Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tin(II) pyrophosphate
CAS: 15578-26-4 Molecular Formula: O7P2Sn2 Molecular Weight (g/mol): 411.361 MDL Number: MFCD00049544 InChI Key: GEZAUFNYMZVOFV-UHFFFAOYSA-J Synonym: stannous pyrophosphate,technescan pyp,ditin pyrophosphate,tin ii pyrophosphate,tin 2+ pyrophosphate,unii-4dnt29ec86,stannous pyrophosphate usan,tin 2+ diphosphate 1:2,pyro stannous phosphate,ditin 2+ pyrophosphate 4- PubChem CID: 66379 IUPAC Name: phosphonato phosphate;tin(2+) SMILES: [O-]P(=O)([O-])OP(=O)([O-])[O-].[Sn+2].[Sn+2]
| PubChem CID | 66379 |
|---|---|
| CAS | 15578-26-4 |
| Molecular Weight (g/mol) | 411.361 |
| MDL Number | MFCD00049544 |
| SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Sn+2].[Sn+2] |
| Synonym | stannous pyrophosphate,technescan pyp,ditin pyrophosphate,tin ii pyrophosphate,tin 2+ pyrophosphate,unii-4dnt29ec86,stannous pyrophosphate usan,tin 2+ diphosphate 1:2,pyro stannous phosphate,ditin 2+ pyrophosphate 4- |
| IUPAC Name | phosphonato phosphate;tin(2+) |
| InChI Key | GEZAUFNYMZVOFV-UHFFFAOYSA-J |
| Molecular Formula | O7P2Sn2 |
Tin(IV) bromide, 99%
CAS: 7789-67-5 Molecular Formula: Br4Sn Molecular Weight (g/mol): 438.326 MDL Number: MFCD00011240 InChI Key: LTSUHJWLSNQKIP-UHFFFAOYSA-J Synonym: tin iv bromide,stannic bromide,tin tetrabromide,stannane, tetrabromo,tin perbromide,snbr4,tin bromide,tin iv bromide 1:4,tetrabromotin PubChem CID: 24616 IUPAC Name: tetrabromostannane SMILES: Br[Sn](Br)(Br)Br
| PubChem CID | 24616 |
|---|---|
| CAS | 7789-67-5 |
| Molecular Weight (g/mol) | 438.326 |
| MDL Number | MFCD00011240 |
| SMILES | Br[Sn](Br)(Br)Br |
| Synonym | tin iv bromide,stannic bromide,tin tetrabromide,stannane, tetrabromo,tin perbromide,snbr4,tin bromide,tin iv bromide 1:4,tetrabromotin |
| IUPAC Name | tetrabromostannane |
| InChI Key | LTSUHJWLSNQKIP-UHFFFAOYSA-J |
| Molecular Formula | Br4Sn |
Tin(IV) iodide, 95%
CAS: 7790-47-8 Molecular Formula: H4I4Sn Molecular Weight (g/mol): 630.36 MDL Number: MFCD00036272 InChI Key: ZBCVLXKKLMNLGV-UHFFFAOYSA-N Synonym: stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide PubChem CID: 24631 IUPAC Name: tetraiodostannane SMILES: [Sn].I.I.I.I
| PubChem CID | 24631 |
|---|---|
| CAS | 7790-47-8 |
| Molecular Weight (g/mol) | 630.36 |
| MDL Number | MFCD00036272 |
| SMILES | [Sn].I.I.I.I |
| Synonym | stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide |
| IUPAC Name | tetraiodostannane |
| InChI Key | ZBCVLXKKLMNLGV-UHFFFAOYSA-N |
| Molecular Formula | H4I4Sn |
Tin(II) sulfide, 99.5%
CAS: 1314-95-0 Molecular Formula: SSn Molecular Weight (g/mol): 150.77 MDL Number: MFCD00011245 InChI Key: DZXKSFDSPBRJPS-UHFFFAOYSA-N Synonym: tin ii sulfide,stannous sulfide,tin sulfide sns,tin monosulfide,tin sulphide,stannanethione,herzenbergite,zinnsulfur,acmc-1btyn PubChem CID: 426379 IUPAC Name: λ²-tin(2+) sulfanediide SMILES: [S--].[Sn++]
| PubChem CID | 426379 |
|---|---|
| CAS | 1314-95-0 |
| Molecular Weight (g/mol) | 150.77 |
| MDL Number | MFCD00011245 |
| SMILES | [S--].[Sn++] |
