Filtered Search Results
Ethylaluminium dichloride, 1.8M solution in toluene, AcroSeal™
CAS: 563-43-9 Molecular Formula: C2H5AlCl2 Molecular Weight (g/mol): 126.94 MDL Number: MFCD00000457 InChI Key: UAIZDWNSWGTKFZ-UHFFFAOYSA-L Synonym: ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum IUPAC Name: dichloro(ethyl)alumane SMILES: CC[Al](Cl)Cl
| CAS | 563-43-9 |
|---|---|
| Molecular Weight (g/mol) | 126.94 |
| MDL Number | MFCD00000457 |
| SMILES | CC[Al](Cl)Cl |
| Synonym | ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum |
| IUPAC Name | dichloro(ethyl)alumane |
| InChI Key | UAIZDWNSWGTKFZ-UHFFFAOYSA-L |
| Molecular Formula | C2H5AlCl2 |
| PubChem CID | 160960 |
|---|---|
| CAS | 7550-45-0 |
| Molecular Weight (g/mol) | 189.71 |
| MDL Number | MFCD00011267 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| Synonym | titanium iv chloride,titanium 4+ tetrachloride,acmc-1bjgv,titanium 4+ ion tetrachloride,parent,titanium +4 cation tetrachloride,titanium iv chloride 100ml,superlist names titanium chloride, t-4,titanic chloride; titanio tetracloruro di,unii-8o3pje5t7q; titanium chloride ticl4 |
| IUPAC Name | titanium(4+);tetrachloride |
| InChI Key | XJDNKRIXUMDJCW-UHFFFAOYSA-J |
| Molecular Formula | Cl4Ti |
| Linear Formula | ZnCl2 |
|---|---|
| Molecular Weight (g/mol) | 136.29 |
| ChEBI | CHEBI:49976 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Zinc chloride |
| SMILES | Cl[Zn]Cl |
| Merck Index | 15, 10331 |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Density | 1.0700g/mL |
| PubChem CID | 5727 |
| Name Note | 2M solution in 2-Methyltetrahydrofuran |
| Concentration or Composition (by Analyte or Components) | 23 to 27% |
| CAS | 96-47-9 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00011295 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause respiratory irritation. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. May form explos |
| Flash Point | −11°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| Molecular Formula | Cl2Zn |
| EINECS Number | 231-592- |
| Formula Weight | 136.29 |
| Specific Gravity | 1.07 |
Sodium trimethylsilanolate, 1M solution in dichloromethane, AcroSeal™, Thermo Scientific Chemicals
CAS: 18027-10-6 Molecular Formula: C3H9NaOSi Molecular Weight (g/mol): 112.18 MDL Number: MFCD00013926 InChI Key: HSNUIYJWTSJUMS-UHFFFAOYSA-N Synonym: sodium trimethylsilanolate,silanol, trimethyl-, sodium salt,trimethylsilanol sodium salt,silanol, 1,1,1-trimethyl-, sodium salt 1:1,silanol,1,1,1-trimethyl-, sodium salt 1:1,naotms,sodiooxytrimethylsilane,naosi me 3,trimethylsilyloxy sodium,sodium trimethylsilanolat PubChem CID: 23672319 IUPAC Name: sodium;trimethyl(oxido)silane SMILES: C[Si](C)(C)[O-].[Na+]
| PubChem CID | 23672319 |
|---|---|
| CAS | 18027-10-6 |
| Molecular Weight (g/mol) | 112.18 |
| MDL Number | MFCD00013926 |
| SMILES | C[Si](C)(C)[O-].[Na+] |
| Synonym | sodium trimethylsilanolate,silanol, trimethyl-, sodium salt,trimethylsilanol sodium salt,silanol, 1,1,1-trimethyl-, sodium salt 1:1,silanol,1,1,1-trimethyl-, sodium salt 1:1,naotms,sodiooxytrimethylsilane,naosi me 3,trimethylsilyloxy sodium,sodium trimethylsilanolat |
| IUPAC Name | sodium;trimethyl(oxido)silane |
| InChI Key | HSNUIYJWTSJUMS-UHFFFAOYSA-N |
| Molecular Formula | C3H9NaOSi |
N,N'-Dicyclohexylcarbodiimide, 1M solution in dichloromethane, AcroSeal™
CAS: 538-75-0 | C13H22N2 | 206.33 g/mol
| PubChem CID | 10868 |
|---|---|
| CAS | 538-75-0 |
| Molecular Weight (g/mol) | 206.33 |
| ChEBI | CHEBI:53090 |
| MDL Number | MFCD00011659 |
| SMILES | C1CCC(CC1)N=C=NC2CCCCC2 |
| Synonym | dicyclohexylcarbodiimide,n,n'-dicyclohexylcarbodiimide,dccd,1,3-dicyclohexylcarbodiimide,dcci,carbodicyclohexylimide,bis cyclohexyl carbodiimide,dcc,n,n-dicyclohexylcarbodiimide,carbodiimide, dicyclohexyl |
| IUPAC Name | N,N'-dicyclohexylmethanediimine |
