missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Cadmium (Cd) Standard for AAS 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010069500N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural Poly Bottle | |
| 95.83%,1.96%,0.21% | |
| 1.01 | |
| CdN2O6 | |
| XIEPJMXMMWZAAV-UHFFFAOYSA-N | |
| cadmium(2+);dinitrate | |
| 500 mL | |
| CHEBI:77732 |
| 10325-94-7,7697-37-2,7732-18-5 | |
| 99.75%,2.04%,0.21% | |
| Liquid | |
| Approximately 0°C | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Cd+2] | |
| 236.422 | |
| 25154 | |
| High Purity |
Chemical Identifiers
| 10325-94-7 | |
| 236.422 | |
| 25154 | |
| cadmium(2+);dinitrate |
| CdN2O6 | |
| XIEPJMXMMWZAAV-UHFFFAOYSA-N | |
| CHEBI:77732 | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Cd+2] |