missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate TS, 7.5% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company R6041000100A
Specifications
| Potassium Dichromate 7.5% (w/v) Aqueous Solution | |
| Test Solution | |
| 91.0,6.84 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 7.5% | |
| Natural Poly Bottle | |
| ∼3.5 to 4 | |
| Liquid |
| Orange | |
| 7778-50-9,7732-18-5 | |
| 95.0,7.12 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Laboratory | |
| Aqueous Solution | |
| 100 mL | |
| 7.5% (w/v) |
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |