Carboxylic acid salts
- (2)
- (9)
- (11)
- (1)
- (1)
- (1)
- (1)
- (33)
- (2)
- (3)
- (8)
- (5)
- (12)
- (2)
- (4)
- (1)
- (1)
- (3)
- (4)
- (2)
- (4)
- (8)
- (3)
- (2)
- (4)
- (6)
- (80)
- (10)
- (1)
- (1)
- (3)
- (3)
- (1)
- (7)
- (1)
- (2)
- (2)
- (2)
- (2)
- (4)
Filtered Search Results
Sodium Pyruvate (White Powder), Fisher BioReagents
CAS: 113-24-6 | C3H3NaO3 | 110.044 g/mol
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Pyruvic Acid Sodium Salt (Reagent), Fisher Chemical
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Rubidium formate hydrate, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 3495-35-0 Molecular Formula: CHO2Rb Molecular Weight (g/mol): 130.49 MDL Number: MFCD00054359 InChI Key: ZIMBPNXOLRMVGV-UHFFFAOYSA-M Synonym: rubidium formate,formic acid, rubidium salt,formic acid rubidium salt,64-18-6 parent,formic acid, rubidium salt 1:1,rubidiumformiat,rubidium 1+ formira,rubidium 1+ formate,rubidium 1+ ion formate,formic acid, rubidiumsalt 1:1 PubChem CID: 23673641 IUPAC Name: rubidium(1+) formate SMILES: [Rb+].[O-]C=O
| PubChem CID | 23673641 |
|---|---|
| CAS | 3495-35-0 |
| Molecular Weight (g/mol) | 130.49 |
| MDL Number | MFCD00054359 |
| SMILES | [Rb+].[O-]C=O |
| Synonym | rubidium formate,formic acid, rubidium salt,formic acid rubidium salt,64-18-6 parent,formic acid, rubidium salt 1:1,rubidiumformiat,rubidium 1+ formira,rubidium 1+ formate,rubidium 1+ ion formate,formic acid, rubidiumsalt 1:1 |
| IUPAC Name | rubidium(1+) formate |
| InChI Key | ZIMBPNXOLRMVGV-UHFFFAOYSA-M |
| Molecular Formula | CHO2Rb |
| Optical Rotation | [α]/D -28°C ± 2°C = 0.1 in. H218O |
|---|---|
| Percent Purity | ≥92% (HPLC) |
| Linear Formula | C10D3H14NO6 · xLi+ |
| CAS | 1803252-71-2 (Free Acid) |
| Flash Point | Not applicable |
| Grade | Analytical Standard |
| Recommended Storage | -20°C |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C10D3H14NO6 · xLi+ |
| Formula Weight | 250.26 (Free Acid Basis) |
Lithium L-lactate, 97%
CAS: 27848-80-2 Molecular Formula: C3H5LiO3 Molecular Weight (g/mol): 96.01 MDL Number: MFCD00065399 InChI Key: GKQWYZBANWAFMQ-DKWTVANSSA-M Synonym: lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li PubChem CID: 23687877 IUPAC Name: lithium;(2S)-2-hydroxypropanoate SMILES: [Li+].CC(C(=O)[O-])O
| PubChem CID | 23687877 |
|---|---|
| CAS | 27848-80-2 |
| Molecular Weight (g/mol) | 96.01 |
| MDL Number | MFCD00065399 |
| SMILES | [Li+].CC(C(=O)[O-])O |
| Synonym | lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li |
| IUPAC Name | lithium;(2S)-2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-DKWTVANSSA-M |
| Molecular Formula | C3H5LiO3 |
Silver(I) citrate hydrate
CAS: 206986-90-5 Molecular Formula: C6H5Ag3O7 Molecular Weight (g/mol): 512.70 MDL Number: MFCD00150589 InChI Key: QUTYHQJYVDNJJA-UHFFFAOYSA-K Synonym: silver i citrate hydrate,trisilver 1+ citrate hydrate PubChem CID: 16212313 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate SMILES: [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 16212313 |
|---|---|
| CAS | 206986-90-5 |
| Molecular Weight (g/mol) | 512.70 |
| MDL Number | MFCD00150589 |
| SMILES | [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | silver i citrate hydrate,trisilver 1+ citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate |
| InChI Key | QUTYHQJYVDNJJA-UHFFFAOYSA-K |
| Molecular Formula | C6H5Ag3O7 |
alpha-Ketoglutaric acid disodium salt dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5 Molecular Weight (g/mol): 190.062 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 190.062 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5 |
Propionic acid, sodium salt, 99.0-100.5%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.06 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.06 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
Pyruvic acid, sodium salt, 99+%
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.04 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.04 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
5-Keto-D-gluconic acid potassium salt, 98%
Molecular Formula: C6H10KO7 Molecular Weight (g/mol): 233.237 MDL Number: MFCD00069562 InChI Key: BJBNFUCYWPVFKM-YMDUGQBDSA-N Synonym: potassium 5-ketogluconate PubChem CID: 131855000 IUPAC Name: potassium;(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid SMILES: C(C(=O)C(C(C(C(=O)O)O)O)O)O.[K]
