missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Strontium (Sr) Standard for AAS 2% Sr in 1% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010129100N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 92.29%,4.73%,0.98% | |
| 1.01 | |
| N2O6Sr | |
| Approximately 0°C | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 211.63 | |
| 24848 |
| 10042-76-9,10042-76-9,7732-18-5 | |
| 96.05%,4.93%,1.02% | |
| Liquid | |
| MFCD00011248 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate | |
| 100 mL | |
| High Purity |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate |
| N2O6Sr | |
| MFCD00011248 | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |