missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Magnesium - Mg2+ Standard for Ion Chromatography 1000 ppm in H2O, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Facility
Supplier: Ricca Chemical Company RV010923250N
Description
- 1000 ppm in H2O
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural Poly Bottle | |
| 97.40%,0.60% | |
| 1.01 | |
| MgN2O6 | |
| Approximately 0°C | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 148.31 | |
| 25212 | |
| High Purity |
| 10377-60-3 , 7732-18-5 | |
| 100%,0.62% | |
| Liquid | |
| MFCD00011103 | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| magnesium(2+) dinitrate | |
| 250 mL | |
| CHEBI:64736 |
Chemical Identifiers
| 10377-60-3 | |
| 148.31 | |
| YIXJRHPUWRPCBB-UHFFFAOYSA-N | |
| CHEBI:64736 | |
| [Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| MgN2O6 | |
| MFCD00011103 | |
| 25212 | |
| magnesium(2+) dinitrate |