missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thymol Blue Indicator, 0.4% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company 84104
Specifications
| Thymol Blue Indicator | |
| 98.0,0.39 | |
| 0.4% (w/v) | |
| MFCD00151093 | |
| [Na+].CC(C)C1=C\C(=C(\C2=CC(C(C)C)=C(O)C=C2C)C2=C(C=CC=C2)S([O-])(=O)=O)C(C)=CC1=O | |
| 488.57 | |
| Natural Poly Bottle | |
| Green | |
| Liquid |
| 62625-21-2,7732-18-5 | |
| 100.0,0.41 | |
| C27H29NaO5S | |
| OCMIKNBSIRSUPI-FRWNMSGJSA-M | |
| sodium 2-{[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl][(1E)-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methyl}benzene-1-sulfonate | |
| 23692293 | |
| Aqueous Solution | |
| 120 mL |
Chemical Identifiers
| 62625-21-2 | |
| 488.57 | |
| OCMIKNBSIRSUPI-FRWNMSGJSA-M | |
| sodium 2-{[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl][(1E)-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methyl}benzene-1-sulfonate |
| C27H29NaO5S | |
| MFCD00151093 | |
| 23692293 | |
| [Na+].CC(C)C1=C\C(=C(\C2=CC(C(C)C)=C(O)C=C2C)C2=C(C=CC=C2)S([O-])(=O)=O)C(C)=CC1=O |