missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thymolphthalein Indicator, 0.1% (w/v) in 90% (v/v) Isopropyl Alcohol, Ricca Chemical
Supplier: Ricca Chemical Company RSOD1530100A
Specifications
| Thymolphthalein Indicator | |
| 125-20-2,67-63-0,7732-18-5 | |
| Solubility in Water: Infinite | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O | |
| 430.544 | |
| Characteristic alcohol odor | |
| Aqueous Solution |
| 0.1% (w/v) in 90% (v/v) Isopropyl Alcohols | |
| C28H30O4 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | |
| 31316 | |
| Natural Poly Bottle | |
| 100 mL |
Chemical Identifiers
| 125-20-2 | |
| 430.544 | |
| 31316 | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| C28H30O4 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |