Boronic acid derivatives
- (9)
- (2)
- (1)
- (1)
- (8)
- (5)
- (3)
- (1)
- (278)
- (5)
- (4)
- (1)
- (11)
- (48)
- (2)
- (30)
- (2)
- (3)
- (2)
- (11)
- (4)
- (4)
- (4)
- (1)
- (4)
- (193)
- (2)
- (1)
- (53)
- (18)
- (17)
- (1)
- (2)
- (3)
- (2)
- (4)
- (4)
- (3)
- (2)
Résultats de la recherche filtrée
4-Cyano-2-fluorobenzeneboronic acid, 98%, Thermo Scientific Chemicals
CAS: 1150114-77-4 Formule moléculaire: C7H5BFNO2 Poids moléculaire (g/mol): 164.93 Numéro MDL: MFCD07644472 Clé InChI: HFAUMAIVCYTVQR-UHFFFAOYSA-N Synonyme: 4-cyano-2-fluorophenyl boronic acid,boronic acid, b-4-cyano-2-fluorophenyl,acmc-2099nb,4-borono-3-fluorobenzonitrile,4-cyano-2-fluoro-phenylboronic acid,4-cyano-2-fluorobenzeneboronic acid CID PubChem: 44755209 Nom IUPAC: (4-cyano-2-fluorophenyl)boronic acid SMILES: OB(O)C1=C(F)C=C(C=C1)C#N
| Poids moléculaire (g/mol) | 164.93 |
|---|---|
| Synonyme | 4-cyano-2-fluorophenyl boronic acid,boronic acid, b-4-cyano-2-fluorophenyl,acmc-2099nb,4-borono-3-fluorobenzonitrile,4-cyano-2-fluoro-phenylboronic acid,4-cyano-2-fluorobenzeneboronic acid |
| Numéro MDL | MFCD07644472 |
| CAS | 1150114-77-4 |
| CID PubChem | 44755209 |
| Nom IUPAC | (4-cyano-2-fluorophenyl)boronic acid |
| Clé InChI | HFAUMAIVCYTVQR-UHFFFAOYSA-N |
| SMILES | OB(O)C1=C(F)C=C(C=C1)C#N |
| Formule moléculaire | C7H5BFNO2 |
2,3-Dihydro-1-benzofuran-5-ylboronic acid, 95%, May contain varying amounts of anhydride, Thermo Scientific™
CAS: 227305-69-3 Formule moléculaire: C8H9BO3 Poids moléculaire (g/mol): 163.97 Numéro MDL: MFCD02681979 Clé InChI: ZIXLJHSFAMVHPC-UHFFFAOYSA-N Synonyme: 2,3-dihydrobenzofuran-5-boronic acid,2,3-dihydrobenzofuran-5-ylboronic acid,2,3-dihydrobenzofuran-5-yl boronic acid,2,3-dihydrobenzo b furan-5-boronic acid,2,3-dihydrobenzofuran-5-yl-5-boronic acid,boronic acid, 2,3-dihydro-5-benzofuranyl,2,3-dihydro-1-benzofuran-5-yl-boranediol,2,3-dihydro-1-benzofuran-5-yl boronic acid,pubchem7848,zlchem 1108 CID PubChem: 2773380 SMILES: OB(O)C1=CC=C2OCCC2=C1
| Poids moléculaire (g/mol) | 163.97 |
|---|---|
| Synonyme | 2,3-dihydrobenzofuran-5-boronic acid,2,3-dihydrobenzofuran-5-ylboronic acid,2,3-dihydrobenzofuran-5-yl boronic acid,2,3-dihydrobenzo b furan-5-boronic acid,2,3-dihydrobenzofuran-5-yl-5-boronic acid,boronic acid, 2,3-dihydro-5-benzofuranyl,2,3-dihydro-1-benzofuran-5-yl-boranediol,2,3-dihydro-1-benzofuran-5-yl boronic acid,pubchem7848,zlchem 1108 |
| Numéro MDL | MFCD02681979 |
| CAS | 227305-69-3 |
| CID PubChem | 2773380 |
| Clé InChI | ZIXLJHSFAMVHPC-UHFFFAOYSA-N |
| SMILES | OB(O)C1=CC=C2OCCC2=C1 |
| Formule moléculaire | C8H9BO3 |
4,4,5,5-Tetramethyl-2-(2-methyl-3-furyl)-1,3,2-dioxaborolane, 90%, Thermo Scientific™
