missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate TS, 7.5% (w/v), Ricca Chemical
$233.83 - $338.30
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
R6041000100
|
Ricca Chemical Company
R6041000100A |
100 mL | Natural Poly Bottle |
Each for $233.83
|
|
||||
|
6041-16
|
Ricca Chemical Company
604116 |
500 mL | Natural Poly Bottle |
Each for $338.30
|
|
||||
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| Orange | |
| 91.0,6.84 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 7.5% | |
| Natural Poly Bottle | |
| ∼3.5 to 4 | |
| Liquid | |
| Potassium Dichromate 7.5% (w/v) Aqueous Solution, Test Solution |
| 7778-50-9,7732-18-5 | |
| 95.0,7.12 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Laboratory | |
| Aqueous Solution | |
| 100 mL | |
| 7.5% (w/v) |