Inorganic Salts
Filtered Search Results
| CAS | 12018-18-7 |
|---|---|
| MDL Number | MFCD00064806 |
Nickel(II) sulfate heptahydrate, for analysis, for nickel plating, DIN 50970
CAS: 10101-98-1 Molecular Formula: H14NiO11S Molecular Weight (g/mol): 280.85 MDL Number: MFCD00149814 InChI Key: OGKAGKFVPCOHQW-UHFFFAOYSA-L Synonym: nickel ii sulfate heptahydrate,nickel sulfate heptahydrate,nickel 2+ sulfate heptahydrate,nickelous sulfate heptahydrate,unii-596idd57nr,sulfuric acid, nickel 2+ salt 1:1 , heptahydrate,nickel sulfate heptahydrate nickel and nickel compounds,ni.so4.7h2o,ksc492q3n,nickel sulfate-water 1/7 PubChem CID: 61474 ChEBI: CHEBI:53504 SMILES: O.O.O.O.O.O.O.[Ni++].[O-]S([O-])(=O)=O
| PubChem CID | 61474 |
|---|---|
| CAS | 10101-98-1 |
| Molecular Weight (g/mol) | 280.85 |
| ChEBI | CHEBI:53504 |
| MDL Number | MFCD00149814 |
| SMILES | O.O.O.O.O.O.O.[Ni++].[O-]S([O-])(=O)=O |
| Synonym | nickel ii sulfate heptahydrate,nickel sulfate heptahydrate,nickel 2+ sulfate heptahydrate,nickelous sulfate heptahydrate,unii-596idd57nr,sulfuric acid, nickel 2+ salt 1:1 , heptahydrate,nickel sulfate heptahydrate nickel and nickel compounds,ni.so4.7h2o,ksc492q3n,nickel sulfate-water 1/7 |
| InChI Key | OGKAGKFVPCOHQW-UHFFFAOYSA-L |
| Molecular Formula | H14NiO11S |
Nickel(II) bromide, 99%
CAS: 13462-88-9 Molecular Formula: Br2Ni Molecular Weight (g/mol): 218.53 MDL Number: MFCD00011141 InChI Key: IPLJNQFXJUCRNH-UHFFFAOYSA-L Synonym: nickel bromide,nickel ii bromide,nickel dibromide,nickelous bromide,nickel bromide nibr2,nickel 2+ bromide,unii-41sgh8a2s6,nibr2,nickel ii bromide, anhydrous PubChem CID: 278492 IUPAC Name: dibromonickel SMILES: [Ni](Br)Br
| PubChem CID | 278492 |
|---|---|
| CAS | 13462-88-9 |
| Molecular Weight (g/mol) | 218.53 |
| MDL Number | MFCD00011141 |
| SMILES | [Ni](Br)Br |
| Synonym | nickel bromide,nickel ii bromide,nickel dibromide,nickelous bromide,nickel bromide nibr2,nickel 2+ bromide,unii-41sgh8a2s6,nibr2,nickel ii bromide, anhydrous |
| IUPAC Name | dibromonickel |
| InChI Key | IPLJNQFXJUCRNH-UHFFFAOYSA-L |
| Molecular Formula | Br2Ni |
Nickel(II) cyanide tetrahydrate
CAS: 13477-95-7 Molecular Formula: C2H8N2NiO4 Molecular Weight (g/mol): 182.789 MDL Number: MFCD00049490 InChI Key: VHHVAACTKRUWEK-UHFFFAOYSA-N Synonym: nickel ii cyanide tetrahydrate,ni cn 2 tetrahydrate,acmc-20ak3a,nickel cyanide tetrahydrate,c2n2ni.4h2o,nickel dicyanide tetrahydrate PubChem CID: 71317429 IUPAC Name: nickel(2+);dicyanide;tetrahydrate SMILES: [C-]#N.[C-]#N.O.O.O.O.[Ni+2]
| PubChem CID | 71317429 |
|---|---|
| CAS | 13477-95-7 |
| Molecular Weight (g/mol) | 182.789 |
| MDL Number | MFCD00049490 |
| SMILES | [C-]#N.[C-]#N.O.O.O.O.[Ni+2] |
| Synonym | nickel ii cyanide tetrahydrate,ni cn 2 tetrahydrate,acmc-20ak3a,nickel cyanide tetrahydrate,c2n2ni.4h2o,nickel dicyanide tetrahydrate |
| IUPAC Name | nickel(2+);dicyanide;tetrahydrate |
| InChI Key | VHHVAACTKRUWEK-UHFFFAOYSA-N |
| Molecular Formula | C2H8N2NiO4 |
Nickel(II) chloride, 98%
