missing translation for 'onlineSavingsMsg'
Learn More
Learn More
trans-4-Hydroxystilbene, 98%
CAS: 6554-98-9 | C14H12O | 196.25 g/mol
Supplier: Thermo Scientific Chemicals 121930050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| trans-4-Hydroxystilbene | |
| 6554-98-9 | |
| 96.5% min. (HPLC) | |
| C14H12O | |
| MFCD00002386 | |
| 06,693 | |
| Solubility in water: insoluble. Other solubilities: soluble in acetone,chloroform,benzene,,soluble in acetic acid | |
| C1=CC=C(C=C1)C=CC2=CC=C(C=C2)O | |
| 196.25 | |
| CHEBI:35101 | |
| 98% |
| 98% | |
| 185°C to 189°C | |
| Glass Bottle | |
| C6H5CH=CHC6H4OH | |
| 5 g | |
| trans-4-hydroxystilbene, 4-hydroxystilbene, 4-styrylphenol, 4-stilbenol, e-4-stilbenol, 4-2-phenylethenyl phenol, 4-2-phenylvinyl phenol, 4-e-2-phenylethenyl phenol, e-4-hydroxystilbene, stilben-4-ol | |
| QVLMUEOXQBUPAH-VOTSOKGWSA-N | |
| 4-[(E)-2-phenylethenyl]phenol | |
| 5284650 | |
| 196.25 |
Chemical Identifiers
| 6554-98-9 | |
| 196.25 | |
| QVLMUEOXQBUPAH-VOTSOKGWSA-N | |
| 5284650 | |
| 4-[(E)-2-phenylethenyl]phenol |
| C14H12O | |
| MFCD00002386 | |
| trans-4-hydroxystilbene, 4-hydroxystilbene, 4-styrylphenol, 4-stilbenol, e-4-stilbenol, 4-2-phenylethenyl phenol, 4-2-phenylvinyl phenol, 4-e-2-phenylethenyl phenol, e-4-hydroxystilbene, stilben-4-ol | |
| CHEBI:35101 | |
| C1=CC=C(C=C1)C=CC2=CC=C(C=C2)O |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 229-483-8
RUO – Research Use Only