |
|---|---|
| CAS | 996-50-9 |
| Molecular Weight (g/mol) | 145.32 |
| ChEBI | CHEBI:85070 |
| MDL Number | MFCD00009040 |
| SMILES | CCN(CC)[Si](C)(C)C |
| Synonym | n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine |
| IUPAC Name | N-ethyl-N-trimethylsilylethanamine |
| InChI Key | JOOMLFKONHCLCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H19NSi |
Diethyl(3-pyridyl)borane, 97%, Thermo Scientific Chemicals
CAS: 89878-14-8 Molecular Formula: C9H14BN Molecular Weight (g/mol): 147.03 MDL Number: MFCD00012348 InChI Key: OJKBCQOJVMAHDX-UHFFFAOYSA-N Synonym: diethyl 3-pyridyl borane,3-diethylboryl pyridine,diethyl 3-pyridinyl borane,pyridine, 3-diethylboryl,3-diethylboranyl pyridine,diethyl-3-pyridylborane,dithyl 3-pyridyl borane,3-pyridyldiethylborane,diethyl 3-pyridyl bo PubChem CID: 642851 IUPAC Name: diethyl(pyridin-3-yl)borane SMILES: CCB(CC)C1=CN=CC=C1
| PubChem CID | 642851 |
|---|---|
| CAS | 89878-14-8 |
| Molecular Weight (g/mol) | 147.03 |
| MDL Number | MFCD00012348 |
| SMILES | CCB(CC)C1=CN=CC=C1 |
| Synonym | diethyl 3-pyridyl borane,3-diethylboryl pyridine,diethyl 3-pyridinyl borane,pyridine, 3-diethylboryl,3-diethylboranyl pyridine,diethyl-3-pyridylborane,dithyl 3-pyridyl borane,3-pyridyldiethylborane,diethyl 3-pyridyl bo |
| IUPAC Name | diethyl(pyridin-3-yl)borane |
| InChI Key | OJKBCQOJVMAHDX-UHFFFAOYSA-N |
| Molecular Formula | C9H14BN |
2-(Trimethylsilyl)thiophene, 97%
CAS: 18245-28-8 Molecular Formula: C7H12SSi Molecular Weight (g/mol): 156.318 MDL Number: MFCD00005415 InChI Key: OANGLGSZPSFVDY-UHFFFAOYSA-N Synonym: 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane PubChem CID: 140360 IUPAC Name: trimethyl(thiophen-2-yl)silane SMILES: C[Si](C)(C)C1=CC=CS1
| PubChem CID | 140360 |
|---|---|
| CAS | 18245-28-8 |
| Molecular Weight (g/mol) | 156.318 |
| MDL Number | MFCD00005415 |
| SMILES | C[Si](C)(C)C1=CC=CS1 |
| Synonym | 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane |
| IUPAC Name | trimethyl(thiophen-2-yl)silane |
| InChI Key | OANGLGSZPSFVDY-UHFFFAOYSA-N |
| Molecular Formula | C7H12SSi |
(3-chloropropyl)trimethoxysilane, 98+%
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.72 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.72 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
Triethylborane, 1M soln. in THF
CAS: 97-94-9 Molecular Formula: C6H15B Molecular Weight (g/mol): 98.00 MDL Number: MFCD00009022 InChI Key: LALRXNPLTWZJIJ-UHFFFAOYSA-N Synonym: triethylboron,borane, triethyl,triethylborine,boron triethyl,boron ethyl,unii-z3s980z4p3,hsdb 897,triethylboran,borethyl,triethyl borane PubChem CID: 7357 IUPAC Name: triethylborane SMILES: CCB(CC)CC
| PubChem CID | 7357 |
|---|---|
| CAS | 97-94-9 |
| Molecular Weight (g/mol) | 98.00 |
| MDL Number | MFCD00009022 |
| SMILES | CCB(CC)CC |
| Synonym | triethylboron,borane, triethyl,triethylborine,boron triethyl,boron ethyl,unii-z3s980z4p3,hsdb 897,triethylboran,borethyl,triethyl borane |
| IUPAC Name | triethylborane |
| InChI Key | LALRXNPLTWZJIJ-UHFFFAOYSA-N |
| Molecular Formula | C6H15B |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 10% TMCS
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.403 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.403 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
(3-Bromopropoxy)-tert-butyldimethylsilane, 97%, stabilized over sodium carbonate
CAS: 89031-84-5 Molecular Formula: C9H21BrOSi Molecular Weight (g/mol): 253.26 InChI Key: QGMROEZDWJTIDW-UHFFFAOYSA-N Synonym: 3-bromopropoxy-tert-butyldimethylsilane,3-bromopropoxy tert-butyl dimethylsilane,3-bromopropoxy-t-butyldimethylsilane,3-bromopropoxy-tert-butyl-dimethyl-silane,silane, 3-bromopropoxy 1,1-dimethylethyl dimethyl,acmc-209unq,t-butyl 3-bromopropoxy dimethylsilane,bromopropoxy-tert-butyldimethyl silane PubChem CID: 607486 IUPAC Name: 3-bromopropoxy-tert-butyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)OCCCBr
