missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Palladium Standard for ICP 1000 ppm in 5% HCl, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010302250N
Description
- 1000 ppm in 5% HCl
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Spécifications
| Natural Poly Bottle | |
| 92.93%,4.90% | |
| 1 | |
| N2O6Pd | |
| UN3264 | |
| Standard | |
| [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 230.43 | |
| 24932 |
| 10102-05-3,7647-01-0,7732-18-5 | |
| 96.73%,5.10% | |
| Liquid | |
| MFCD00011169 | |
| Approximately 0°C | |
| GPNDARIEYHPYAY-UHFFFAOYSA-N | |
| palladium(2+) dinitrate | |
| 250 mL | |
| High Purity |
Identifiants chimiques
| 10102-05-3 | |
| 230.43 | |
| GPNDARIEYHPYAY-UHFFFAOYSA-N | |
| palladium(2+) dinitrate |
| N2O6Pd | |
| MFCD00011169 | |
| 24932 | |
| [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |