missing translation for 'onlineSavingsMsg'
Learn More
Learn More
![Wright's Stain [for Microscopy and Bacteriology], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-68988-92-1.jpg-650.jpg)
![Wright's Stain [for Microscopy and Bacteriology], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
Wright's Stain [for Microscopy and Bacteriology], TCI America™
Supplier: TCI America W000125G
Specifications
| Wright′s Stain [for Microscopy and Bacteriology] | |
| C36H27Br4N3O5S+2 | |
| AXIKDPDWFVPGOD-UHFFFAOYSA-O | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;2-(2,4,5,7-tetrabromo-3,6-dihydroxyxanthen-10-ium-9-yl)benzoic acid | |
| 25113599 | |
| 25 g |
| 68988-92-1 | |
| MFCD00082143 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.C1=CC=C(C(=C1)C2=C3C=C(C(=C(C3=[O+]C4=C(C(=C(C=C24)Br)O)Br)Br)O)Br)C(=O)O | |
| 933.304 | |
| Black/Green | |
| Crystal/Powder |
Chemical Identifiers
| 68988-92-1 | |
| 933.304 | |
| AXIKDPDWFVPGOD-UHFFFAOYSA-O | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;2-(2,4,5,7-tetrabromo-3,6-dihydroxyxanthen-10-ium-9-yl)benzoic acid |
| C36H27Br4N3O5S+2 | |
| MFCD00082143 | |
| 25113599 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.C1=CC=C(C(=C1)C2=C3C=C(C(=C(C3=[O+]C4=C(C(=C(C=C24)Br)O)Br)Br)O)Br)C(=O)O |
Safety and Handling
TSCA : Yes