Organometallic Compounds
Résultats de la recherche filtrée
Silicon(IV) 2-ethylhexanoate, nominally 75% in ethanol
CAS: 67939-81-5 Formule moléculaire: C32H60O8Si Poids moléculaire (g/mol): 600.909 Numéro MDL: MFCD00269842 Clé InChI: UNKOLEUDCQIVBV-UHFFFAOYSA-N Synonyme: silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol CID PubChem: 106984 Nom IUPAC: tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate SMILES: CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC
| Poids moléculaire (g/mol) | 600.909 |
|---|---|
| Synonyme | silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol |
| Numéro MDL | MFCD00269842 |
| CAS | 67939-81-5 |
| CID PubChem | 106984 |
| Nom IUPAC | tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate |
| Clé InChI | UNKOLEUDCQIVBV-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| Formule moléculaire | C32H60O8Si |
Copper(II) oxalate hemihydrate, 98%
CAS: 5893-66-3 Formule moléculaire: C4H8Cu2O10 Poids moléculaire (g/mol): 343.19 Numéro MDL: MFCD00150451 Clé InChI: NNZNHNMQOYUANB-UHFFFAOYSA-N Synonyme: cupric oxalate,copper oxalate hemihydrate CID PubChem: 122130000 Nom IUPAC: copper;oxalic acid;hydrate SMILES: O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O
| Poids moléculaire (g/mol) | 343.19 |
|---|---|
| Synonyme | cupric oxalate,copper oxalate hemihydrate |
| Numéro MDL | MFCD00150451 |
| CAS | 5893-66-3 |
| CID PubChem | 122130000 |
| Nom IUPAC | copper;oxalic acid;hydrate |
| Clé InChI | NNZNHNMQOYUANB-UHFFFAOYSA-N |
| SMILES | O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O |
| Formule moléculaire | C4H8Cu2O10 |
| Numéro MDL | MFCD00015611 |
|---|---|
| CAS | 1184-54-9 |
Chlorophyllin, coppered trisodium salt
CAS: 11006-34-1 Formule moléculaire: C34H31CuN4Na3O6 Numéro MDL: MFCD00012149
| Numéro MDL | MFCD00012149 |
|---|---|
| CAS | 11006-34-1 |
| Formule moléculaire | C34H31CuN4Na3O6 |
Copper(II) methacrylate, tech.
CAS: 19662-59-0 Formule moléculaire: C4H5CuO2 Poids moléculaire (g/mol): 148.63 Numéro MDL: MFCD00080547,MFCD00156451,MFCD00080547 Clé InChI: BFHDHRZKYIRNRP-UHFFFAOYSA-M CID PubChem: 121233728 Nom IUPAC: copper;2-methylprop-2-enoic acid;hydrate SMILES: [Cu++].CC(=C)C([O-])=O
| Poids moléculaire (g/mol) | 148.63 |
|---|---|
| Numéro MDL | MFCD00080547,MFCD00156451,MFCD00080547 |
| CAS | 19662-59-0 |
| CID PubChem | 121233728 |
| Nom IUPAC | copper;2-methylprop-2-enoic acid;hydrate |
| Clé InChI | BFHDHRZKYIRNRP-UHFFFAOYSA-M |
| SMILES | [Cu++].CC(=C)C([O-])=O |
| Formule moléculaire | C4H5CuO2 |
Tricyclohexyltin chloride, 97%
CAS: 3091-32-5 Formule moléculaire: C18H33ClSn Poids moléculaire (g/mol): 403.622 Numéro MDL: MFCD00003817 Clé InChI: OJVZYIKTLISAIH-UHFFFAOYSA-M Synonyme: tricyclohexyltin chloride,stannane, chlorotricyclohexyl,chlorotricyclohexyltin,chloro tricyclohexyl stannane,tin, chlorotricyclohexyl,tricyclohexyltinchloride,acmc-1ck6z,tricyclohexylchlorotin CID PubChem: 76539 Nom IUPAC: chloro(tricyclohexyl)stannane SMILES: C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)Cl
| Poids moléculaire (g/mol) | 403.622 |
|---|---|
| Synonyme | tricyclohexyltin chloride,stannane, chlorotricyclohexyl,chlorotricyclohexyltin,chloro tricyclohexyl stannane,tin, chlorotricyclohexyl,tricyclohexyltinchloride,acmc-1ck6z,tricyclohexylchlorotin |
| Numéro MDL | MFCD00003817 |
| CAS | 3091-32-5 |
| CID PubChem | 76539 |
| Nom IUPAC | chloro(tricyclohexyl)stannane |
| Clé InChI | OJVZYIKTLISAIH-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)Cl |
| Formule moléculaire | C18H33ClSn |
Tri-n-butyltin iodide, tech. 90%, stab. with copper, Thermo Scientific™
CAS: 7342-47-4 Formule moléculaire: C12H27ISn Poids moléculaire (g/mol): 416.962 Numéro MDL: MFCD00074996 Clé InChI: YHHVXVNXTMIXOL-UHFFFAOYSA-M Synonyme: tributyltin iodide,iodotributylstannane,stannane, iodotributyl,iodotributyltin,stannane, tributyliodo,tri-n-butyl tin iodide,tin, tri-n-butyl-, iodide,bu3sni,tri-n-butyltin iodide,tributyl iodo stannane CID PubChem: 23765 Nom IUPAC: tributyl(iodo)stannane SMILES: CCCC[Sn](CCCC)(CCCC)I
| Poids moléculaire (g/mol) | 416.962 |
|---|---|
| Synonyme | tributyltin iodide,iodotributylstannane,stannane, iodotributyl,iodotributyltin,stannane, tributyliodo,tri-n-butyl tin iodide,tin, tri-n-butyl-, iodide,bu3sni,tri-n-butyltin iodide,tributyl iodo stannane |
| Numéro MDL | MFCD00074996 |
| CAS | 7342-47-4 |
| CID PubChem | 23765 |
| Nom IUPAC | tributyl(iodo)stannane |
| Clé InChI | YHHVXVNXTMIXOL-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)I |
| Formule moléculaire | C12H27ISn |
Diethylgermanium dichloride
CAS: 13314-52-8 Formule moléculaire: C4H14Cl2Ge Poids moléculaire (g/mol): 205.69 Numéro MDL: MFCD00013589 Clé InChI: FVUWAWRMMUJVGO-UHFFFAOYSA-N Synonyme: diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane CID PubChem: 83334 Nom IUPAC: dichloro(diethyl)germane SMILES: Cl.Cl.CC[GeH2]CC
| Poids moléculaire (g/mol) | 205.69 |
|---|---|
| Synonyme | diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane |
| Numéro MDL | MFCD00013589 |
| CAS | 13314-52-8 |
| CID PubChem | 83334 |
| Nom IUPAC | dichloro(diethyl)germane |
| Clé InChI | FVUWAWRMMUJVGO-UHFFFAOYSA-N |
| SMILES | Cl.Cl.CC[GeH2]CC |
| Formule moléculaire | C4H14Cl2Ge |
n-Butyltin trichloride, 96%
CAS: 1118-46-3 Formule moléculaire: C4H9Cl3Sn Poids moléculaire (g/mol): 282.176 Numéro MDL: MFCD00000515 Clé InChI: YMLFYGFCXGNERH-UHFFFAOYSA-K Synonyme: butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride CID PubChem: 14236 Nom IUPAC: butyl(trichloro)stannane SMILES: CCCC[Sn](Cl)(Cl)Cl
| Poids moléculaire (g/mol) | 282.176 |
|---|---|
| Synonyme | butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride |
| Numéro MDL | MFCD00000515 |
| CAS | 1118-46-3 |
| CID PubChem | 14236 |
| Nom IUPAC | butyl(trichloro)stannane |
| Clé InChI | YMLFYGFCXGNERH-UHFFFAOYSA-K |
| SMILES | CCCC[Sn](Cl)(Cl)Cl |
| Formule moléculaire | C4H9Cl3Sn |
Ethylaluminium dichloride, 1.8M solution in toluene, AcroSeal™
CAS: 563-43-9 Formule moléculaire: C2H5AlCl2 Poids moléculaire (g/mol): 126.94 Numéro MDL: MFCD00000457 Clé InChI: UAIZDWNSWGTKFZ-UHFFFAOYSA-L Synonyme: ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum Nom IUPAC: dichloro(ethyl)alumane SMILES: CC[Al](Cl)Cl
| Poids moléculaire (g/mol) | 126.94 |
|---|---|
| Synonyme | ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum |
| Numéro MDL | MFCD00000457 |
| CAS | 563-43-9 |
| Nom IUPAC | dichloro(ethyl)alumane |
| Clé InChI | UAIZDWNSWGTKFZ-UHFFFAOYSA-L |
| SMILES | CC[Al](Cl)Cl |
| Formule moléculaire | C2H5AlCl2 |
Tri-n-butyltin chloride, 95%, tech.