CAS: 864776-02-3 Formule moléculaire: C11H17BO3 Poids moléculaire (g/mol): 208.06 Numéro MDL: MFCD09879905 Clé InChI: JMLBPHNESOKSEV-UHFFFAOYSA-N Synonyme: 4,4,5,5-tetramethyl-2-2-methylfuran-3-yl-1,3,2-dioxaborolane,2-methylfuran-3-boronic acid, pinacol ester,4,4,5,5-tetramethyl-2-2-methyl-3-furanyl-1,3,2-dioxaborolane,1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-2-methyl-3-furanyl,4,4,5,5-tetramethyl-2-2-methyl-3-furyl-1,3,2-dioxaborolane,pubchem18438,2-2-methylfur-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl furan,4,4,5,5-tetramethyl-2-2-methyl 3-furyl-1,3,2-dioxaborolane,3-hydroxy-2,3-dimethylbutan-2-yl hydrogen 2-methylfuran-3-yl boronate CID PubChem: 24229547 Nom IUPAC: 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane SMILES: CC1=C(C=CO1)B1OC(C)(C)C(C)(C)O1
| Poids moléculaire (g/mol) | 208.06 |
|---|---|
| Synonyme | 4,4,5,5-tetramethyl-2-2-methylfuran-3-yl-1,3,2-dioxaborolane,2-methylfuran-3-boronic acid, pinacol ester,4,4,5,5-tetramethyl-2-2-methyl-3-furanyl-1,3,2-dioxaborolane,1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-2-methyl-3-furanyl,4,4,5,5-tetramethyl-2-2-methyl-3-furyl-1,3,2-dioxaborolane,pubchem18438,2-2-methylfur-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl furan,4,4,5,5-tetramethyl-2-2-methyl 3-furyl-1,3,2-dioxaborolane,3-hydroxy-2,3-dimethylbutan-2-yl hydrogen 2-methylfuran-3-yl boronate |
| Numéro MDL | MFCD09879905 |
| CAS | 864776-02-3 |
| CID PubChem | 24229547 |
| Nom IUPAC | 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane |
| Clé InChI | JMLBPHNESOKSEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)B1OC(C)(C)C(C)(C)O1 |
| Formule moléculaire | C11H17BO3 |
3-Aminobenzeneboronic acid hemisulfate, 98+%
CAS: 66472-86-4 Formule moléculaire: C12H18B2N2O8S Poids moléculaire (g/mol): 371.96 Numéro MDL: MFCD00013111 Clé InChI: UKTAURVTSWDIQR-UHFFFAOYSA-N Synonyme: 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid CID PubChem: 16211139 Nom IUPAC: (3-aminophenyl)boronic acid;sulfuric acid SMILES: OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O
| Poids moléculaire (g/mol) | 371.96 |
|---|---|
| Synonyme | 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid |
| Numéro MDL | MFCD00013111 |
| CAS | 66472-86-4 |
| CID PubChem | 16211139 |
| Nom IUPAC | (3-aminophenyl)boronic acid;sulfuric acid |
| Clé InChI | UKTAURVTSWDIQR-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O |
| Formule moléculaire | C12H18B2N2O8S |
2-Methoxybenzeneboronic acid, 97%
CAS: 5720-06-9 Formule moléculaire: C7H9BO3 Poids moléculaire (g/mol): 151.96 Numéro MDL: MFCD00236047 Clé InChI: ROEQGIFOWRQYHD-UHFFFAOYSA-N Synonyme: 2-methoxybenzeneboronic acid,2-methoxyphenyl boronic acid,o-methoxyphenylboronic acid,2-methoxyphenyl boranediol,2-boronoanisole,2-methoxypenylboronic acid,o-methoxyphenyl boronic acid,2-methoxy phenylboronic acid,2-methoxybenzene boronic acid CID PubChem: 2733958 Nom IUPAC: (2-methoxyphenyl)boronic acid SMILES: COC1=CC=CC=C1B(O)O