| InChI Key | QOSSAOTZNIDXMA-UHFFFAOYSA-N |
| Molecular Formula | C13H22N2 |
Sodium borohydride, 12% solution in 40% aq. NaOH solution, AcroSeal™
CAS: 16940-66-2 | BH4Na | 37.83 g/mol
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
Trimethyl orthoformate, 99+%, anhydrous, AcroSeal™
CAS: 149-73-5 Molecular Formula: C4H10O3 Molecular Weight (g/mol): 106.12 InChI Key: PYOKUURKVVELLB-UHFFFAOYSA-N Synonym: trimethyl orthoformate,methyl orthoformate,methane, trimethoxy,orthoformic acid, trimethyl ester,orthoformic acid methyl ester,orthomravencan methylnaty,methoxymethylal,methylester kyseliny orthomravenci,unii-xam28819yj,orthoformic acid trimethyl ester PubChem CID: 9005 IUPAC Name: trimethoxymethane SMILES: COC(OC)OC
| PubChem CID | 9005 |
|---|---|
| CAS | 149-73-5 |
| Molecular Weight (g/mol) | 106.12 |
| SMILES | COC(OC)OC |
| Synonym | trimethyl orthoformate,methyl orthoformate,methane, trimethoxy,orthoformic acid, trimethyl ester,orthoformic acid methyl ester,orthomravencan methylnaty,methoxymethylal,methylester kyseliny orthomravenci,unii-xam28819yj,orthoformic acid trimethyl ester |
| IUPAC Name | trimethoxymethane |
| InChI Key | PYOKUURKVVELLB-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3 |
| Molecular Weight (g/mol) | 312.65 |
|---|---|
| Chemical Name or Material | Boron tribromide dimethyl sulfide |
| SMILES | CSC.BrB(Br)Br |
| InChI Key | YNLFEVAOQLXINF-UHFFFAOYSA-N |
| Density | 1.4560g/mL |
| PubChem CID | 4181510 |
| Name Note | 1M solution in methylene chloride |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. |
| MDL Number | MFCD00043296 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Toxic if inhaled. Causes severe skin burns and eye damage. Harmful in contact with skin. Toxic if swallowed. Toxic if swallowed. |
| Solubility Information | Solubility in water: reacts |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tribromoborane-methyl sulfide,boron tribromide-methyl sulfide complex,boron tribromide dimethyl sulfide complex,tribromo dimethyl-??-sulfanylidene-??-borane,dimethyl sulfide-tribromoborane,tribromo dimethylsulfonio boranuide,boron tribromide-methylsulfide complex,borontribromide-methyl sulfide complex,boron tribromide dimethyl sulfide complex solution |
| IUPAC Name | (methylsulfanyl)methane; tribromoborane |
| Molecular Formula | C2H6BBr3S |
| Formula Weight | 312.66 |
| Specific Gravity | 1.456 |
Triethyl borate, 97%, AcroSeal™, Thermo Scientific Chemicals
CAS: 150-46-9 Molecular Formula: C6H15BO3 Molecular Weight (g/mol): 145.99 MDL Number: MFCD00009073 InChI Key: AJSTXXYNEIHPMD-UHFFFAOYSA-N Synonym: triethoxyborane,boron ethoxide,boron triethoxide,triethoxyboron,boric acid, triethyl ester,boric acid triethyl ester,borane, triethoxy,triethylborate,ethyl borate eto 3b,boric acid h3bo3 , triethyl ester PubChem CID: 9009 ChEBI: CHEBI:38916 IUPAC Name: triethyl borate SMILES: B(OCC)(OCC)OCC
| PubChem CID | 9009 |
|---|---|
| CAS | 150-46-9 |
| Molecular Weight (g/mol) | 145.99 |
| ChEBI | CHEBI:38916 |
| MDL Number | MFCD00009073 |
| SMILES | B(OCC)(OCC)OCC |
| Synonym | triethoxyborane,boron ethoxide,boron triethoxide,triethoxyboron,boric acid, triethyl ester,boric acid triethyl ester,borane, triethoxy,triethylborate,ethyl borate eto 3b,boric acid h3bo3 , triethyl ester |
| IUPAC Name | triethyl borate |
| InChI Key | AJSTXXYNEIHPMD-UHFFFAOYSA-N |
| Molecular Formula | C6H15BO3 |
| Linear Formula | LiBH4 |
|---|---|
| Molecular Weight (g/mol) | 21.78 |
| SMILES | [Li+].[BH4-] |
| Merck Index | 15,5581 |
| InChI Key | UUKMSDRCXNLYOO-UHFFFAOYSA-N |
| Density | 0.8900g/mL |
| PubChem CID | 20722760 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00011088 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. In contact with water releases flammable gases which may ignite spontaneously. Harmful if swallowed. Causes severe skin burns and eye damage. May cause respiratory irritati |
