missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Silicon ICP Standard, 1000 ppm Si in 3% HNO3, Ricca Chemical
Supplier: Ricca Chemical Company PSI1KN500
Specifications
| Silicon ICP Standard | |
| 16919-19-0,7697-37-2,7664-39-3,7440-21-3,7732-18-5 | |
| 95.0,5.74,0.72,0.1 | |
| F6H8N2Si | |
| < 2 | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| ITHIMUMYFVCXSL-UHFFFAOYSA-P | |
| diazanium;hexafluorosilicon(2-) | |
| 500 mL | |
| Laboratory |
| Natural Poly Bottle | |
| 92.0,5.51,0.69,0.09 | |
| Odorless | |
| Colorless | |
| Approximately 100°C | |
| Miscible with water | |
| Standard | |
| [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F | |
| 178.153 | |
| 28145 | |
| 1mL = 1mg Si (1, 000ppm Si)Si in 3% HNO3 / trace HF |
Chemical Identifiers
| 16919-19-0 | |
| 178.153 | |
| 28145 | |
| [NH4+].[NH4+].F[Si-2](F)(F)(F)(F)F |
| F6H8N2Si | |
| ITHIMUMYFVCXSL-UHFFFAOYSA-P | |
| diazanium;hexafluorosilicon(2-) |
Safety and Handling
ShelfLife : 18 months