missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Mercury (Hg) Standard for AAS 1000 ppm in 10% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010024100C
Description
- 1000 ppm in 10% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Amber Glass Bottle | |
| 88.04%,9.80%,0.16% | |
| 1.02 | |
| HgN2O6 | |
| UN2031 | |
| ORMNPSYMZOGSSV-UHFFFAOYSA-N | |
| mercury(2+) dinitrate | |
| 100 mL | |
| High Purity |
| 10045-94-0,7697-37-2,7732-18-5 | |
| 91.64%,10.20%,0.16% | |
| Liquid | |
| MFCD00011038 | |
| Approximately 0°C | |
| [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 324.60 | |
| 24864 |
Chemical Identifiers
| 10045-94-0 | |
| 324.60 | |
| ORMNPSYMZOGSSV-UHFFFAOYSA-N | |
| mercury(2+) dinitrate |
| HgN2O6 | |
| MFCD00011038 | |
| 24864 | |
| [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |