Benzoic acid esters
- (14)
- (28)
- (1)
- (22)
- (7)
- (4)
- (4)
- (6)
- (1)
- (9)
- (1)
- (10)
- (1)
- (26)
- (3)
- (6)
- (2)
- (4)
- (26)
- (30)
- (16)
- (3)
- (4)
- (13)
- (5)
- (97)
- (24)
- (3)
- (5)
- (1)
- (33)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (5)
- (3)
- (1)
Filtered Search Results
Methyl 3-hydroxybenzoate, 98%
CAS: 19438-10-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002295 InChI Key: YKUCHDXIBAQWSF-UHFFFAOYSA-N Synonym: methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester PubChem CID: 88068 IUPAC Name: methyl 3-hydroxybenzoate SMILES: COC(=O)C1=CC=CC(O)=C1
| PubChem CID | 88068 |
|---|---|
| CAS | 19438-10-9 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002295 |
| SMILES | COC(=O)C1=CC=CC(O)=C1 |
| Synonym | methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-hydroxybenzoate |
| InChI Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Ethyl 3,4-dihydroxybenzoate, 97%
CAS: 3943-89-3 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002199 InChI Key: KBPUBCVJHFXPOC-UHFFFAOYSA-N Synonym: ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester PubChem CID: 77547 IUPAC Name: ethyl 3,4-dihydroxybenzoate SMILES: CCOC(=O)C1=CC=C(O)C(O)=C1
| PubChem CID | 77547 |
|---|---|
| CAS | 3943-89-3 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002199 |
| SMILES | CCOC(=O)C1=CC=C(O)C(O)=C1 |
| Synonym | ethyl protocatechuate,3,4-dihydroxybenzoic acid ethyl ester,ethyl-3,4-dihydroxybenzoate,unii-4ygj96wtbg,benzoic acid, 3,4-dihydroxy-, ethyl ester,edhb,protocatechuic acid ethyl ester,4ygj96wtbg,3,4-dihydroxy-benzoic acid ethyl ester |
| IUPAC Name | ethyl 3,4-dihydroxybenzoate |
| InChI Key | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
Propyl 4-hydroxybenzoate, 99+%
CAS: 94-13-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.2 MDL Number: MFCD00002354 InChI Key: QELSKZZBTMNZEB-UHFFFAOYSA-N Synonym: propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept PubChem CID: 7175 ChEBI: CHEBI:32063 IUPAC Name: propyl 4-hydroxybenzoate SMILES: CCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7175 |
|---|---|
| CAS | 94-13-3 |
| Molecular Weight (g/mol) | 180.2 |
| ChEBI | CHEBI:32063 |
| MDL Number | MFCD00002354 |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept |
| IUPAC Name | propyl 4-hydroxybenzoate |
| InChI Key | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
3-Hydroxy-4-(methoxycarbonyl)phenylboronic acid pinacol ester, 97%
CAS: 1073371-99-9 Molecular Formula: C14H19BO5 Molecular Weight (g/mol): 278.11 MDL Number: MFCD08458200 InChI Key: SRYGMLVCVMGUTB-UHFFFAOYSA-N Synonym: methyl 2-hydroxy-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate,3-hydroxy-4-methoxycarbonylphenylboronic acid, pinacol ester,methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl salicylate,methyl 2-hydroxy-4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate PubChem CID: 17998928 IUPAC Name: methyl 2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate SMILES: COC(=O)C1=C(O)C=C(C=C1)B1OC(C)(C)C(C)(C)O1
| PubChem CID | 17998928 |
|---|---|
| CAS | 1073371-99-9 |
| Molecular Weight (g/mol) | 278.11 |
| MDL Number | MFCD08458200 |
| SMILES | COC(=O)C1=C(O)C=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| Synonym | methyl 2-hydroxy-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate,3-hydroxy-4-methoxycarbonylphenylboronic acid, pinacol ester,methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl salicylate,methyl 2-hydroxy-4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate |
| IUPAC Name | methyl 2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChI Key | SRYGMLVCVMGUTB-UHFFFAOYSA-N |
| Molecular Formula | C14H19BO5 |
Butyl 4-hydroxybenzoate, 99+%
CAS: 94-26-8 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00016478 InChI Key: QFOHBWFCKVYLES-UHFFFAOYSA-N Synonym: butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl PubChem CID: 7184 IUPAC Name: butyl 4-hydroxybenzoate SMILES: CCCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7184 |