| Poids moléculaire (g/mol) | 151.96 |
|---|---|
| Synonyme | 2-methoxybenzeneboronic acid,2-methoxyphenyl boronic acid,o-methoxyphenylboronic acid,2-methoxyphenyl boranediol,2-boronoanisole,2-methoxypenylboronic acid,o-methoxyphenyl boronic acid,2-methoxy phenylboronic acid,2-methoxybenzene boronic acid |
| Numéro MDL | MFCD00236047 |
| CAS | 5720-06-9 |
| CID PubChem | 2733958 |
| Nom IUPAC | (2-methoxyphenyl)boronic acid |
| Clé InChI | ROEQGIFOWRQYHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1B(O)O |
| Formule moléculaire | C7H9BO3 |
4-Carboxybenzeneboronic acid, 97%
CAS: 14047-29-1 Formule moléculaire: C7H7BO4 Poids moléculaire (g/mol): 165.94 Numéro MDL: MFCD00151801 Clé InChI: SIAVMDKGVRXFAX-UHFFFAOYSA-N Synonyme: 4-carboxyphenylboronic acid,4-carboxybenzeneboronic acid,4-dihydroxyboranyl benzoic acid,benzoic acid, 4-borono,4-dihydroxyboryl benzoic acid,p-carboxyphenylboronic acid,4-phenylester boronic acid,4-carboxyphenyl boronic acid,chembl82324 CID PubChem: 312183 Nom IUPAC: 4-boronobenzoic acid SMILES: OB(O)C1=CC=C(C=C1)C(O)=O
| Poids moléculaire (g/mol) | 165.94 |
|---|---|
| Synonyme | 4-carboxyphenylboronic acid,4-carboxybenzeneboronic acid,4-dihydroxyboranyl benzoic acid,benzoic acid, 4-borono,4-dihydroxyboryl benzoic acid,p-carboxyphenylboronic acid,4-phenylester boronic acid,4-carboxyphenyl boronic acid,chembl82324 |
| Numéro MDL | MFCD00151801 |
| CAS | 14047-29-1 |
| CID PubChem | 312183 |
| Nom IUPAC | 4-boronobenzoic acid |
| Clé InChI | SIAVMDKGVRXFAX-UHFFFAOYSA-N |
| SMILES | OB(O)C1=CC=C(C=C1)C(O)=O |
| Formule moléculaire | C7H7BO4 |
1-Naphthaleneboronic acid, 97%
CAS: 13922-41-3 Formule moléculaire: C10H9BO2 Poids moléculaire (g/mol): 171.99 Numéro MDL: MFCD00019722 Clé InChI: HUMMCEUVDBVXTQ-UHFFFAOYSA-N Synonyme: 1-naphthaleneboronic acid,1-naphthylboronic acid,naphthalene-1-boronic acid,naphthalenyl-1-boronic acid,1-naphthalene boronic acid,1-naphthaleneboronicacid,1-naphthyleneboronic acid,boronic acid, naphthalenyl,1-borononaphthalene,naphthylboronic acid CID PubChem: 254532 Nom IUPAC: naphthalen-1-ylboronic acid SMILES: OB(O)C1=CC=CC2=CC=CC=C12
| Poids moléculaire (g/mol) | 171.99 |
|---|---|
| Synonyme | 1-naphthaleneboronic acid,1-naphthylboronic acid,naphthalene-1-boronic acid,naphthalenyl-1-boronic acid,1-naphthalene boronic acid,1-naphthaleneboronicacid,1-naphthyleneboronic acid,boronic acid, naphthalenyl,1-borononaphthalene,naphthylboronic acid |
| Numéro MDL | MFCD00019722 |
| CAS | 13922-41-3 |
| CID PubChem | 254532 |
| Nom IUPAC | naphthalen-1-ylboronic acid |
| Clé InChI | HUMMCEUVDBVXTQ-UHFFFAOYSA-N |
| SMILES | OB(O)C1=CC=CC2=CC=CC=C12 |
| Formule moléculaire | C10H9BO2 |