| PubChem CID | 607486 |
|---|---|
| CAS | 89031-84-5 |
| Molecular Weight (g/mol) | 253.26 |
| SMILES | CC(C)(C)[Si](C)(C)OCCCBr |
| Synonym | 3-bromopropoxy-tert-butyldimethylsilane,3-bromopropoxy tert-butyl dimethylsilane,3-bromopropoxy-t-butyldimethylsilane,3-bromopropoxy-tert-butyl-dimethyl-silane,silane, 3-bromopropoxy 1,1-dimethylethyl dimethyl,acmc-209unq,t-butyl 3-bromopropoxy dimethylsilane,bromopropoxy-tert-butyldimethyl silane |
| IUPAC Name | 3-bromopropoxy-tert-butyl-dimethylsilane |
| InChI Key | QGMROEZDWJTIDW-UHFFFAOYSA-N |
| Molecular Formula | C9H21BrOSi |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Boiling Point | 65.0°C |
|---|---|
| Linear Formula | ((CH3)3Si)2NLi |
| Molecular Weight (g/mol) | 167.33 |
| Chemical Name or Material | Lithium bis(trimethylsilyl)amide |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Density | 0.9000g/mL |
| PubChem CID | 2733832 |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Solubility Information | Solubility in water: reacts. |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| Molecular Formula | C6H18LiNSi2 |
| EINECS Number | 223-725-6 |
| Formula Weight | 167.33 |
| Specific Gravity | 0.9 |
Potassium ethyltrifluoroborate, 97%
CAS: 44248-07-9 Molecular Formula: C2H5BF3K Molecular Weight (g/mol): 135.97 MDL Number: MFCD04112713 InChI Key: GIIPADVFWNGSKY-UHFFFAOYSA-N Synonym: potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- PubChem CID: 23668491 IUPAC Name: potassium;ethyl(trifluoro)boranuide SMILES: [K+].CC[B-](F)(F)F
| PubChem CID | 23668491 |
|---|---|
| CAS | 44248-07-9 |
| Molecular Weight (g/mol) | 135.97 |
| MDL Number | MFCD04112713 |
| SMILES | [K+].CC[B-](F)(F)F |
| Synonym | potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- |
| IUPAC Name | potassium;ethyl(trifluoro)boranuide |
| InChI Key | GIIPADVFWNGSKY-UHFFFAOYSA-N |
| Molecular Formula | C2H5BF3K |
Trimethylsilanol
CAS: 1066-40-6 Molecular Formula: C3H9LiOSi Molecular Weight (g/mol): 96.13 MDL Number: MFCD02751657 InChI Key: OXOZHAWWRPCVGL-UHFFFAOYSA-N Synonym: trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt PubChem CID: 66110 IUPAC Name: hydroxy(trimethyl)silane SMILES: [Li+].C[Si](C)(C)[O-]
| PubChem CID | 66110 |
|---|---|
| CAS | 1066-40-6 |
| Molecular Weight (g/mol) | 96.13 |
| MDL Number | MFCD02751657 |
| SMILES | [Li+].C[Si](C)(C)[O-] |
| Synonym | trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt |
| IUPAC Name | hydroxy(trimethyl)silane |
| InChI Key | OXOZHAWWRPCVGL-UHFFFAOYSA-N |
| Molecular Formula | C3H9LiOSi |
Aluminum acrylate
CAS: 15743-20-1 Molecular Formula: C9H12AlO6 Molecular Weight (g/mol): 243.171 MDL Number: MFCD00078421 InChI Key: UNGWYUCJMHZVEX-UHFFFAOYSA-N Synonym: aluminum acrylate PubChem CID: 131874419 IUPAC Name: aluminum;prop-2-enoic acid SMILES: C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.[Al]
| PubChem CID | 131874419 |
|---|---|
| CAS | 15743-20-1 |
| Molecular Weight (g/mol) | 243.171 |
| MDL Number | MFCD00078421 |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.[Al] |
| Synonym | aluminum acrylate |
| IUPAC Name | aluminum;prop-2-enoic acid |
| InChI Key | UNGWYUCJMHZVEX-UHFFFAOYSA-N |
| Molecular Formula | C9H12AlO6 |
2-Pyridylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles
CAS: 218777-23-2 Molecular Formula: C5H5BrNZn- Molecular Weight (g/mol): 224.386 MDL Number: MFCD00671985 InChI Key: WUTSMSLAOBVVCP-UHFFFAOYSA-M Synonym: 2-pyridylzinc bromide PubChem CID: 76056926 IUPAC Name: pyridine;zinc;bromide SMILES: C1=CC=NC=C1.[Zn].[Br-]
| PubChem CID | 76056926 |
|---|---|
| CAS | 218777-23-2 |
| Molecular Weight (g/mol) | 224.386 |
| MDL Number | MFCD00671985 |
| SMILES | C1=CC=NC=C1.[Zn].[Br-] |
| Synonym | 2-pyridylzinc bromide |
| IUPAC Name | pyridine;zinc;bromide |
| InChI Key | WUTSMSLAOBVVCP-UHFFFAOYSA-M |
| Molecular Formula | C5H5BrNZn- |