missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Magnesium (Mg) Standard for AAS 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010077100N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 95.44%,1.96%,0.60% | |
| 1.01 | |
| MgN2O6 | |
| Approximately 0°C | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 148.31 | |
| 25212 | |
| High Purity |
| 10377-60-3 , 7697-37-2 , 7732-18-5 | |
| 99.34%,2.04%,0.62% | |
| Liquid | |
| MFCD00011103 | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| magnesium(2+) dinitrate | |
| 100 mL | |
| CHEBI:64736 |
Chemical Identifiers
| 10377-60-3 | |
| 148.31 | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| CHEBI:64736 | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| MgN2O6 | |
| MFCD00011103 | |
| 25212 | |
| magnesium(2+) dinitrate |