missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Strontium ICP Standard, 1000 ppm Sr in 3% HNO3, Ricca Chemical
Supplier: Ricca Chemical Company MSSR1KN100
Specifications
| Strontium ICP Standard | |
| 10042-76-9 , 7697-37-2 , 7732-18-5 | |
| 94.0,4.22,0.23 | |
| 1 mL = 1 mg Sr | |
| N2O6Sr | |
| Colorless | |
| Approximately 0°C | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate | |
| 100 mL | |
| Laboratory |
| Natural LDPE Bottle | |
| 1,000ppm Sr | |
| 97.0,4.39,0.24 | |
| Liquid | |
| MFCD00011248 | |
| < 2 | |
| Approximately 100°C | |
| Miscible with water | |
| Standard | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 211.63 | |
| 24848 |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate |
| N2O6Sr | |
| MFCD00011248 | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |