Filtered Search Results
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9950g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Boiling Point | >100.0°C |
| Color | White to Yellow |
| Physical Form | Crystals or Powder |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.995 |
| Linear Formula | KOH |
|---|---|
| Molecular Weight (g/mol) | 56.11 |
| ChEBI | CHEBI:32035 |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Density | 0.8600g/mL |
| PubChem CID | 14797 |
| Name Note | 1N solution in ethanol |
| Formula Weight | 56.11 |
| Melting Point | -117.0°C |
| Boiling Point | 78.0°C |
| Color | Brown-Orange to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Potassium hydroxide |
| SMILES | [OH-].[K+] |
| Merck Index | 15, 7761 |
| Concentration | 0.950 to 1.050N |
| CAS | 64-17-5 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00003553 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Highly flammable liquid and vapor. |
| Packaging | Plastic bottle |
| Flash Point | 12°C |
| Solubility Information | Solubility in water: soluble. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| Recommended Storage | May darken on storage |
| IUPAC Name | potassium hydroxide |
| Molecular Formula | HKO |
| Specific Gravity | 0.86 |
Sodium bromide, 99+% (dry wt.), water <1.0%
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Lithium hexafluorophosphate, 98%
CAS: 21324-40-3 Molecular Formula: F6LiP Molecular Weight (g/mol): 151.904 MDL Number: MFCD00011096 InChI Key: AXPLOJNSKRXQPA-UHFFFAOYSA-N Synonym: lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h PubChem CID: 23688915 IUPAC Name: lithium;hexafluorophosphate SMILES: [Li+].F[P-](F)(F)(F)(F)F
| PubChem CID | 23688915 |
|---|---|
| CAS | 21324-40-3 |
| Molecular Weight (g/mol) | 151.904 |
| MDL Number | MFCD00011096 |
| SMILES | [Li+].F[P-](F)(F)(F)(F)F |
| Synonym | lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h |
| IUPAC Name | lithium;hexafluorophosphate |
| InChI Key | AXPLOJNSKRXQPA-UHFFFAOYSA-N |
| Molecular Formula | F6LiP |
Adiponitrile, 99+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 111-69-3 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.144 MDL Number: MFCD00001975 InChI Key: BTGRAWJCKBQKAO-UHFFFAOYSA-N Synonym: adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril PubChem CID: 8128 IUPAC Name: hexanedinitrile SMILES: C(CCC#N)CC#N
| PubChem CID | 8128 |
|---|---|
| CAS | 111-69-3 |
| Molecular Weight (g/mol) | 108.144 |
| MDL Number | MFCD00001975 |
| SMILES | C(CCC#N)CC#N |
| Synonym | adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril |
| IUPAC Name | hexanedinitrile |
| InChI Key | BTGRAWJCKBQKAO-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |
Lithium bromide, 99%, pure, anhydrous
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.84 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Synonym: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| PubChem CID | 82050 |
|---|---|
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.84 |
| ChEBI | CHEBI:63042 |
| SMILES | [Li+].[Br-] |
| Synonym | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
Lithium trifluoromethanesulfonate, 98%
CAS: 33454-82-9 Molecular Formula: CF3LiO3S Molecular Weight (g/mol): 156.01 MDL Number: MFCD00013227 InChI Key: MCVFFRWZNYZUIJ-UHFFFAOYSA-M Synonym: lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt PubChem CID: 3664839 IUPAC Name: lithium;trifluoromethanesulfonate SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[O-]
| PubChem CID | 3664839 |
|---|---|
| CAS | 33454-82-9 |
| Molecular Weight (g/mol) | 156.01 |
| MDL Number | MFCD00013227 |
| SMILES | [Li+].C(F)(F)(F)S(=O)(=O)[O-] |
| Synonym | lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt |
| IUPAC Name | lithium;trifluoromethanesulfonate |
| InChI Key | MCVFFRWZNYZUIJ-UHFFFAOYSA-M |
| Molecular Formula | CF3LiO3S |
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Tetraheptylammonium bromide, 99%
