missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenediaminetetraacetic Acid (0.5M Solution/pH 8.0), Fisher BioReagents
Supplier: Fisher BioReagents BP248220
Description
EDTA is used extensively in molecular biology to minimize metal ion impurities in reaction buffers. Ideal for DNA work.Specifications
| Ethylenediamine Tetraacetic Acid | |
| 0.5 M Solution, pH 8.0 (for DNA Work) | |
| C10H16N2O8 | |
| MFCD00003541 | |
| 15, 3565 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.25 | |
| Poly CUBE | |
| 20 L |
| Colorless | |
| 60-00-4 , 7732-18-5 | |
| (HOOCCH2)2NCH2CH2N(CH2COOH)2 | |
| 0.475 to 0.525M | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| Pass Test | |
| 8.0 | |
| Liquid |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
Recommended Storage : RT