CAS: 1461-22-9 Formule moléculaire: C12H27ClSn Poids moléculaire (g/mol): 325.48 Numéro MDL: MFCD00000521 Clé InChI: GCTFWCDSFPMHHS-UHFFFAOYSA-M Synonyme: tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride CID PubChem: 15096 ChEBI: CHEBI:79734 Nom IUPAC: tributyl(chloro)stannane SMILES: CCCC[Sn](CCCC)(CCCC)Cl
| Poids moléculaire (g/mol) | 325.48 |
|---|---|
| Synonyme | tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride |
| Numéro MDL | MFCD00000521 |
| CAS | 1461-22-9 |
| CID PubChem | 15096 |
| ChEBI | CHEBI:79734 |
| Nom IUPAC | tributyl(chloro)stannane |
| Clé InChI | GCTFWCDSFPMHHS-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cl |
| Formule moléculaire | C12H27ClSn |
Methylgermanium trichloride, 97%
CAS: 993-10-2 Formule moléculaire: CH9Cl3Ge Poids moléculaire (g/mol): 200.06 Numéro MDL: MFCD00013585 Clé InChI: NNMJXXWNUALEKD-UHFFFAOYSA-N Synonyme: methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 CID PubChem: 70436 Nom IUPAC: trichloro(methyl)germane SMILES: Cl.Cl.Cl.C[GeH3]
| Poids moléculaire (g/mol) | 200.06 |
|---|---|
| Synonyme | methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 |
| Numéro MDL | MFCD00013585 |
| CAS | 993-10-2 |
| CID PubChem | 70436 |
| Nom IUPAC | trichloro(methyl)germane |
| Clé InChI | NNMJXXWNUALEKD-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Cl.C[GeH3] |
| Formule moléculaire | CH9Cl3Ge |
Trimethyltin chloride, 99%
CAS: 1066-45-1 Formule moléculaire: C3H11ClSn Poids moléculaire (g/mol): 201.28 Numéro MDL: MFCD00000520 Clé InChI: FVFGWISLDLUGHX-UHFFFAOYSA-N Synonyme: trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride CID PubChem: 14016 Nom IUPAC: chloro(trimethyl)stannane SMILES: Cl.C[SnH](C)C
| Poids moléculaire (g/mol) | 201.28 |
|---|---|
| Synonyme | trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride |
| Numéro MDL | MFCD00000520 |
| CAS | 1066-45-1 |
| CID PubChem | 14016 |
| Nom IUPAC | chloro(trimethyl)stannane |
| Clé InChI | FVFGWISLDLUGHX-UHFFFAOYSA-N |
| SMILES | Cl.C[SnH](C)C |
| Formule moléculaire | C3H11ClSn |
Ethylaluminium sesquichloride, 0.4M solution in hexane, AcroSeal™
CAS: 12075-68-2 Formule moléculaire: C6H15Al2Cl3 Poids moléculaire (g/mol): 247.51 Numéro MDL: MFCD00044852 Clé InChI: LDXMUMPEDOQULK-UHFFFAOYSA-K Synonyme: ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane CID PubChem: 25508 Nom IUPAC: chloro(diethyl)alumane;dichloro(ethyl)alumane SMILES: CC[Al](CC)Cl.CC[Al](Cl)Cl
| Poids moléculaire (g/mol) | 247.51 |
|---|---|
| Synonyme | ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane |
| Numéro MDL | MFCD00044852 |
| CAS | 12075-68-2 |
| CID PubChem | 25508 |
| Nom IUPAC | chloro(diethyl)alumane;dichloro(ethyl)alumane |
| Clé InChI | LDXMUMPEDOQULK-UHFFFAOYSA-K |
| SMILES | CC[Al](CC)Cl.CC[Al](Cl)Cl |
| Formule moléculaire | C6H15Al2Cl3 |
Trimethyltin bromide, Thermo Scientific™
CAS: 1066-44-0 Formule moléculaire: C3H11BrSn Poids moléculaire (g/mol): 245.74 Numéro MDL: MFCD00000051 Clé InChI: KNPKGRQZYPSMBF-UHFFFAOYSA-N Synonyme: trimethyltin bromide,bromotrimethyltin,stannane, bromotrimethyl,trimethylstannyl bromide,trimethyltin bromide 6ci,me3snbr,tin, bromotrimethyl,acmc-20ajcw,bromo trimethyl stannane,ch3 3snbr CID PubChem: 14015 Nom IUPAC: bromo(trimethyl)stannane SMILES: Br.C[SnH](C)C
| Poids moléculaire (g/mol) | 245.74 |
|---|---|
| Synonyme | trimethyltin bromide,bromotrimethyltin,stannane, bromotrimethyl,trimethylstannyl bromide,trimethyltin bromide 6ci,me3snbr,tin, bromotrimethyl,acmc-20ajcw,bromo trimethyl stannane,ch3 3snbr |
| Numéro MDL | MFCD00000051 |
| CAS | 1066-44-0 |
| CID PubChem | 14015 |
| Nom IUPAC | bromo(trimethyl)stannane |
| Clé InChI | KNPKGRQZYPSMBF-UHFFFAOYSA-N |
| SMILES | Br.C[SnH](C)C |
| Formule moléculaire | C3H11BrSn |