missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Cobalt (Co) Standard for AAS 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010071100N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural LDPE Bottle | |
| 95.74%,1.96%,0.30% | |
| 1.013 | |
| CoN2O6 | |
| UFMZWBIQTDUYBN-UHFFFAOYSA-N | |
| cobalt(2+);dinitrate | |
| 100 mL | |
| CHEBI:86209 |
| 10141-05-6,7697-37-2,7732-18-5 | |
| 99.64%,2.04%,0.32% | |
| Liquid | |
| Approximately 0°C | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Co+2] | |
| 182.941 | |
| 25000 | |
| High Purity |
Chemical Identifiers
| 10141-05-6 | |
| 182.941 | |
| 25000 | |
| cobalt(2+);dinitrate |
| CoN2O6 | |
| UFMZWBIQTDUYBN-UHFFFAOYSA-N | |
| CHEBI:86209 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Co+2] |