missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Calcium Standard for ICP/MS 100 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010510100N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Calcium ICP-MS Standard | |
| 10124-37-5,7697-37-2,7732-18-5 | |
| 99.92%,2.04%,0.04% | |
| Liquid | |
| Colorless | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| ZCCIPPOKBCJFDN-UHFFFAOYSA-N | |
| calcium;dinitrate | |
| 100 mL | |
| CHEBI:64205 |
| Natural LDPE Bottle | |
| 96.00%,1.96%,0.04% | |
| 1 | |
| CaN2O6 | |
| Approximately 0°C | |
| Miscible with water | |
| Standard | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ca+2] | |
| 164.086 | |
| 24963 | |
| High Purity |
Chemical Identifiers
| 10124-37-5 | |
| 164.086 | |
| 24963 | |
| calcium;dinitrate |
| CaN2O6 | |
| ZCCIPPOKBCJFDN-UHFFFAOYSA-N | |
| CHEBI:64205 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ca+2] |