| PubChem CID | 131855000 |
|---|---|
| Molecular Weight (g/mol) | 233.237 |
| MDL Number | MFCD00069562 |
| SMILES | C(C(=O)C(C(C(C(=O)O)O)O)O)O.[K] |
| Synonym | potassium 5-ketogluconate |
| IUPAC Name | potassium;(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid |
| InChI Key | BJBNFUCYWPVFKM-YMDUGQBDSA-N |
| Molecular Formula | C6H10KO7 |
L(-)-Lactic acid, lithium salt, 99%, pure
CAS: 27848-80-2 Molecular Formula: C3H5O3Li Molecular Weight (g/mol): 96.01 MDL Number: MFCD00065512 InChI Key: GKQWYZBANWAFMQ-DKWTVANSSA-M Synonym: lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li PubChem CID: 23687877 IUPAC Name: lithium;(2S)-2-hydroxypropanoate SMILES: [Li+].CC(C(=O)[O-])O
| PubChem CID | 23687877 |
|---|---|
| CAS | 27848-80-2 |
| Molecular Weight (g/mol) | 96.01 |
| MDL Number | MFCD00065512 |
| SMILES | [Li+].CC(C(=O)[O-])O |
| Synonym | lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li |
| IUPAC Name | lithium;(2S)-2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-DKWTVANSSA-M |
| Molecular Formula | C3H5O3Li |
Calcium Formate, 98%, Pure
CAS: 544-17-2 Molecular Formula: C2H2CaO4 Molecular Weight (g/mol): 130.11 MDL Number: MFCD00036108 InChI Key: CBOCVOKPQGJKKJ-UHFFFAOYSA-L Synonym: calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 PubChem CID: 10997 ChEBI: CHEBI:81851 IUPAC Name: calcium;diformate SMILES: C(=O)[O-].C(=O)[O-].[Ca+2]
| PubChem CID | 10997 |
|---|---|
| CAS | 544-17-2 |
| Molecular Weight (g/mol) | 130.11 |
| ChEBI | CHEBI:81851 |
| MDL Number | MFCD00036108 |
| SMILES | C(=O)[O-].C(=O)[O-].[Ca+2] |
| Synonym | calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 |
| IUPAC Name | calcium;diformate |
| InChI Key | CBOCVOKPQGJKKJ-UHFFFAOYSA-L |
| Molecular Formula | C2H2CaO4 |
2,2,3,3-d(4)-3-(Trimethylsilyl)propionic acid sodium salt, 98+ atom % D
CAS: 24493-21-8 Molecular Formula: C6H13NaO2Si Molecular Weight (g/mol): 172.267 MDL Number: MFCD00002762 InChI Key: OIIWPAYIXDCDNL-HGFPCDIYSA-M Synonym: sodium 3-trimethylsilyl 2,2,3,3-2h4 propionate,3-trimethylsilyl propionic acid-d4 sodium salt,2,2,3,3-d4-3-trimethylsilyl propionic acid sodium salt,sodium 3-trimethylsilyl 2 h? propanoate,sodium 3-trimethylsilyl 2h4 propanoate,tsp-d4,propanoic-2,2,3,3-d4 acid, 3-trimethylsilyl-, sodium salt,sodium 3-trimethylsilyl propionate-2,2,3,3-d4,3-trimethylsilyl propionic-2,2,3,3-d4 acid sodium salt,sodium-3-trimethylsilyl-2,2,3,3-tetradeuteriopropionate PubChem CID: 23688921 IUPAC Name: sodium;2,2,3,3-tetradeuterio-3-trimethylsilylpropanoate SMILES: C[Si](C)(C)CCC(=O)[O-].[Na+]
| PubChem CID | 23688921 |
|---|---|
| CAS | 24493-21-8 |
| Molecular Weight (g/mol) | 172.267 |
| MDL Number | MFCD00002762 |
| SMILES | C[Si](C)(C)CCC(=O)[O-].[Na+] |
| Synonym | sodium 3-trimethylsilyl 2,2,3,3-2h4 propionate,3-trimethylsilyl propionic acid-d4 sodium salt,2,2,3,3-d4-3-trimethylsilyl propionic acid sodium salt,sodium 3-trimethylsilyl 2 h? propanoate,sodium 3-trimethylsilyl 2h4 propanoate,tsp-d4,propanoic-2,2,3,3-d4 acid, 3-trimethylsilyl-, sodium salt,sodium 3-trimethylsilyl propionate-2,2,3,3-d4,3-trimethylsilyl propionic-2,2,3,3-d4 acid sodium salt,sodium-3-trimethylsilyl-2,2,3,3-tetradeuteriopropionate |
| IUPAC Name | sodium;2,2,3,3-tetradeuterio-3-trimethylsilylpropanoate |
| InChI Key | OIIWPAYIXDCDNL-HGFPCDIYSA-M |
| Molecular Formula | C6H13NaO2Si |
Sodium benzoate, 99%
CAS: 532-32-1 Molecular Formula: C7H5NaO2 Molecular Weight (g/mol): 144.11 MDL Number: MFCD00012463 InChI Key: WXMKPNITSTVMEF-UHFFFAOYSA-M Synonym: sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 PubChem CID: 517055 SMILES: [Na+].[O-]C(=O)C1=CC=CC=C1
| PubChem CID | 517055 |
|---|---|
| CAS | 532-32-1 |
| Molecular Weight (g/mol) | 144.11 |
| MDL Number | MFCD00012463 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| Synonym | sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 |
| InChI Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO2 |
Sodium propionate, 99%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.061 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.061 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |