missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals HEPES, 99%, for biochemistry
CAS: 7365-45-9 | C8H18N2O4S | 238.30 g/mol
Supplier: Thermo Scientific Chemicals 172572500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| 0.08 max. at 260nm, 0.05 max. at 280nm, 0.08 max. at 250nm, (5% in water) 1 cm cell, (5% in water) 1 cm cell at 0nm | |
| (5% aq. soln.) (1cm cell) | |
| 7365-45-9 | |
| 238°C | |
| 250 g | |
| Authentic | |
| C8H18N2O4S | |
| Glass bottle | |
| 15, 4689 | |
| Solubility in water: 704g/L (20°C). | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| CHEBI:42334 | |
| 99% |
| HEPES | |
| 234.0°C to 238.0°C | |
| (5% in water) clear, colorless | |
| Liquid or Solid | |
| 99% | |
| 1 % max. (1 g, 105°C, 3 hrs) | |
| MFCD00006158 | |
| 23, V,2, 379 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid | |
| 23831 | |
| 238.3 | |
| Biochemical |
Chemical Identifiers
| 7365-45-9 | |
| 238.30 | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 23831 | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 |
| C8H18N2O4S | |
| MFCD00006158 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid | |
| CHEBI:42334 |
RUO – Research Use Only