| Synonym | tin ii sulfide,stannous sulfide,tin sulfide sns,tin monosulfide,tin sulphide,stannanethione,herzenbergite,zinnsulfur,acmc-1btyn |
| IUPAC Name | λ²-tin(2+) sulfanediide |
| InChI Key | DZXKSFDSPBRJPS-UHFFFAOYSA-N |
| Molecular Formula | SSn |
Tin(II) oxide, 99%
CAS: 21651-19-4 Molecular Formula: OSn Molecular Weight (g/mol): 134.71 MDL Number: MFCD00011243 InChI Key: QHGNHLZPVBIIPX-UHFFFAOYSA-N Synonym: stannous oxide,tin ii oxide,tin oxide sno,tin monoxide,tin oxide sn2o2,stannane, oxo,stannanone,stannicoxide,oxostannanylidene,oxo stannane PubChem CID: 88989 IUPAC Name: oxotin SMILES: O=[Sn]
| PubChem CID | 88989 |
|---|---|
| CAS | 21651-19-4 |
| Molecular Weight (g/mol) | 134.71 |
| MDL Number | MFCD00011243 |
| SMILES | O=[Sn] |
| Synonym | stannous oxide,tin ii oxide,tin oxide sno,tin monoxide,tin oxide sn2o2,stannane, oxo,stannanone,stannicoxide,oxostannanylidene,oxo stannane |
| IUPAC Name | oxotin |
| InChI Key | QHGNHLZPVBIIPX-UHFFFAOYSA-N |
| Molecular Formula | OSn |
Tin(II) bromide, 99.2%
CAS: 10031-24-0 Molecular Formula: SnBr2 MDL Number: MFCD00011239 Synonym: tin ii bromide,tin dibromide,stannous bromide,tin bromide snbr2,snbr2,acmc-1bp22
| CAS | 10031-24-0 |
|---|---|
| MDL Number | MFCD00011239 |
| Synonym | tin ii bromide,tin dibromide,stannous bromide,tin bromide snbr2,snbr2,acmc-1bp22 |
| Molecular Formula | SnBr2 |
Tin(II) iodide, 99+%
CAS: 10294-70-9 Molecular Formula: I2Sn Molecular Weight (g/mol): 372.519 MDL Number: MFCD00049545 InChI Key: JTDNNCYXCFHBGG-UHFFFAOYSA-L Synonym: tin ii iodide,stannous iodide,tin diiodide,tin iodide sni2,stannous diiodide,sni2,acmc-1bqot,tin ii iodide, ultra dry,tin ii iodide,-10 mesh trace metals basis,tin ii iodide, anhydrous, beads,-10 mesh trace metals basis PubChem CID: 25138 IUPAC Name: diiodotin SMILES: [Sn](I)I
| PubChem CID | 25138 |
|---|---|
| CAS | 10294-70-9 |
| Molecular Weight (g/mol) | 372.519 |
| MDL Number | MFCD00049545 |
| SMILES | [Sn](I)I |
| Synonym | tin ii iodide,stannous iodide,tin diiodide,tin iodide sni2,stannous diiodide,sni2,acmc-1bqot,tin ii iodide, ultra dry,tin ii iodide,-10 mesh trace metals basis,tin ii iodide, anhydrous, beads,-10 mesh trace metals basis |
| IUPAC Name | diiodotin |
| InChI Key | JTDNNCYXCFHBGG-UHFFFAOYSA-L |
| Molecular Formula | I2Sn |
Tin(II) sulfate, 95%
CAS: 7488-55-3 Molecular Formula: O4SSn Molecular Weight (g/mol): 214.77 MDL Number: MFCD00011246 InChI Key: OBBXFSIWZVFYJR-UHFFFAOYSA-L Synonym: stannous sulfate,tin ii sulfate,tin 2+ sulfate,unii-0mfe10j96e,sulfuric acid, tin 2+ salt 1:1,stannous sulfate, crystal,stannous sulfate, solutions,tin, ion sn2+ sulfate,tin ii sulfate 250g PubChem CID: 62643 SMILES: [Sn++].[O-]S([O-])(=O)=O
| PubChem CID | 62643 |
|---|---|
| CAS | 7488-55-3 |
| Molecular Weight (g/mol) | 214.77 |
| MDL Number | MFCD00011246 |
| SMILES | [Sn++].[O-]S([O-])(=O)=O |
| Synonym | stannous sulfate,tin ii sulfate,tin 2+ sulfate,unii-0mfe10j96e,sulfuric acid, tin 2+ salt 1:1,stannous sulfate, crystal,stannous sulfate, solutions,tin, ion sn2+ sulfate,tin ii sulfate 250g |
