Learn More
Sulfosalicylic Acid, Certified, 20.0% (w/v) ±0.5%, LabChem™
Supplier: LabChem LC255451
Specifications
| Sulfosalicylic Acid | |
| 80,20 | |
| Amber Poly | |
| C7H6O6S·2H2O | |
| 500 mL | |
| Soluble in water | |
| C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O | |
| 250.27 | |
| 254.21 | |
| Certified |
| 5965-83-3,7732-18-5 | |
| Pink | |
| C9H14O6S | |
| MFCD00007508,MFCD00149540 | |
| 2-hydroxy-5-sulfobenzoic acid dihydrate, 5-sulfosalicylic acid dihydrate, sulfosalicylic acid dihydrate, benzoic acid, 2-hydroxy-5-sulfo-, dihydrate, unii-09ngq462s6, 2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate, 5-sulfosalicylsyre, 5-sulfosalicylsaeure, salicylic acid, 5-sulfo-, dihydrate, acmc-1aymd | |
| NFYHZVWMQHQKRU-UHFFFAOYSA-N | |
| 2-hydroxy-5-sulfobenzoic acid; bis(methane) | |
| 2723734 | |
| 20.0% ±0.5% (w/v) | |
| Liquid |
Chemical Identifiers
| 5965-83-3 | |
| 250.27 | |
| NFYHZVWMQHQKRU-UHFFFAOYSA-N | |
| 2723734 | |
| C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| C9H14O6S | |
| MFCD00007508,MFCD00149540 | |
| 2-hydroxy-5-sulfobenzoic acid dihydrate, 5-sulfosalicylic acid dihydrate, sulfosalicylic acid dihydrate, benzoic acid, 2-hydroxy-5-sulfo-, dihydrate, unii-09ngq462s6, 2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate, 5-sulfosalicylsyre, 5-sulfosalicylsaeure, salicylic acid, 5-sulfo-, dihydrate, acmc-1aymd | |
| 2-hydroxy-5-sulfobenzoic acid; bis(methane) |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust.
Use only outdoors or in a well-ventilated area.
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
If on skin: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
Take off contaminated clothing and wash before reuse.
If inhaled: Remove person to fresh air and keep comfortable for breathing.
Call a poison center/doctor if you feel unwell.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Store locked up in a well-ventilated place.
Keep container tightly closed.
Dispose of contents/container to comply with local, state and federal regulations.
Warning
Recommended Storage : Room Temperature