1-Butylboronic acid, 98%
CAS: 4426-47-5 Formule moléculaire: C4H11BO2 Poids moléculaire (g/mol): 101.94 Numéro MDL: MFCD00002106 Clé InChI: QPKFVRWIISEVCW-UHFFFAOYSA-N Synonyme: n-butylboronic acid,1-butylboronic acid,1-butaneboronic acid,n-butaneboronic acid,boronic acid, butyl,1-butane boronic acid,butylboric acid,butyl boronic acid,chembl31962,1-butyldihydroxyborane CID PubChem: 20479 Nom IUPAC: butylboronic acid SMILES: CCCCB(O)O
| Poids moléculaire (g/mol) | 101.94 |
|---|---|
| Synonyme | n-butylboronic acid,1-butylboronic acid,1-butaneboronic acid,n-butaneboronic acid,boronic acid, butyl,1-butane boronic acid,butylboric acid,butyl boronic acid,chembl31962,1-butyldihydroxyborane |
| Numéro MDL | MFCD00002106 |
| CAS | 4426-47-5 |
| CID PubChem | 20479 |
| Nom IUPAC | butylboronic acid |
| Clé InChI | QPKFVRWIISEVCW-UHFFFAOYSA-N |
| SMILES | CCCCB(O)O |
| Formule moléculaire | C4H11BO2 |
3-Aminobenzeneboronic acid monohydrate, 97%
CAS: 206658-89-1 Formule moléculaire: C6H10BNO3 Poids moléculaire (g/mol): 154.96 Numéro MDL: MFCD00149554 Clé InChI: XAEOVQODHLLNKX-UHFFFAOYSA-N Synonyme: 3-aminophenylboronic acid monohydrate,3-aminophenyl boronic acid hydrate,3-aminophenylboronic acid hydrate,3-aminobenzeneboronic acid monohydrate,m-aminophenylboronic acid hydrate,boronic acid, 3-aminophenyl-, monohydrate,3-aminobenzeneboronic acid hydrate,pubchem4016,acmc-1cfgg,3-boronoaniline monohydrate CID PubChem: 14389423 Nom IUPAC: (3-aminophenyl)boronic acid;hydrate SMILES: O.NC1=CC=CC(=C1)B(O)O
| Poids moléculaire (g/mol) | 154.96 |
|---|---|
| Synonyme | 3-aminophenylboronic acid monohydrate,3-aminophenyl boronic acid hydrate,3-aminophenylboronic acid hydrate,3-aminobenzeneboronic acid monohydrate,m-aminophenylboronic acid hydrate,boronic acid, 3-aminophenyl-, monohydrate,3-aminobenzeneboronic acid hydrate,pubchem4016,acmc-1cfgg,3-boronoaniline monohydrate |
| Numéro MDL | MFCD00149554 |
| CAS | 206658-89-1 |
| CID PubChem | 14389423 |
| Nom IUPAC | (3-aminophenyl)boronic acid;hydrate |
| Clé InChI | XAEOVQODHLLNKX-UHFFFAOYSA-N |
| SMILES | O.NC1=CC=CC(=C1)B(O)O |
| Formule moléculaire | C6H10BNO3 |
3,5-Dichlorobenzeneboronic acid, 98+%
CAS: 67492-50-6 Formule moléculaire: C6H5BCl2O2 Poids moléculaire (g/mol): 190.814 Numéro MDL: MFCD00051935 Clé InChI: DKYRKAIKWFHQHM-UHFFFAOYSA-N Synonyme: 3,5-dichlorophenyl boronic acid,3,5-dichlorobenzeneboronic acid,3,5-dichlorophenyl boranediol,3,5-dichlophenylboronic acid,3,5-dichloro phenylboronic acid,3,5-dichlorobenzene boronic acid,3,5-dichlorophenyl dihydroxyborane,boronic acid, b-3,5-dichlorophenyl,3,5-dichlorophenylboronicacid CID PubChem: 2734331 Nom IUPAC: (3,5-dichlorophenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)Cl)Cl)(O)O
| Poids moléculaire (g/mol) | 190.814 |
|---|---|
