missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 | C6H7NaO6 | 198.11 g/mol
$69.75 - $1050.53
Chemical Identifiers
| CAS | 134-03-2 |
|---|---|
| Molecular Formula | C6H7NaO6 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Synonym | sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate |
| PubChem CID | 131674100 |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC352680050
|
Thermo Scientific Chemicals
352680050 |
5 g | Glass bottle |
Each for $69.75
|
|
||||
|
AC352681000
|
Thermo Scientific Chemicals
352681000 |
100 g | Plastic bottle |
Each for $149.32
|
|
||||
|
AC352685000
|
Thermo Scientific Chemicals
352685000 |
500 g | Plastic bottle |
Each for $286.77
|
|
||||
|
AC352680025
|
Thermo Scientific Chemicals
352680025 |
2.5 kg | Plastic bottle |
Each for $1,050.53
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 134-03-2 | |
| 198.11 | |
| IFVCRSPJFHGFCG-HXPAKLQESA-N | |
| 131674100 | |
| [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| C6H7NaO6 | |
| MFCD00082340 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
Specifications
| 134-03-2 | |
| White to Yellow | |
| 98.5 to 101.5% (Iodimetry) | |
| C6H7NaO6 | |
| 5 g | |
| + 104.00 | |
| (5% in water) Clear colorless to light yellow | |
| [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O | |
| 198.11 | |
| 198.11 | |
| Crystalline Powder |
| 219.0°C to 221.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00082340 | |
| 15,819 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| IFVCRSPJFHGFCG-HXPAKLQESA-N | |
| sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide | |
| 131674100 | |
| 99% | |
| L-Ascorbic acid sodium salt, 99% |
Safety and Handling
EINECSNumber : 205-126-1
RTECSNumber : CI7671000
TSCA : TSCA
RUO – Research Use Only