Learn More
Strontium AA Standard, Certified, 1000ppm ±10ppm (1mL = 1mg Sr), LabChem™
$91.50 - $157.50
Chemical Identifiers
| CAS | 10042-76-9 |
|---|---|
| Molecular Formula | N2O6Sr |
| Molecular Weight (g/mol) | 211.63 |
| MDL Number | MFCD00011248 |
| InChI Key | DHEQXMRUPNDRPG-UHFFFAOYSA-N |
| PubChem CID | 24848 |
| IUPAC Name | strontium(2+) dinitrate |
| SMILES | [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate |
| N2O6Sr | |
| MFCD00011248 | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
Specifications
| Poly Bottle | |
| 95.9,3.86,0.24 | |
| Liquid | |
| 1000 ppm ±10 ppm (1mL = 1mg Sr) | |
| MFCD00011248 | |
| Colorless | |
| Soluble in water | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 211.63 | |
| 24848 | |
| Certified |
| 10042-76-9 , 7697-37-2 , 7732-18-5 | |
| Passes Test | |
| N2O6Sr | |
| Sr(NO3)2 | |
| UN3264 | |
| 105°C | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate | |
| 125 mL | |
| 211.63 | |
| Strontium AA Standard, 1000ppm (1mL = 1mg Sr) |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Do not breathe mist, vapors, spray.
Wear protective gloves/eye protection.
Wash exposed skin thoroughly after handling.
If swallowed: Rinse mouth.
Do not induce vomiting.
Immediately call a poison center/doctor.
If on skin (or hair): Remove/Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a poison center/doctor.
Wash contaminated clothing before reuse.
If inhaled: Remove person to fresh air and keep comfortable for breathing.
Immediately call a poison center/doctor.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
Immediately call a poison center/doctor.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Room Temperature