| Synonyme | 3,5-dichlorophenyl boronic acid,3,5-dichlorobenzeneboronic acid,3,5-dichlorophenyl boranediol,3,5-dichlophenylboronic acid,3,5-dichloro phenylboronic acid,3,5-dichlorobenzene boronic acid,3,5-dichlorophenyl dihydroxyborane,boronic acid, b-3,5-dichlorophenyl,3,5-dichlorophenylboronicacid |
| Numéro MDL | MFCD00051935 |
| CAS | 67492-50-6 |
| CID PubChem | 2734331 |
| Nom IUPAC | (3,5-dichlorophenyl)boronic acid |
| Clé InChI | DKYRKAIKWFHQHM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)Cl)(O)O |
| Formule moléculaire | C6H5BCl2O2 |
2,3-Dichlorobenzeneboronic acid, 98%
CAS: 151169-74-3 Formule moléculaire: C6H5BCl2O2 Poids moléculaire (g/mol): 190.81 Numéro MDL: MFCD01075703 Clé InChI: TYIKXPOMOYDGCS-UHFFFAOYSA-N Synonyme: 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid CID PubChem: 2734661 Nom IUPAC: (2,3-dichlorophenyl)boronic acid SMILES: OB(O)C1=C(Cl)C(Cl)=CC=C1
| Poids moléculaire (g/mol) | 190.81 |
|---|---|
| Synonyme | 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid |
| Numéro MDL | MFCD01075703 |
| CAS | 151169-74-3 |
| CID PubChem | 2734661 |
| Nom IUPAC | (2,3-dichlorophenyl)boronic acid |
| Clé InChI | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| SMILES | OB(O)C1=C(Cl)C(Cl)=CC=C1 |
| Formule moléculaire | C6H5BCl2O2 |
2,5-Dichlorobenzeneboronic acid, 98%
CAS: 135145-90-3 Formule moléculaire: C6H5BCl2O2 Poids moléculaire (g/mol): 190.814 Numéro MDL: MFCD01863182 Clé InChI: NNTFPBXQPOQRBT-UHFFFAOYSA-N Synonyme: 2,5-dichlorobenzeneboronic acid,2,5-dichlorophenyl boronic acid,2,5-dichlorophenylboronicacid,2,5-dichlorophenyl boranediol,boronic acid, 2,5-dichlorophenyl,pubchem1811,acmc-209bxy,ksc174k3h,2,5-dichloro-phenylboronic acid CID PubChem: 2773371 Nom IUPAC: (2,5-dichlorophenyl)boronic acid SMILES: B(C1=C(C=CC(=C1)Cl)Cl)(O)O
| Poids moléculaire (g/mol) | 190.814 |
|---|---|
| Synonyme | 2,5-dichlorobenzeneboronic acid,2,5-dichlorophenyl boronic acid,2,5-dichlorophenylboronicacid,2,5-dichlorophenyl boranediol,boronic acid, 2,5-dichlorophenyl,pubchem1811,acmc-209bxy,ksc174k3h,2,5-dichloro-phenylboronic acid |
| Numéro MDL | MFCD01863182 |
| CAS | 135145-90-3 |
| CID PubChem | 2773371 |
| Nom IUPAC | (2,5-dichlorophenyl)boronic acid |
| Clé InChI | NNTFPBXQPOQRBT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)Cl)(O)O |
| Formule moléculaire | C6H5BCl2O2 |
3-Methylbenzeneboronic acid, 97%
CAS: 17933-03-8 Formule moléculaire: C7H9BO2 Poids moléculaire (g/mol): 135.96 Numéro MDL: MFCD00040198 Clé InChI: BJQCPCFFYBKRLM-UHFFFAOYSA-N Synonyme: 3-tolylboronic acid,m-tolylboronic acid,3-methylphenyl boronic acid,3-methylbenzeneboronic acid,3-methyl phenyl boronic acid,3-tolyboronic acid,3-methylphenyl boranediol,m-methylphenylboronic acid,m-tolyl boronic acid CID PubChem: 2733950 Nom IUPAC: (3-methylphenyl)boronic acid SMILES: CC1=CC=CC(=C1)B(O)O
| Poids moléculaire (g/mol) | 135.96 |
|---|---|
| Synonyme | 3-tolylboronic acid,m-tolylboronic acid,3-methylphenyl boronic acid,3-methylbenzeneboronic acid,3-methyl phenyl boronic acid,3-tolyboronic acid,3-methylphenyl boranediol,m-methylphenylboronic acid,m-tolyl boronic acid |
| Numéro MDL | MFCD00040198 |
| CAS | 17933-03-8 |
| CID PubChem | 2733950 |
| Nom IUPAC | (3-methylphenyl)boronic acid |
| Clé InChI | BJQCPCFFYBKRLM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=C1)B(O)O |
| Formule moléculaire | C7H9BO2 |
Benzo[b]furan-2-boronic acid, 98%
CAS: 98437-24-2 Formule moléculaire: C8H7BO3 Poids moléculaire (g/mol): 161.95 Numéro MDL: MFCD00236019 Clé InChI: PKRRNTJIHGOMRC-UHFFFAOYSA-N Synonyme: benzofuran-2-boronic acid,benzo b furan-2-boronic acid,benzofuran-2-ylboronic acid,2-benzofuranboronic acid,2-benzofuranylboronic acid,2,3-benzo b furan-2-boronic acid,2-boronobenzo b furan,1-benzofuran-2-yl boronic acid,1-benzofuran-2-boronic acid CID PubChem: 2776266 Nom IUPAC: 1-benzofuran-2-ylboronic acid SMILES: OB(O)C1=CC2=CC=CC=C2O1
| Poids moléculaire (g/mol) | 161.95 |
|---|---|
| Synonyme | benzofuran-2-boronic acid,benzo b furan-2-boronic acid,benzofuran-2-ylboronic acid,2-benzofuranboronic acid,2-benzofuranylboronic acid,2,3-benzo b furan-2-boronic acid,2-boronobenzo b furan,1-benzofuran-2-yl boronic acid,1-benzofuran-2-boronic acid |
| Numéro MDL | MFCD00236019 |
| CAS | 98437-24-2 |
| CID PubChem | 2776266 |
| Nom IUPAC | 1-benzofuran-2-ylboronic acid |
| Clé InChI | PKRRNTJIHGOMRC-UHFFFAOYSA-N |
| SMILES | OB(O)C1=CC2=CC=CC=C2O1 |
| Formule moléculaire | C8H7BO3 |
4-Ethoxybenzeneboronic acid, 98%
CAS: 22237-13-4 Formule moléculaire: C8H11BO3 Poids moléculaire (g/mol): 165.983 Numéro MDL: MFCD00674028 Clé InChI: WRQNDLDUNQMTCL-UHFFFAOYSA-N Synonyme: 4-ethoxybenzeneboronic acid,4-ethoxyphenyl boronic acid,4-ethoxyphenyl boranediol,p-ethoxyphenylboronic acid,4-n-ethoxyphenyl boronic acid,boronic acid, 4-ethoxyphenyl,4-ethoxybenzeneboronicacid,4-ethoxyphenylboronicacid,4-ethoxyphenylboronic CID PubChem: 2734351 Nom IUPAC: (4-ethoxyphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)OCC)(O)O
| Poids moléculaire (g/mol) | 165.983 |
|---|---|
| Synonyme | 4-ethoxybenzeneboronic acid,4-ethoxyphenyl boronic acid,4-ethoxyphenyl boranediol,p-ethoxyphenylboronic acid,4-n-ethoxyphenyl boronic acid,boronic acid, 4-ethoxyphenyl,4-ethoxybenzeneboronicacid,4-ethoxyphenylboronicacid,4-ethoxyphenylboronic |
| Numéro MDL | MFCD00674028 |
| CAS | 22237-13-4 |
| CID PubChem | 2734351 |
| Nom IUPAC | (4-ethoxyphenyl)boronic acid |
| Clé InChI | WRQNDLDUNQMTCL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC)(O)O |
| Formule moléculaire | C8H11BO3 |