missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
HEPES, >98%, MP Biomedicals™
Manufacturer: Mp Biomedicals 0219454980
Specifications
| HEPES | |
| C8H18N2O4S | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N?-(2-ethanesulfonic acid) sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| 23831 | |
| 238.3 | |
| >98% |
| 7365-45-9 | |
| MFCD00006158 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid | |
| White | |
| CHEBI:42334 | |
| Powder | |
| 100g |
Chemical Identifiers
| 7365-45-9 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 23831 | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| C8H18N2O4S | |
| MFCD00006158 | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N?-(2-ethanesulfonic acid) sodium salt | |
| CHEBI:42334 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Safety and Handling
EINECSNumber : 230-907-9
Recommended Storage : Store at Room Temperature (15 to 30°C). Store Desiccated.