CAS: 7718-54-9 MDL Number: MFCD00011142 InChI Key: QMMRZOWCJAIUJA-UHFFFAOYSA-L PubChem CID: 24385 ChEBI: CHEBI:34887
| PubChem CID | 24385 |
|---|---|
| CAS | 7718-54-9 |
| ChEBI | CHEBI:34887 |
| MDL Number | MFCD00011142 |
| InChI Key | QMMRZOWCJAIUJA-UHFFFAOYSA-L |
Nickel molybdenum oxide, 98%
CAS: 14177-55-0 Molecular Formula: MoNiO4 Molecular Weight (g/mol): 218.639 MDL Number: MFCD00016255 InChI Key: NLPVCCRZRNXTLT-UHFFFAOYSA-N Synonym: molybdenum nickel tetraoxide,nickel molybdate,nickel 2+ molybdate,molybdenum nickel oxide,nickel 2+ dioxido dioxo molybdenum,moo4.ni,nickel molybdenum oxide,dioxido dioxo molybdenum; nickel 2+ PubChem CID: 84241 IUPAC Name: dioxido(dioxo)molybdenum;nickel(2+) SMILES: [O-][Mo](=O)(=O)[O-].[Ni+2]
| PubChem CID | 84241 |
|---|---|
| CAS | 14177-55-0 |
| Molecular Weight (g/mol) | 218.639 |
| MDL Number | MFCD00016255 |
| SMILES | [O-][Mo](=O)(=O)[O-].[Ni+2] |
| Synonym | molybdenum nickel tetraoxide,nickel molybdate,nickel 2+ molybdate,molybdenum nickel oxide,nickel 2+ dioxido dioxo molybdenum,moo4.ni,nickel molybdenum oxide,dioxido dioxo molybdenum; nickel 2+ |
| IUPAC Name | dioxido(dioxo)molybdenum;nickel(2+) |
| InChI Key | NLPVCCRZRNXTLT-UHFFFAOYSA-N |
| Molecular Formula | MoNiO4 |
Nickel(II) tetrafluoroborate hexahydrate
CAS: 15684-36-3 Molecular Formula: B2F8H12NiO6 Molecular Weight (g/mol): 340.39 MDL Number: MFCD00150259 InChI Key: BFFWGFMAXHCLDV-UHFFFAOYSA-N Synonym: nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate PubChem CID: 177615 SMILES: O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 177615 |
|---|---|
| CAS | 15684-36-3 |
| Molecular Weight (g/mol) | 340.39 |
| MDL Number | MFCD00150259 |
| SMILES | O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate |
| InChI Key | BFFWGFMAXHCLDV-UHFFFAOYSA-N |
| Molecular Formula | B2F8H12NiO6 |
Nickel(II) sulfamate hydrate
CAS: 13770-89-3 Molecular Formula: H4N2NiO6S2 Molecular Weight (g/mol): 250.85 MDL Number: MFCD00137261 InChI Key: KERTUBUCQCSNJU-UHFFFAOYSA-L Synonym: nickel sulfamate,nickel bis sulphamidate,nickel ii sulfamate,aeronikl 250,aeronikl 400,aeronikl 575,nickel 2+ disulfamate,sulfamic acid, nickel 2+ salt 2:1,nickel sulfamate 6ci,7ci PubChem CID: 83720 SMILES: [Ni++].NS([O-])(=O)=O.NS([O-])(=O)=O
| PubChem CID | 83720 |
|---|---|
| CAS | 13770-89-3 |
| Molecular Weight (g/mol) | 250.85 |
| MDL Number | MFCD00137261 |
| SMILES | [Ni++].NS([O-])(=O)=O.NS([O-])(=O)=O |
| Synonym | nickel sulfamate,nickel bis sulphamidate,nickel ii sulfamate,aeronikl 250,aeronikl 400,aeronikl 575,nickel 2+ disulfamate,sulfamic acid, nickel 2+ salt 2:1,nickel sulfamate 6ci,7ci |
| InChI Key | KERTUBUCQCSNJU-UHFFFAOYSA-L |
| Molecular Formula | H4N2NiO6S2 |
Nickel tin oxide dihydrate
CAS: 12035-38-0 Molecular Formula: NiO3Sn Molecular Weight (g/mol): 225.40 MDL Number: MFCD00054011 InChI Key: SHULAURIUQUJKN-UHFFFAOYSA-N Synonym: Nickel stannate
| CAS | 12035-38-0 |
|---|---|
| Molecular Weight (g/mol) | 225.40 |
