missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Calcium (Ca) Standard for AAS 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010068100N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 95.64%,1.96%,0.40% | |
| 1.01 | |
| CaN2O6 | |
| ZCCIPPOKBCJFDN-UHFFFAOYSA-N | |
| calcium;dinitrate | |
| 100 mL | |
| CHEBI:64205 |
| 10124-37-5,7697-37-2,7732-18-5 | |
| 99.54%,2.04%,0.42% | |
| Liquid | |
| Approximately 0°C | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ca+2] | |
| 164.086 | |
| 24963 | |
| High Purity |
Chemical Identifiers
| 10124-37-5 | |
| 164.086 | |
| 24963 | |
| calcium;dinitrate |
| CaN2O6 | |
| ZCCIPPOKBCJFDN-UHFFFAOYSA-N | |
| CHEBI:64205 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ca+2] |