| Solubility Information | Solubility in water: decomposes |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | borate 1-, tetrahydro-, lithium,unii-8l87x4s4kp,boryllithium,lithium, boryl,lithium hydroborate,lithotab borohydride,bh4li,lithium 1+ ion boranuide,lithium borohydride 2.0 m in thf,borate 1-, tetrahydro-, lithium 1:1 |
| IUPAC Name | lithium;boron(1-) |
| Molecular Formula | BH4Li |
| EINECS Number | 241-021-7 |
| Formula Weight | 21.77 |
| Specific Gravity | 0.89 |
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Triethyloxonium tetrafluoroborate, 1M solution in methylene chloride, AcroSeal™
CAS: 368-39-8 | C6H15BF4O | 189.99 g/mol
| PubChem CID | 2723982 |
|---|---|
| CAS | 368-39-8 |
| Molecular Weight (g/mol) | 189.99 |
| MDL Number | MFCD00044423 |
| SMILES | F[B-](F)(F)F.CC[O+](CC)CC |
| Synonym | triethyloxonium tetrafluoroborate,triethyloxonium fluoroborate,triethyloxonium fluoborate,triethyloxonium borofluoride,triethoxonium fluoroborate,meerwein's reagent,triethyloxidanium tetrafluoroborate,unii-z0b19dd36j,triethyloxonium tetraflouroborate,boron tetrafluoride triethyl oxonium |
| IUPAC Name | triethyloxidanium;tetrafluoroborate |
| InChI Key | IYDQMLLDOVRSJJ-UHFFFAOYSA-N |
| Molecular Formula | C6H15BF4O |
Triethyl orthoformate, 98%, anhydrous, AcroSeal™
CAS: 122-51-0 Molecular Formula: C7H16O3 Molecular Weight (g/mol): 148.2 InChI Key: GKASDNZWUGIAMG-UHFFFAOYSA-N Synonym: triethyl orthoformate,triethoxymethane,ethyl orthoformate,aethon,ethone,diethoxymethoxy ethane,methane, triethoxy,ethyl formate ortho,orthoformic acid triethyl ester,orthomravencan ethylnaty PubChem CID: 31214 IUPAC Name: diethoxymethoxyethane SMILES: CCOC(OCC)OCC
| PubChem CID | 31214 |
|---|---|
| CAS | 122-51-0 |
| Molecular Weight (g/mol) | 148.2 |
| SMILES | CCOC(OCC)OCC |
| Synonym | triethyl orthoformate,triethoxymethane,ethyl orthoformate,aethon,ethone,diethoxymethoxy ethane,methane, triethoxy,ethyl formate ortho,orthoformic acid triethyl ester,orthomravencan ethylnaty |
| IUPAC Name | diethoxymethoxyethane |
| InChI Key | GKASDNZWUGIAMG-UHFFFAOYSA-N |
| Molecular Formula | C7H16O3 |
Sodium ethoxide, 21% in ethanol, AcroSeal™
CAS: 141-52-6 Molecular Formula: C2H5NaO Molecular Weight (g/mol): 68.04 MDL Number: MFCD00012417 InChI Key: QDRKDTQENPPHOJ-UHFFFAOYSA-N Synonym: sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 PubChem CID: 2723922 ChEBI: CHEBI:52096 IUPAC Name: sodium;ethanolate SMILES: CC[O-].[Na+]
| PubChem CID | 2723922 |
|---|---|
| CAS | 141-52-6 |
| Molecular Weight (g/mol) | 68.04 |
| ChEBI | CHEBI:52096 |
| MDL Number | MFCD00012417 |
| SMILES | CC[O-].[Na+] |
| Synonym | sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 |
| IUPAC Name | sodium;ethanolate |
| InChI Key | QDRKDTQENPPHOJ-UHFFFAOYSA-N |
| Molecular Formula | C2H5NaO |
Ethyl chloroformate, 99%, AcroSeal™
CAS: 541-41-3 Molecular Formula: C3H5ClO2 Molecular Weight (g/mol): 108.52 MDL Number: MFCD00000644 InChI Key: RIFGWPKJUGCATF-UHFFFAOYSA-N Synonym: ethyl chloroformate,ethyl chlorocarbonate,cathyl chloride,ethoxycarbonyl chloride,chloroformic acid ethyl ester,ethylchloroformate,carbonochloridic acid, ethyl ester,chloro ethoxy methanone,ethylchloorformiaat,etil cloroformiato PubChem CID: 10928 IUPAC Name: ethyl carbonochloridate SMILES: CCOC(=O)Cl
| PubChem CID | 10928 |
|---|---|
| CAS | 541-41-3 |
| Molecular Weight (g/mol) | 108.52 |
| MDL Number | MFCD00000644 |
| SMILES | CCOC(=O)Cl |
| Synonym | ethyl chloroformate,ethyl chlorocarbonate,cathyl chloride,ethoxycarbonyl chloride,chloroformic acid ethyl ester,ethylchloroformate,carbonochloridic acid, ethyl ester,chloro ethoxy methanone,ethylchloorformiaat,etil cloroformiato |
| IUPAC Name | ethyl carbonochloridate |
| InChI Key | RIFGWPKJUGCATF-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO2 |