| MDL Number | MFCD00054011 |
| Synonym | Nickel stannate |
| InChI Key | SHULAURIUQUJKN-UHFFFAOYSA-N |
| Molecular Formula | NiO3Sn |
Nickel bis(trifluoromethylsulfonyl)imide
CAS: 207861-63-0 Molecular Formula: C4F12N2NiO8S4 Molecular Weight (g/mol): 618.964 MDL Number: MFCD23380174 InChI Key: VFUSIQAHVPEYFD-UHFFFAOYSA-N Synonym: nickel bis-trifluoromethanesulfonimide PubChem CID: 131875825 IUPAC Name: bis(trifluoromethylsulfonyl)azanide;nickel(2+) SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Ni+2]
| PubChem CID | 131875825 |
|---|---|
| CAS | 207861-63-0 |
| Molecular Weight (g/mol) | 618.964 |
| MDL Number | MFCD23380174 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Ni+2] |
| Synonym | nickel bis-trifluoromethanesulfonimide |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;nickel(2+) |
| InChI Key | VFUSIQAHVPEYFD-UHFFFAOYSA-N |
| Molecular Formula | C4F12N2NiO8S4 |
Nickel ammonium sulfate hexahydrate
CAS: 7785-20-8 Molecular Formula: Ni(NH4)2(SO4)2·6H2O MDL Number: MFCD00150260 Synonym: Ammonium nickel sulfate hexahydrate
| CAS | 7785-20-8 |
|---|---|
| MDL Number | MFCD00150260 |
| Synonym | Ammonium nickel sulfate hexahydrate |
| Molecular Formula | Ni(NH4)2(SO4)2·6H2O |
Iron nickel oxide, tech.
CAS: 12168-54-6 Molecular Formula: Fe2NiO4 Molecular Weight (g/mol): 234.38 MDL Number: MFCD00016254 InChI Key: NQNBVCBUOCNRFZ-UHFFFAOYSA-N IUPAC Name: oxo[(oxoferrio)oxy]iron; oxonickel SMILES: O=[Ni].O=[Fe]O[Fe]=O
| CAS | 12168-54-6 |
|---|---|
| Molecular Weight (g/mol) | 234.38 |
| MDL Number | MFCD00016254 |
| SMILES | O=[Ni].O=[Fe]O[Fe]=O |
| IUPAC Name | oxo[(oxoferrio)oxy]iron; oxonickel |
| InChI Key | NQNBVCBUOCNRFZ-UHFFFAOYSA-N |
| Molecular Formula | Fe2NiO4 |
Nickel(II) formate dihydrate
CAS: 15694-70-9 Molecular Formula: Ni(HCO2)2·2H2O MDL Number: MFCD00153034
| CAS | 15694-70-9 |
|---|---|
| MDL Number | MFCD00153034 |
| Molecular Formula | Ni(HCO2)2·2H2O |
Nickel(II) hydroxide, for analysis
CAS: 12054-48-7 Molecular Formula: H2NiO2 Molecular Weight (g/mol): 92.71 MDL Number: MFCD00011140 InChI Key: BFDHFSHZJLFAMC-UHFFFAOYSA-L IUPAC Name: nickel(2+) dihydroxide SMILES: [OH-].[OH-].[Ni++]
| CAS | 12054-48-7 |
|---|---|
| Molecular Weight (g/mol) | 92.71 |
| MDL Number | MFCD00011140 |
| SMILES | [OH-].[OH-].[Ni++] |
| IUPAC Name | nickel(2+) dihydroxide |
| InChI Key | BFDHFSHZJLFAMC-UHFFFAOYSA-L |
| Molecular Formula | H2NiO2 |
Nickel(II) tetrafluoroborate hexahydrate, 99%
CAS: 15684-36-3 Molecular Formula: B2F8H12NiO6 Molecular Weight (g/mol): 340.39 MDL Number: MFCD00150259 InChI Key: BFFWGFMAXHCLDV-UHFFFAOYSA-N Synonym: nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate PubChem CID: 177615 SMILES: O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 177615 |
|---|---|
| CAS | 15684-36-3 |
| Molecular Weight (g/mol) | 340.39 |
| MDL Number | MFCD00150259 |
| SMILES | O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate |
| InChI Key | BFFWGFMAXHCLDV-UHFFFAOYSA-N |
| Molecular Formula | B2F8H12NiO6 |