missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Manganese Standard for ICP 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010343100N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 95.72%,1.96%,0.32% | |
| 1 | |
| MnN2O6 | |
| Standard | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2] | |
| 178.946 | |
| 61511 |
| 10377-66-9,7697-37-2,7732-18-5 | |
| 99.62%,2.04%,0.34% | |
| Liquid | |
| Approximately 0°C | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| manganese(2+);dinitrate | |
| 100 mL | |
| High Purity |
Chemical Identifiers
| 10377-66-9 | |
| 178.946 | |
| 61511 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2] |
| MnN2O6 | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| manganese(2+);dinitrate |