missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thymolphthalein, ACS Reagent, Reagents
Thymolphthalein, ACS Reagent, ACS, for general laboratory use. Manufactured in ISO 9001 facility.
Supplier: Labchem Inc C233845010C1
| Quantity | 10 g |
|---|
Chemical Identifiers
| 125-20-2 | |
| 430.54 | |
| 5',5''-Diisopropyl-2',2''-dimethylphenolphthalein | |
| CC(C)C1=CC(=C(C)C=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C=C1C |
| C28H30O4 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-1,3-dihydro-2-benzofuran-1-one |
Specifications
| Thymolphthalein, ACS Reagent | |
| 125-20-2 | |
| 5',5''-Diisopropyl-2',2''-dimethylphenolphthalein | |
| CC(C)C1=CC(=C(C)C=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C=C1C | |
| 430.54 | |
| Glass Bottle | |
| Colorless (pH <8.8) to Pale, grayish-blue (pH 9.4) to Blue (pH 9.9) to Intense Blue (pH >10.5) | |
| Solid |
| 245°C | |
| C28H30O4 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-1,3-dihydro-2-benzofuran-1-one | |
| ACS | |
| 0.92 | |
| 10 g |