|---|---|
| CAS | 94-26-8 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00016478 |
| SMILES | CCCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl |
| IUPAC Name | butyl 4-hydroxybenzoate |
| InChI Key | QFOHBWFCKVYLES-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
Methyl 3-bromo-4-hydroxybenzoate, 98%
CAS: 29415-97-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.05 MDL Number: MFCD06203850 InChI Key: RKUNSPWAQIUGEZ-UHFFFAOYSA-N Synonym: methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester PubChem CID: 4778958 IUPAC Name: methyl 3-bromo-4-hydroxybenzoate SMILES: COC(=O)C1=CC(Br)=C(O)C=C1
| PubChem CID | 4778958 |
|---|---|
| CAS | 29415-97-2 |
| Molecular Weight (g/mol) | 231.05 |
| MDL Number | MFCD06203850 |
| SMILES | COC(=O)C1=CC(Br)=C(O)C=C1 |
| Synonym | methyl3-bromo-4-hydroxybenzoate,3-bromo-4-hydroxybenzoic acid methyl ester,benzoic acid, 3-bromo-4-hydroxy-, methyl ester,2-bromo-4-methoxycarbonyl phenol,methyl 4-hydroxy-3-bromobenzoate,methyl-3-bromo-4-hydroxybenzoate,methyl 3-bromo-4-hydroxy-benzoate,methyl 3-bromo-4-hydroxybenzoate,methyl 3-bromanyl-4-oxidanyl-benzoate,3-bromo-4-hydroxy-benzoic acid methyl ester |
| IUPAC Name | methyl 3-bromo-4-hydroxybenzoate |
| InChI Key | RKUNSPWAQIUGEZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Isopropyl salicylate, 99%
CAS: 607-85-2 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00035703 InChI Key: YEULQIJMIOWCHB-UHFFFAOYSA-N Synonym: isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate PubChem CID: 11838 ChEBI: CHEBI:38703 IUPAC Name: propan-2-yl 2-hydroxybenzoate SMILES: CC(C)OC(=O)C1=CC=CC=C1O
| PubChem CID | 11838 |
|---|---|
| CAS | 607-85-2 |
| Molecular Weight (g/mol) | 180.203 |
| ChEBI | CHEBI:38703 |
| MDL Number | MFCD00035703 |
| SMILES | CC(C)OC(=O)C1=CC=CC=C1O |
| Synonym | isopropyl salicylate,isopropyl 2-hydroxybenzoate,salicylic acid, isopropyl ester,iso-propyl salicylate,salicylic acid isopropyl ester,isopropyl o-hydroxybenzoate,benzoic acid, 2-hydroxy-, 1-methylethyl ester,1-methylethyl 2-hydroxybenzoate,methylethyl 2-hydroxybenzoate,opropyl salicylate |
| IUPAC Name | propan-2-yl 2-hydroxybenzoate |
| InChI Key | YEULQIJMIOWCHB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl salicylate, 99%
CAS: 119-36-8 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002214 InChI Key: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC Name: methyl 2-hydroxybenzoate SMILES: COC(=O)C1=CC=CC=C1O
| PubChem CID | 4133 |
|---|---|
| CAS | 119-36-8 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31832 |
| MDL Number | MFCD00002214 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-hydroxybenzoate |
| InChI Key | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 3-hydroxybenzoate, 99%
CAS: 19438-10-9 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002295 InChI Key: YKUCHDXIBAQWSF-UHFFFAOYSA-N Synonym: methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester PubChem CID: 88068 IUPAC Name: methyl 3-hydroxybenzoate SMILES: COC(=O)C1=CC=CC(O)=C1
| PubChem CID | 88068 |
|---|---|
| CAS | 19438-10-9 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002295 |
| SMILES | COC(=O)C1=CC=CC(O)=C1 |
| Synonym | methyl m-hydroxybenzoate,3-hydroxybenzoic acid methyl ester,m-carbomethoxyphenol,methyl m-oxybenzoate,m-hydroxybenzoic acid methyl ester,benzoic acid, 3-hydroxy-, methyl ester,3-hydroxy-benzoic acid methyl ester,unii-569m9g3stj,3-methoxycarbonyl phenol,benzoic acid, m-hydroxy-, methyl ester |
| IUPAC Name | methyl 3-hydroxybenzoate |
| InChI Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Methyl 3,5-dihydroxybenzoate, 98%
CAS: 2150-44-9 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002289 InChI Key: RNVFYQUEEMZKLR-UHFFFAOYSA-N Synonym: 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate PubChem CID: 75076 IUPAC Name: methyl 3,5-dihydroxybenzoate SMILES: COC(=O)C1=CC(O)=CC(O)=C1
| PubChem CID | 75076 |
|---|---|
| CAS | 2150-44-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00002289 |
| SMILES | COC(=O)C1=CC(O)=CC(O)=C1 |
| Synonym | 3,5-dihydroxybenzoic acid methyl ester,benzoic acid, 3,5-dihydroxy-, methyl ester,methyl3,5-dihydroxybenzoate,methyl .alpha.-resorcylate,alpha-resorcinol carboxylic acid methyl ester,alpha-resorcylic acid, methyl ester,.alpha.-resorcylic acid, methyl ester,.alpha.-resorcinol carboxylic acid methyl ester,pubchem21357,methyl alpha-resorcylate |
| IUPAC Name | methyl 3,5-dihydroxybenzoate |
| InChI Key | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
n-Octyl 4-hydroxybenzoate, 98%
CAS: 1219-38-1 Molecular Formula: C15H22O3 Molecular Weight (g/mol): 250.34 MDL Number: MFCD00016482 InChI Key: RIKCMEDSBFQFAL-UHFFFAOYSA-N Synonym: octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german PubChem CID: 14642 IUPAC Name: octyl 4-hydroxybenzoate SMILES: CCCCCCCCOC(=O)C1=CC=C(O)C=C1
| PubChem CID | 14642 |
|---|---|
| CAS | 1219-38-1 |
| Molecular Weight (g/mol) | 250.34 |
| MDL Number | MFCD00016482 |
| SMILES | CCCCCCCCOC(=O)C1=CC=C(O)C=C1 |
| Synonym | octylparaben,n-octyl 4-hydroxybenzoate,octyl paraben,octyl p-hydroxybenzoate,p-hydroxybenzoic acid octyl ester,benzoic acid, 4-hydroxy-, octyl ester,p-oxybenzoesaureoctylester,4-hydroxybenzoic acid n-octyl ester,unii-4uvk431k6b,p-oxybenzoesaureoctylester german |
| IUPAC Name | octyl 4-hydroxybenzoate |
| InChI Key | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| Molecular Formula | C15H22O3 |
Methyl 3,4-dihydroxybenzoate, 97%
CAS: 2150-43-8 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00016437 InChI Key: CUFLZUDASVUNOE-UHFFFAOYSA-N Synonym: methyl protocatechuate,protocatechuic acid, methyl ester,3,4-dihydroxybenzoic acid methyl ester,protocatechuic acid methyl ester,benzoic acid, 3,4-dihydroxy-, methyl ester,3,4-dihydroxymethylbenzoate,3,4-dihydroxybenzoic acid methyl,mdhb,methyl 3,4-dihydroxy,acmc-1cfbz PubChem CID: 287064 IUPAC Name: methyl 3,4-dihydroxybenzoate SMILES: COC(=O)C1=CC=C(O)C(O)=C1
| PubChem CID | 287064 |
|---|---|
| CAS | 2150-43-8 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00016437 |
| SMILES | COC(=O)C1=CC=C(O)C(O)=C1 |
| Synonym | methyl protocatechuate,protocatechuic acid, methyl ester,3,4-dihydroxybenzoic acid methyl ester,protocatechuic acid methyl ester,benzoic acid, 3,4-dihydroxy-, methyl ester,3,4-dihydroxymethylbenzoate,3,4-dihydroxybenzoic acid methyl,mdhb,methyl 3,4-dihydroxy,acmc-1cfbz |
| IUPAC Name | methyl 3,4-dihydroxybenzoate |
| InChI Key | CUFLZUDASVUNOE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Methyl 2-hydroxy-3-methylbenzoate, 97%
CAS: 23287-26-5 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00020051 InChI Key: SUHLUMKZPUMAFP-UHFFFAOYSA-N Synonym: methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester PubChem CID: 31835 IUPAC Name: methyl 2-hydroxy-3-methylbenzoate SMILES: COC(=O)C1=CC=CC(C)=C1O
| PubChem CID | 31835 |
|---|---|
| CAS | 23287-26-5 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00020051 |
| SMILES | COC(=O)C1=CC=CC(C)=C1O |
| Synonym | methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester |
| IUPAC Name | methyl 2-hydroxy-3-methylbenzoate |
| InChI Key | SUHLUMKZPUMAFP-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Ethyl 4-hydroxybenzoate, 99%
CAS: 120-47-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002353 InChI Key: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC Name: ethyl 4-hydroxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 8434 |
|---|---|
| CAS | 120-47-8 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:86616 |
| MDL Number | MFCD00002353 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |