missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triphenylene, 98%
CAS: 217-59-4 | C18H12 | 228.29 g/mol
$177.83 - $177.83
Chemical Identifiers
| CAS | 217-59-4 |
|---|---|
| Molecular Formula | C18H12 |
| Molecular Weight (g/mol) | 228.29 |
| MDL Number | MFCD00001108 |
| InChI Key | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
| Synonym | 9,10-benzophenanthrene, isochrysene, 9,10-benzphenanthrene, benzo l phenanthrene, 1,2,3,4-dibenznaphthalene, benzophenanthrene, 1,2:3,4-dibenznaphthalene, ccris 1301, triphenylen-1-yl |
| PubChem CID | 9170 |
| ChEBI | CHEBI:33080 |
| IUPAC Name | triphenylene |
| SMILES | C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC140360010
|
Thermo Scientific Chemicals
140360010 |
1 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 217-59-4 | |
| 228.29 | |
| SLGBZMMZGDRARJ-UHFFFAOYSA-N | |
| 9170 | |
| triphenylene |
| C18H12 | |
| MFCD00001108 | |
| 9,10-benzophenanthrene, isochrysene, 9,10-benzphenanthrene, benzo l phenanthrene, 1,2,3,4-dibenznaphthalene, benzophenanthrene, 1,2:3,4-dibenznaphthalene, ccris 1301, triphenylen-1-yl | |
| CHEBI:33080 | |
| C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21 |
Specifications
| 217-59-4 | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00001108 | |
| 05, 720 | |
| 9,10-benzophenanthrene, isochrysene, 9,10-benzphenanthrene, benzo l phenanthrene, 1,2,3,4-dibenznaphthalene, benzophenanthrene, 1,2:3,4-dibenznaphthalene, ccris 1301, triphenylen-1-yl | |
| C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21 | |
| 228.29 | |
| CHEBI:33080 | |
| 98% | |
| Triphenylene, 98% |
| 196.0°C to 200.0°C | |
| 438.0°C | |
| 97.5% min. (HPLC) | |
| C18H12 | |
| 1 g | |
| 15, 9913 | |
| SLGBZMMZGDRARJ-UHFFFAOYSA-N | |
| triphenylene | |
| 9170 | |
| 228.29 | |
| Crystalline Needles |
Safety and Handling
GHS Signal Word: Danger
EINECSNumber : 205-922-9
RTECSNumber : YK2925000
RUO – Research Use Only