missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Magnesium Standard for ICP/MS 100 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010533100N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Magnesium ICP-MS Standard | |
| 10377-60-3 , 7697-37-2 , 7732-18-5 | |
| 99.90%,2.04%,0.06% | |
| Liquid | |
| MFCD00011103 | |
| Approximately 0°C | |
| Miscible with water | |
| Standard | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 148.31 | |
| 25212 | |
| High Purity |
| Natural LDPE Bottle | |
| 95.98%,1.96%,0.06% | |
| 1 | |
| MgN2O6 | |
| Colorless | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| magnesium(2+) dinitrate | |
| 100 mL | |
| CHEBI:64736 |
Chemical Identifiers
| 10377-60-3 | |
| 148.31 | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| CHEBI:64736 | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| MgN2O6 | |
| MFCD00011103 | |
| 25212 | |
| magnesium(2+) dinitrate |