CAS: 4368-51-8 Molecular Formula: C28H60BrN Molecular Weight (g/mol): 490.69 MDL Number: MFCD00011861 InChI Key: YQIVQBMEBZGFBY-UHFFFAOYSA-M Synonym: tetraheptylammonium bromide,tetra-n-heptylammonium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide,tetraheptylazanium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide 1:1,acmc-209jv6,nhep4 1+ *br 1- PubChem CID: 78073 IUPAC Name: tetraheptylazanium;bromide SMILES: CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-]
| PubChem CID | 78073 |
|---|---|
| CAS | 4368-51-8 |
| Molecular Weight (g/mol) | 490.69 |
| MDL Number | MFCD00011861 |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-] |
| Synonym | tetraheptylammonium bromide,tetra-n-heptylammonium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide,tetraheptylazanium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide 1:1,acmc-209jv6,nhep4 1+ *br 1- |
| IUPAC Name | tetraheptylazanium;bromide |
| InChI Key | YQIVQBMEBZGFBY-UHFFFAOYSA-M |
| Molecular Formula | C28H60BrN |
Potassium hydroxide, flake, 85%
CAS: 1310-58-3 Molecular Formula: HKO Molecular Weight (g/mol): 56.11 MDL Number: MFCD00003553 InChI Key: KWYUFKZDYYNOTN-UHFFFAOYSA-M IUPAC Name: potassium hydroxide SMILES: [OH-].[K+]
| CAS | 1310-58-3 |
|---|---|
| Molecular Weight (g/mol) | 56.11 |
| MDL Number | MFCD00003553 |
| SMILES | [OH-].[K+] |
| IUPAC Name | potassium hydroxide |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Molecular Formula | HKO |
Lithium nitrate, anhydrous, 99%
CAS: 7790-69-4 Molecular Formula: LiNO3 Molecular Weight (g/mol): 68.94 MDL Number: MFCD00011094 InChI Key: IIPYXGDZVMZOAP-UHFFFAOYSA-N Synonym: lithium nitrate,nitric acid, lithium salt,lithium nitrate, anhydrous,lithium 1+ ion nitronate,ksc492i7j,lithium nitrate 3-hydrate,lithium 1+ ion nitrate,lithium nitrate, anhydrous 25g,lithium nitrate, ionization buffer solution, specpure PubChem CID: 10129889 ChEBI: CHEBI:63315 SMILES: [Li+].[O-][N+]([O-])=O
| PubChem CID | 10129889 |
|---|---|
| CAS | 7790-69-4 |
| Molecular Weight (g/mol) | 68.94 |
| ChEBI | CHEBI:63315 |
| MDL Number | MFCD00011094 |
| SMILES | [Li+].[O-][N+]([O-])=O |
| Synonym | lithium nitrate,nitric acid, lithium salt,lithium nitrate, anhydrous,lithium 1+ ion nitronate,ksc492i7j,lithium nitrate 3-hydrate,lithium 1+ ion nitrate,lithium nitrate, anhydrous 25g,lithium nitrate, ionization buffer solution, specpure |
| InChI Key | IIPYXGDZVMZOAP-UHFFFAOYSA-N |
| Molecular Formula | LiNO3 |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |
Lithium bromide, anhydrous, 99% min
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.844 MDL Number: MFCD00011077 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Synonym: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| PubChem CID | 82050 |
|---|---|
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.844 |
| ChEBI | CHEBI:63042 |
| MDL Number | MFCD00011077 |
| SMILES | [Li+].[Br-] |
| Synonym | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
Zinc sulfate heptahydrate, ACS, 99.0-103.0%
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 IUPAC Name: zinc;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| IUPAC Name | zinc;sulfate;heptahydrate |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Lithium tetrafluoroborate, 98%
CAS: 14283-07-9 Molecular Formula: BF4Li Molecular Weight (g/mol): 93.74 MDL Number: MFCD00011087 InChI Key: UFXJWFBILHTTET-UHFFFAOYSA-N Synonym: lithium tetrafluoroborate,lithium fluoroborate,lithium tetra fluoroborate,lithium 1+ ion tetrafluoroborate,lithium borofluoride,unii-af751cnk2n,libf4,lithotab tetrafluoroborate,acmc-209cp3,af751cnk2n PubChem CID: 4298216 IUPAC Name: lithium;tetrafluoroborate SMILES: [Li+].F[B-](F)(F)F
| PubChem CID | 4298216 |
|---|---|
| CAS | 14283-07-9 |
| Molecular Weight (g/mol) | 93.74 |
| MDL Number | MFCD00011087 |
| SMILES | [Li+].F[B-](F)(F)F |
| Synonym | lithium tetrafluoroborate,lithium fluoroborate,lithium tetra fluoroborate,lithium 1+ ion tetrafluoroborate,lithium borofluoride,unii-af751cnk2n,libf4,lithotab tetrafluoroborate,acmc-209cp3,af751cnk2n |
| IUPAC Name | lithium;tetrafluoroborate |
| InChI Key | UFXJWFBILHTTET-UHFFFAOYSA-N |
| Molecular Formula | BF4Li |