| InChI Key | OBBXFSIWZVFYJR-UHFFFAOYSA-L |
| Molecular Formula | O4SSn |
Tin(II) oxalate, 98%
CAS: 814-94-8 Molecular Formula: C2O4Sn Molecular Weight (g/mol): 206.728 MDL Number: MFCD00040678 InChI Key: OQBLGYCUQGDOOR-UHFFFAOYSA-L Synonym: stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty PubChem CID: 13149 IUPAC Name: oxalate;tin(2+) SMILES: C(=O)(C(=O)[O-])[O-].[Sn+2]
| PubChem CID | 13149 |
|---|---|
| CAS | 814-94-8 |
| Molecular Weight (g/mol) | 206.728 |
| MDL Number | MFCD00040678 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sn+2] |
| Synonym | stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty |
| IUPAC Name | oxalate;tin(2+) |
| InChI Key | OQBLGYCUQGDOOR-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sn |
Tin(II) trifluoromethanesulfonate, 98%
CAS: 62086-04-8 Molecular Formula: C2F6O6S2Sn Molecular Weight (g/mol): 416.85 MDL Number: MFCD00191251 InChI Key: IACSYIHNPIQPMP-UHFFFAOYSA-M Synonym: tin ii trifluoromethanesulfonate PubChem CID: 131676109 IUPAC Name: molecular hydrogen;tin(2+);trifluoromethanesulfonate SMILES: [HH].[HH].C(F)(F)(F)S(=O)(=O)[O-].[Sn+2]
| PubChem CID | 131676109 |
|---|---|
| CAS | 62086-04-8 |
| Molecular Weight (g/mol) | 416.85 |
| MDL Number | MFCD00191251 |
| SMILES | [HH].[HH].C(F)(F)(F)S(=O)(=O)[O-].[Sn+2] |
| Synonym | tin ii trifluoromethanesulfonate |
| IUPAC Name | molecular hydrogen;tin(2+);trifluoromethanesulfonate |
| InChI Key | IACSYIHNPIQPMP-UHFFFAOYSA-M |
| Molecular Formula | C2F6O6S2Sn |
Tin powder, -325 mesh
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Tin(II) fluoride, 99%
CAS: 7783-47-3 Molecular Formula: F2Sn Molecular Weight (g/mol): 156.69 MDL Number: MFCD00042540
| CAS | 7783-47-3 |
|---|---|
| Molecular Weight (g/mol) | 156.69 |
| MDL Number | MFCD00042540 |
| Molecular Formula | F2Sn |
| CAS | 7783-47-3 |
|---|---|
| MDL Number | MFCD00042540 |
Nickel tin oxide dihydrate
CAS: 12035-38-0 Molecular Formula: NiO3Sn Molecular Weight (g/mol): 225.40 MDL Number: MFCD00054011 InChI Key: SHULAURIUQUJKN-UHFFFAOYSA-N Synonym: Nickel stannate
| CAS | 12035-38-0 |
|---|---|
| Molecular Weight (g/mol) | 225.40 |
| MDL Number | MFCD00054011 |
| Synonym | Nickel stannate |
| InChI Key | SHULAURIUQUJKN-UHFFFAOYSA-N |
| Molecular Formula | NiO3Sn |
Tin(IV) chloride, 99%, anhydrous
CAS: 7646-78-8 Molecular Formula: Cl4Sn Molecular Weight (g/mol): 260.52 InChI Key: HPGGPRDJHPYFRM-UHFFFAOYSA-J Synonym: tin tetrachloride,tin iv chloride,stannane, tetrachloro,tin chloride,stannic chloride,tetrachlorotin,tin perchloride,tintetrachloride,tin iv tetrachloride,sncl4 PubChem CID: 24287 IUPAC Name: tetrachlorostannane SMILES: Cl[Sn](Cl)(Cl)Cl
| PubChem CID | 24287 |
|---|---|
| CAS | 7646-78-8 |
| Molecular Weight (g/mol) | 260.52 |
| SMILES | Cl[Sn](Cl)(Cl)Cl |
| Synonym | tin tetrachloride,tin iv chloride,stannane, tetrachloro,tin chloride,stannic chloride,tetrachlorotin,tin perchloride,tintetrachloride,tin iv tetrachloride,sncl4 |
| IUPAC Name | tetrachlorostannane |
| InChI Key | HPGGPRDJHPYFRM-UHFFFAOYSA-J |
| Molecular Formula | Cl4Sn |